Phenol esters
- (6)
- (3)
- (2)
- (8)
- (2)
- (3)
- (4)
- (6)
- (14)
- (1)
- (3)
- (9)
- (1)
- (1)
- (1)
- (53)
- (2)
- (2)
- (1)
- (6)
- (3)
- (2)
- (16)
- (1)
- (6)
- (42)
- (58)
- (3)
- (2)
- (2)
- (1)
- (2)
- (1)
- (2)
- (2)
- (1)
- (1)
Filtered Search Results
4-Acetoxystyrene, 96%, stabilized with 200-300 ppm MEHQ, Thermo Scientific Chemicals
CAS: 2628-16-2 Molecular Formula: C10H10O2 Molecular Weight (g/mol): 162.19 MDL Number: MFCD00075734 InChI Key: JAMNSIXSLVPNLC-UHFFFAOYSA-N Synonym: 4-acetoxystyrene,4-vinylphenyl acetate,4-ethenylphenol acetate,p-acetoxystyrene,phenol, 4-ethenyl-, acetate,p-vinylphenol acetate,unii-7s21904ayn,phenol, 4-ethenyl-, 1-acetate,4-ethenylphenyl acetate,acetic acid 4-vinylphenyl ester PubChem CID: 75821 IUPAC Name: (4-ethenylphenyl) acetate SMILES: CC(=O)OC1=CC=C(C=C1)C=C
| PubChem CID | 75821 |
|---|---|
| CAS | 2628-16-2 |
| Molecular Weight (g/mol) | 162.19 |
| MDL Number | MFCD00075734 |
| SMILES | CC(=O)OC1=CC=C(C=C1)C=C |
| Synonym | 4-acetoxystyrene,4-vinylphenyl acetate,4-ethenylphenol acetate,p-acetoxystyrene,phenol, 4-ethenyl-, acetate,p-vinylphenol acetate,unii-7s21904ayn,phenol, 4-ethenyl-, 1-acetate,4-ethenylphenyl acetate,acetic acid 4-vinylphenyl ester |
| IUPAC Name | (4-ethenylphenyl) acetate |
| InChI Key | JAMNSIXSLVPNLC-UHFFFAOYSA-N |
| Molecular Formula | C10H10O2 |
4-Acetoxy-3-methoxybenzaldehyde, 98%
CAS: 881-68-5 Molecular Formula: C10H10O4 Molecular Weight (g/mol): 194.19 MDL Number: MFCD00003362 InChI Key: PZSJOBKRSVRODF-UHFFFAOYSA-N Synonym: vanillin acetate,4-acetoxy-3-methoxybenzaldehyde,acetovanillin,acetylvanillin,vanillin, acetate,4-o-acetylvanillin,o-acetylvanillin,benzaldehyde, 4-acetyloxy-3-methoxy,3-methoxy-4-acetoxybenzaldehyde,acetyl vanillin PubChem CID: 61229 ChEBI: CHEBI:86956 IUPAC Name: (4-formyl-2-methoxyphenyl) acetate SMILES: CC(=O)OC1=C(C=C(C=C1)C=O)OC
| PubChem CID | 61229 |
|---|---|
| CAS | 881-68-5 |
| Molecular Weight (g/mol) | 194.19 |
| ChEBI | CHEBI:86956 |
| MDL Number | MFCD00003362 |
| SMILES | CC(=O)OC1=C(C=C(C=C1)C=O)OC |
| Synonym | vanillin acetate,4-acetoxy-3-methoxybenzaldehyde,acetovanillin,acetylvanillin,vanillin, acetate,4-o-acetylvanillin,o-acetylvanillin,benzaldehyde, 4-acetyloxy-3-methoxy,3-methoxy-4-acetoxybenzaldehyde,acetyl vanillin |
| IUPAC Name | (4-formyl-2-methoxyphenyl) acetate |
| InChI Key | PZSJOBKRSVRODF-UHFFFAOYSA-N |
| Molecular Formula | C10H10O4 |
4-Nitrophenyl acetate, 97%
CAS: 830-03-5 Molecular Formula: C8H7NO4 Molecular Weight (g/mol): 181.15 MDL Number: MFCD00007326 InChI Key: QAUUDNIGJSLPSX-UHFFFAOYSA-N Synonym: p-nitrophenyl acetate,p-acetoxynitrobenzene,acetic acid, 4-nitrophenyl ester,p-nitrophenol acetate,acetic acid p-nitrophenyl ester,acetic acid, p-nitrophenyl ester,p-nitrophenyl acetate van,4-nitrophenyl acetate,unii-i902j0qh9s,acetic acid 4-nitrophenyl ester PubChem CID: 13243 ChEBI: CHEBI:82635 SMILES: CC(=O)OC1=CC=C(C=C1)[N+]([O-])=O
| PubChem CID | 13243 |
|---|---|
| CAS | 830-03-5 |
| Molecular Weight (g/mol) | 181.15 |
| ChEBI | CHEBI:82635 |
| MDL Number | MFCD00007326 |
| SMILES | CC(=O)OC1=CC=C(C=C1)[N+]([O-])=O |
| Synonym | p-nitrophenyl acetate,p-acetoxynitrobenzene,acetic acid, 4-nitrophenyl ester,p-nitrophenol acetate,acetic acid p-nitrophenyl ester,acetic acid, p-nitrophenyl ester,p-nitrophenyl acetate van,4-nitrophenyl acetate,unii-i902j0qh9s,acetic acid 4-nitrophenyl ester |
| InChI Key | QAUUDNIGJSLPSX-UHFFFAOYSA-N |
| Molecular Formula | C8H7NO4 |
1,4-Diacetoxybenzene, 98%
CAS: 1205-91-0 Molecular Formula: C10H10O4 Molecular Weight (g/mol): 194.19 MDL Number: MFCD00011643 InChI Key: AKOGNYJNGMLDOA-UHFFFAOYSA-N Synonym: 1,4-diacetoxybenzene,hydroquinone diacetate,p-diacetoxybenzene,1,4-benzenediol, diacetate,p-phenylene diacetate,hydroquinone, diacetate,4-acetyloxy phenyl acetate,1,4-phenylene diacetate,1,4-benzenediol, 1,4-diacetate,benzene-1,4-diyl diacetate PubChem CID: 71006 IUPAC Name: (4-acetyloxyphenyl) acetate SMILES: CC(=O)OC1=CC=C(OC(C)=O)C=C1
| PubChem CID | 71006 |
|---|---|
| CAS | 1205-91-0 |
| Molecular Weight (g/mol) | 194.19 |
| MDL Number | MFCD00011643 |
| SMILES | CC(=O)OC1=CC=C(OC(C)=O)C=C1 |
| Synonym | 1,4-diacetoxybenzene,hydroquinone diacetate,p-diacetoxybenzene,1,4-benzenediol, diacetate,p-phenylene diacetate,hydroquinone, diacetate,4-acetyloxy phenyl acetate,1,4-phenylene diacetate,1,4-benzenediol, 1,4-diacetate,benzene-1,4-diyl diacetate |
| IUPAC Name | (4-acetyloxyphenyl) acetate |
| InChI Key | AKOGNYJNGMLDOA-UHFFFAOYSA-N |
| Molecular Formula | C10H10O4 |
Phenyl acetate, 97%
CAS: 122-79-2 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 MDL Number: MFCD00008699 InChI Key: IPBVNPXQWQGGJP-UHFFFAOYSA-N Synonym: acetic acid phenyl ester,phenol acetate,acetylphenol,acetic acid, phenyl ester,acetyl phenol,acetoxybenzene,acetates,acetic acid,phenyl ester,fenylester kyseliny octove,fenylester kyseliny octove czech PubChem CID: 31229 ChEBI: CHEBI:8082 IUPAC Name: phenyl acetate SMILES: CC(=O)OC1=CC=CC=C1
| PubChem CID | 31229 |
|---|---|
| CAS | 122-79-2 |
| Molecular Weight (g/mol) | 136.15 |
| ChEBI | CHEBI:8082 |
| MDL Number | MFCD00008699 |
| SMILES | CC(=O)OC1=CC=CC=C1 |
| Synonym | acetic acid phenyl ester,phenol acetate,acetylphenol,acetic acid, phenyl ester,acetyl phenol,acetoxybenzene,acetates,acetic acid,phenyl ester,fenylester kyseliny octove,fenylester kyseliny octove czech |
| IUPAC Name | phenyl acetate |
| InChI Key | IPBVNPXQWQGGJP-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |
Phenyl acrylate, 97%
CAS: 937-41-7 Molecular Formula: C9H8O2 Molecular Weight (g/mol): 148.161 MDL Number: MFCD00048145 InChI Key: WRAQQYDMVSCOTE-UHFFFAOYSA-N Synonym: phenyl acrylate,phenylacrylate,2-propenoic acid, phenyl ester,phenol acrylate,phenyl-acrylate,acrylic acid phenyl ester,phenyl acrylate 5g,2-propenoic acid,phenyl ester,acrylic acid phenyl ester, stabilized with bht PubChem CID: 61242 IUPAC Name: phenyl prop-2-enoate SMILES: C=CC(=O)OC1=CC=CC=C1
| PubChem CID | 61242 |
|---|---|
| CAS | 937-41-7 |
| Molecular Weight (g/mol) | 148.161 |
| MDL Number | MFCD00048145 |
| SMILES | C=CC(=O)OC1=CC=CC=C1 |
| Synonym | phenyl acrylate,phenylacrylate,2-propenoic acid, phenyl ester,phenol acrylate,phenyl-acrylate,acrylic acid phenyl ester,phenyl acrylate 5g,2-propenoic acid,phenyl ester,acrylic acid phenyl ester, stabilized with bht |
| IUPAC Name | phenyl prop-2-enoate |
| InChI Key | WRAQQYDMVSCOTE-UHFFFAOYSA-N |
| Molecular Formula | C9H8O2 |
m-Tolyl acetate, 97%
CAS: 122-46-3 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00041910 InChI Key: OTGAHJPFNKQGAE-UHFFFAOYSA-N Synonym: m-tolyl acetate,m-cresyl acetate,cresatin,m-acetoxytoluene,m-cresol acetate,acetic acid m-tolyl ester,cresatin-sulzberger,kresatin,acetic acid, 3-methylphenyl ester,m-methylphenyl acetate PubChem CID: 67406 IUPAC Name: (3-methylphenyl) acetate SMILES: CC(=O)OC1=CC=CC(C)=C1
| PubChem CID | 67406 |
|---|---|
| CAS | 122-46-3 |
| Molecular Weight (g/mol) | 150.18 |
| MDL Number | MFCD00041910 |
| SMILES | CC(=O)OC1=CC=CC(C)=C1 |
| Synonym | m-tolyl acetate,m-cresyl acetate,cresatin,m-acetoxytoluene,m-cresol acetate,acetic acid m-tolyl ester,cresatin-sulzberger,kresatin,acetic acid, 3-methylphenyl ester,m-methylphenyl acetate |
| IUPAC Name | (3-methylphenyl) acetate |
| InChI Key | OTGAHJPFNKQGAE-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
4-Acetoxybenzeneboronic acid, 97%, Thermo Scientific Chemicals
CAS: 177490-82-3 Molecular Formula: C8H9BO4 Molecular Weight (g/mol): 179.97 MDL Number: MFCD09027198 InChI Key: VILXJXDXZGKJLU-UHFFFAOYSA-N Synonym: 4-acetoxyphenyl boronic acid,4-acetoxyphenylboronic acid,4-acetoxybenzeneboronic acid,4-acetyloxy phenylboronic acid,boronic acid, 4-acetyloxy phenyl,boronic acid,b-4-acetyloxy phenyl,4-boronophenyl acetate,pubchem20170,acmc-209ecy,4-acetoxyphenyl boronicacid PubChem CID: 44119577 IUPAC Name: (4-acetyloxyphenyl)boronic acid SMILES: CC(=O)OC1=CC=C(C=C1)B(O)O
| PubChem CID | 44119577 |
|---|---|
| CAS | 177490-82-3 |
| Molecular Weight (g/mol) | 179.97 |
| MDL Number | MFCD09027198 |
| SMILES | CC(=O)OC1=CC=C(C=C1)B(O)O |
| Synonym | 4-acetoxyphenyl boronic acid,4-acetoxyphenylboronic acid,4-acetoxybenzeneboronic acid,4-acetyloxy phenylboronic acid,boronic acid, 4-acetyloxy phenyl,boronic acid,b-4-acetyloxy phenyl,4-boronophenyl acetate,pubchem20170,acmc-209ecy,4-acetoxyphenyl boronicacid |
| IUPAC Name | (4-acetyloxyphenyl)boronic acid |
| InChI Key | VILXJXDXZGKJLU-UHFFFAOYSA-N |
| Molecular Formula | C8H9BO4 |
4-Acetoxy-3-methoxybenzaldehyde, 98%
CAS: 881-68-5 Molecular Formula: C10H10O4 Molecular Weight (g/mol): 194.186 MDL Number: MFCD00003362 InChI Key: PZSJOBKRSVRODF-UHFFFAOYSA-N Synonym: vanillin acetate,4-acetoxy-3-methoxybenzaldehyde,acetovanillin,acetylvanillin,vanillin, acetate,4-o-acetylvanillin,o-acetylvanillin,benzaldehyde, 4-acetyloxy-3-methoxy,3-methoxy-4-acetoxybenzaldehyde,acetyl vanillin PubChem CID: 61229 ChEBI: CHEBI:86956 IUPAC Name: (4-formyl-2-methoxyphenyl) acetate SMILES: CC(=O)OC1=C(C=C(C=C1)C=O)OC
| PubChem CID | 61229 |
|---|---|
| CAS | 881-68-5 |
| Molecular Weight (g/mol) | 194.186 |
| ChEBI | CHEBI:86956 |
| MDL Number | MFCD00003362 |
| SMILES | CC(=O)OC1=C(C=C(C=C1)C=O)OC |
| Synonym | vanillin acetate,4-acetoxy-3-methoxybenzaldehyde,acetovanillin,acetylvanillin,vanillin, acetate,4-o-acetylvanillin,o-acetylvanillin,benzaldehyde, 4-acetyloxy-3-methoxy,3-methoxy-4-acetoxybenzaldehyde,acetyl vanillin |
| IUPAC Name | (4-formyl-2-methoxyphenyl) acetate |
| InChI Key | PZSJOBKRSVRODF-UHFFFAOYSA-N |
| Molecular Formula | C10H10O4 |
Pentafluorophenyl trifluoroacetate, 98+%
CAS: 14533-84-7 Molecular Formula: C8F8O2 Molecular Weight (g/mol): 280.07 MDL Number: MFCD00134438 InChI Key: VCQURUZYYSOUHP-UHFFFAOYSA-N Synonym: pentafluorophenyl trifluoroacetate,perfluorophenyl 2,2,2-trifluoroacetate,trifluoroacetic acid pentafluorophenyl ester,pentafluorphenyl trifluoracetate,pentafluorophenyltrifluoroacetate,pentafluorophenyl 2,2,2-trifluoroacetate,acetic acid, trifluoro-, pentafluorophenyl ester,acetic acid,2,2,2-trifluoro-, 2,3,4,5,6-pentafluorophenyl ester,ambotzrl-1046,acmc-1bui8 PubChem CID: 4327891 IUPAC Name: (2,3,4,5,6-pentafluorophenyl) 2,2,2-trifluoroacetate SMILES: FC1=C(F)C(F)=C(OC(=O)C(F)(F)F)C(F)=C1F
| PubChem CID | 4327891 |
|---|---|
| CAS | 14533-84-7 |
| Molecular Weight (g/mol) | 280.07 |
| MDL Number | MFCD00134438 |
| SMILES | FC1=C(F)C(F)=C(OC(=O)C(F)(F)F)C(F)=C1F |
| Synonym | pentafluorophenyl trifluoroacetate,perfluorophenyl 2,2,2-trifluoroacetate,trifluoroacetic acid pentafluorophenyl ester,pentafluorphenyl trifluoracetate,pentafluorophenyltrifluoroacetate,pentafluorophenyl 2,2,2-trifluoroacetate,acetic acid, trifluoro-, pentafluorophenyl ester,acetic acid,2,2,2-trifluoro-, 2,3,4,5,6-pentafluorophenyl ester,ambotzrl-1046,acmc-1bui8 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2,2,2-trifluoroacetate |
| InChI Key | VCQURUZYYSOUHP-UHFFFAOYSA-N |
| Molecular Formula | C8F8O2 |
4-Acetoxystyrene, 95%, stab.
CAS: 2628-16-2 Molecular Formula: C10H10O2 Molecular Weight (g/mol): 162.188 MDL Number: MFCD00075734 InChI Key: JAMNSIXSLVPNLC-UHFFFAOYSA-N Synonym: 4-acetoxystyrene,4-vinylphenyl acetate,4-ethenylphenol acetate,p-acetoxystyrene,phenol, 4-ethenyl-, acetate,p-vinylphenol acetate,unii-7s21904ayn,phenol, 4-ethenyl-, 1-acetate,4-ethenylphenyl acetate,acetic acid 4-vinylphenyl ester PubChem CID: 75821 IUPAC Name: (4-ethenylphenyl) acetate SMILES: CC(=O)OC1=CC=C(C=C1)C=C
| PubChem CID | 75821 |
|---|---|
| CAS | 2628-16-2 |
| Molecular Weight (g/mol) | 162.188 |
| MDL Number | MFCD00075734 |
| SMILES | CC(=O)OC1=CC=C(C=C1)C=C |
| Synonym | 4-acetoxystyrene,4-vinylphenyl acetate,4-ethenylphenol acetate,p-acetoxystyrene,phenol, 4-ethenyl-, acetate,p-vinylphenol acetate,unii-7s21904ayn,phenol, 4-ethenyl-, 1-acetate,4-ethenylphenyl acetate,acetic acid 4-vinylphenyl ester |
| IUPAC Name | (4-ethenylphenyl) acetate |
| InChI Key | JAMNSIXSLVPNLC-UHFFFAOYSA-N |
| Molecular Formula | C10H10O2 |
4-Methoxyphenyl trans-4-n-pentylcyclohexanecarboxylate, 97%, Thermo Scientific™
CAS: 67589-52-0 Molecular Formula: C19H28O3 Molecular Weight (g/mol): 304.43 MDL Number: MFCD11053432 InChI Key: HJIVFZUPTYADSP-UHFFFAOYSA-N Synonym: cyclohexanecarboxylic acid, 4-pentyl-, 4-methoxyphenyl ester, trans,trans-4-methoxyphenyl 4-pentylcyclohexanecarboxylate,trans-4-methoxy-phenyl 4-pentyl-cyclohexanecarboxylate,trans-4-pentylcyclohexanecarboxylic acid, 4-methoxyphenyl ester,4-methoxyphenyl trans-4-pentylcyclohexanoate,4-methoxyphenyl 4-pentylcyclohexanecarboxylate,4-methoxyphenyl trans-4-pentylcyclohexanecarboxylate,hjivfzuptyadsp-wkilwmfisa-n,4-methoxyphenyl 4-pentylcyclohexanecarboxylate #,4-methoxyphenyl 4-pentylcyclohexane-1-carboxylate PubChem CID: 105460 IUPAC Name: (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate SMILES: CCCCCC1CCC(CC1)C(=O)OC2=CC=C(C=C2)OC
| PubChem CID | 105460 |
|---|---|
| CAS | 67589-52-0 |
| Molecular Weight (g/mol) | 304.43 |
| MDL Number | MFCD11053432 |
| SMILES | CCCCCC1CCC(CC1)C(=O)OC2=CC=C(C=C2)OC |
| Synonym | cyclohexanecarboxylic acid, 4-pentyl-, 4-methoxyphenyl ester, trans,trans-4-methoxyphenyl 4-pentylcyclohexanecarboxylate,trans-4-methoxy-phenyl 4-pentyl-cyclohexanecarboxylate,trans-4-pentylcyclohexanecarboxylic acid, 4-methoxyphenyl ester,4-methoxyphenyl trans-4-pentylcyclohexanoate,4-methoxyphenyl 4-pentylcyclohexanecarboxylate,4-methoxyphenyl trans-4-pentylcyclohexanecarboxylate,hjivfzuptyadsp-wkilwmfisa-n,4-methoxyphenyl 4-pentylcyclohexanecarboxylate #,4-methoxyphenyl 4-pentylcyclohexane-1-carboxylate |
| IUPAC Name | (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate |
| InChI Key | HJIVFZUPTYADSP-UHFFFAOYSA-N |
| Molecular Formula | C19H28O3 |
Phenyl bromoacetate, 98%
CAS: 620-72-4 Molecular Formula: C8H7BrO2 Molecular Weight (g/mol): 215.046 MDL Number: MFCD00192391 InChI Key: UEWYUCGVQMZMGY-UHFFFAOYSA-N Synonym: phenyl bromoacetate,acetic acid, bromo-, phenyl ester,bromoacetic acid phenyl ester,bromoacetic acid, phenyl ester,phenylbromessigester,phenyl bromoacetate #,acmc-209mzb,phenyl 2-bromanylethanoate,ksc352o8b PubChem CID: 564919 IUPAC Name: phenyl 2-bromoacetate SMILES: C1=CC=C(C=C1)OC(=O)CBr
| PubChem CID | 564919 |
|---|---|
| CAS | 620-72-4 |
| Molecular Weight (g/mol) | 215.046 |
| MDL Number | MFCD00192391 |
| SMILES | C1=CC=C(C=C1)OC(=O)CBr |
| Synonym | phenyl bromoacetate,acetic acid, bromo-, phenyl ester,bromoacetic acid phenyl ester,bromoacetic acid, phenyl ester,phenylbromessigester,phenyl bromoacetate #,acmc-209mzb,phenyl 2-bromanylethanoate,ksc352o8b |
| IUPAC Name | phenyl 2-bromoacetate |
| InChI Key | UEWYUCGVQMZMGY-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrO2 |
4-Nitrophenyl palmitate, 98+%
CAS: 1492-30-4 Molecular Formula: C22H35NO4 Molecular Weight (g/mol): 377.525 MDL Number: MFCD00047732 InChI Key: LVZSQWIWCANHPF-UHFFFAOYSA-N Synonym: 4-nitrophenyl palmitate,p-nitrophenyl palmitate,hexadecanoic acid 4-nitrophenyl ester,4-nitrophenyl hexadecanoate,hexadecanoic acid, 4-nitrophenyl ester,4-nitrophenylpalmitate,paranitrophenyl palmitate,para-nitrophenyl palmitate,p-nitrophenyl hexadecanoate,4-nitrophenyl palmitate # PubChem CID: 73891 ChEBI: CHEBI:85645 IUPAC Name: (4-nitrophenyl) hexadecanoate SMILES: CCCCCCCCCCCCCCCC(=O)OC1=CC=C(C=C1)[N+](=O)[O-]
| PubChem CID | 73891 |
|---|---|
| CAS | 1492-30-4 |
| Molecular Weight (g/mol) | 377.525 |
| ChEBI | CHEBI:85645 |
| MDL Number | MFCD00047732 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
| Synonym | 4-nitrophenyl palmitate,p-nitrophenyl palmitate,hexadecanoic acid 4-nitrophenyl ester,4-nitrophenyl hexadecanoate,hexadecanoic acid, 4-nitrophenyl ester,4-nitrophenylpalmitate,paranitrophenyl palmitate,para-nitrophenyl palmitate,p-nitrophenyl hexadecanoate,4-nitrophenyl palmitate # |
| IUPAC Name | (4-nitrophenyl) hexadecanoate |
| InChI Key | LVZSQWIWCANHPF-UHFFFAOYSA-N |
| Molecular Formula | C22H35NO4 |
Sodium 4-(tert-butylcarbonyloxy)benzenesulfonate, 95%
CAS: 188114-91-2 Molecular Formula: C11H13NaO5S Molecular Weight (g/mol): 280.27 MDL Number: MFCD09859793 InChI Key: YJWRXNUCTLGRAC-UHFFFAOYSA-M Synonym: sodium 4-pivaloyloxy benzenesulfonate,sodium 4-tert-butylcarbonyloxy-benzensulfonate,sodium 4-t-butylcarbonyloxy-benzensulfonate,sodium 4-t-butylcarbonyloxy benzensulfonate,sodium 4-2,2-dimethylpropanoyl oxy benzenesulfonate,sodium 4-t-butylcarbonyloxy-benzensulf...,4-pivaloyloxy benzenesulfonic acid sodium salt,2,2-dimethylpropanoic acid 4-sulfophenyl ester sodium salt,sodium 4-2,2-dimethylpropanoyl oxy benzene-1-sulfonate,propanoic acid, 2,2-dimethyl-, 4-sulfophenyl ester, sodium salt 1:1 PubChem CID: 23717480 IUPAC Name: sodium;4-(2,2-dimethylpropanoyloxy)benzenesulfonate SMILES: CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)[O-].[Na+]
| PubChem CID | 23717480 |
|---|---|
| CAS | 188114-91-2 |
| Molecular Weight (g/mol) | 280.27 |
| MDL Number | MFCD09859793 |
| SMILES | CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)[O-].[Na+] |
| Synonym | sodium 4-pivaloyloxy benzenesulfonate,sodium 4-tert-butylcarbonyloxy-benzensulfonate,sodium 4-t-butylcarbonyloxy-benzensulfonate,sodium 4-t-butylcarbonyloxy benzensulfonate,sodium 4-2,2-dimethylpropanoyl oxy benzenesulfonate,sodium 4-t-butylcarbonyloxy-benzensulf...,4-pivaloyloxy benzenesulfonic acid sodium salt,2,2-dimethylpropanoic acid 4-sulfophenyl ester sodium salt,sodium 4-2,2-dimethylpropanoyl oxy benzene-1-sulfonate,propanoic acid, 2,2-dimethyl-, 4-sulfophenyl ester, sodium salt 1:1 |
| IUPAC Name | sodium;4-(2,2-dimethylpropanoyloxy)benzenesulfonate |
| InChI Key | YJWRXNUCTLGRAC-UHFFFAOYSA-M |
| Molecular Formula | C11H13NaO5S |