Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Manganese(II) methoxide
CAS: 7245-20-7 Molecular Formula: C2H6MnO2 Molecular Weight (g/mol): 117.006 MDL Number: MFCD00061476 InChI Key: UQIRCVPINUNHQY-UHFFFAOYSA-N Synonym: manganese ii methoxide,acmc-20akkm,dimethoxymanganese ii,manganese ii bis methoxide,manganese 2+ bis methoxide,manganese 2+ ion bis methoxide PubChem CID: 10219413 IUPAC Name: manganese(2+);methanolate SMILES: C[O-].C[O-].[Mn+2]
| PubChem CID | 10219413 |
|---|---|
| CAS | 7245-20-7 |
| Molecular Weight (g/mol) | 117.006 |
| MDL Number | MFCD00061476 |
| SMILES | C[O-].C[O-].[Mn+2] |
| Synonym | manganese ii methoxide,acmc-20akkm,dimethoxymanganese ii,manganese ii bis methoxide,manganese 2+ bis methoxide,manganese 2+ ion bis methoxide |
| IUPAC Name | manganese(2+);methanolate |
| InChI Key | UQIRCVPINUNHQY-UHFFFAOYSA-N |
| Molecular Formula | C2H6MnO2 |
Manganese(II) phthalocyanine
CAS: 14325-24-7 Molecular Formula: C32H16MnN8 Molecular Weight (g/mol): 567.474 MDL Number: MFCD00049821 InChI Key: ICIFYHOILPYQKB-UHFFFAOYSA-N PubChem CID: 6508743 SMILES: C1=CC=C2C(=C1)C3=NC4=C5C=CC=CC5=C([N-]4)N=C6C7=CC=CC=C7C(=N6)N=C8C9=CC=CC=C9C(=N8)N=C2[N-]3.[Mn+2]
| PubChem CID | 6508743 |
|---|---|
| CAS | 14325-24-7 |
| Molecular Weight (g/mol) | 567.474 |
| MDL Number | MFCD00049821 |
| SMILES | C1=CC=C2C(=C1)C3=NC4=C5C=CC=CC5=C([N-]4)N=C6C7=CC=CC=C7C(=N6)N=C8C9=CC=CC=C9C(=N8)N=C2[N-]3.[Mn+2] |
| InChI Key | ICIFYHOILPYQKB-UHFFFAOYSA-N |
| Molecular Formula | C32H16MnN8 |
Manganese(III)acetylacetonate, 97%
CAS: 14284-89-0 Molecular Formula: C15H21MnO6 Molecular Weight (g/mol): 352.27 MDL Number: MFCD00000023 InChI Key: HYZQBNDRDQEWAN-LNTINUHCSA-K Synonym: mn iii acetylacetonate,tris acetylacetonato manganese iii PubChem CID: 122130696 IUPAC Name: manganese(3+);(E)-4-oxopent-2-en-2-olate SMILES: [Mn+3].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
| PubChem CID | 122130696 |
|---|---|
| CAS | 14284-89-0 |
| Molecular Weight (g/mol) | 352.27 |
| MDL Number | MFCD00000023 |
| SMILES | [Mn+3].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | mn iii acetylacetonate,tris acetylacetonato manganese iii |
| IUPAC Name | manganese(3+);(E)-4-oxopent-2-en-2-olate |
| InChI Key | HYZQBNDRDQEWAN-LNTINUHCSA-K |
| Molecular Formula | C15H21MnO6 |
Manganese(II) 2,4-pentanedionate
CAS: 14024-58-9 Molecular Formula: C10H14MnO4 Molecular Weight (g/mol): 253.16 MDL Number: MFCD00000022 MFCD09998212 InChI Key: ZQZQURFYFJBOCE-FDGPNNRMSA-L Synonym: bis 4-hydroxypent-3-en-2-one dihydrate manganese PubChem CID: 54669727 IUPAC Name: (Z)-4-hydroxypent-3-en-2-one;manganese;dihydrate SMILES: [Mn++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
| PubChem CID | 54669727 |
|---|---|
| CAS | 14024-58-9 |
| Molecular Weight (g/mol) | 253.16 |
| MDL Number | MFCD00000022 MFCD09998212 |
| SMILES | [Mn++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | bis 4-hydroxypent-3-en-2-one dihydrate manganese |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;manganese;dihydrate |
| InChI Key | ZQZQURFYFJBOCE-FDGPNNRMSA-L |
| Molecular Formula | C10H14MnO4 |
Manganese(III) 2,4-pentanedionate
CAS: 14284-89-0 Molecular Formula: C15H21MnO6 Molecular Weight (g/mol): 352.27 MDL Number: MFCD00000023 InChI Key: HYZQBNDRDQEWAN-LNTINUHCSA-K Synonym: mn iii acetylacetonate,tris acetylacetonato manganese iii PubChem CID: 122130696 IUPAC Name: manganese(3+);(E)-4-oxopent-2-en-2-olate SMILES: [Mn+3].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
| PubChem CID | 122130696 |
|---|---|
| CAS | 14284-89-0 |
| Molecular Weight (g/mol) | 352.27 |
| MDL Number | MFCD00000023 |
| SMILES | [Mn+3].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | mn iii acetylacetonate,tris acetylacetonato manganese iii |
| IUPAC Name | manganese(3+);(E)-4-oxopent-2-en-2-olate |
| InChI Key | HYZQBNDRDQEWAN-LNTINUHCSA-K |
| Molecular Formula | C15H21MnO6 |
Manganese(II) acetate, anhydrous, 98+%
CAS: 638-38-0 Molecular Formula: C4H6MnO4 Molecular Weight (g/mol): 173.03 MDL Number: MFCD00013039 InChI Key: UOGMEBQRZBEZQT-UHFFFAOYSA-L Synonym: manganese ii acetate,manganese acetate,manganous acetate,diacetylmanganese,manganese diacetate,manganese di acetate,manganese 2+ acetate,octan manganaty czech,acetic acid, manganese 2+ salt,unii-0v6e9q2i0y PubChem CID: 12525 IUPAC Name: manganese(2+);diacetate SMILES: [Mn++].CC([O-])=O.CC([O-])=O
| PubChem CID | 12525 |
|---|---|
| CAS | 638-38-0 |
| Molecular Weight (g/mol) | 173.03 |
| MDL Number | MFCD00013039 |
| SMILES | [Mn++].CC([O-])=O.CC([O-])=O |
| Synonym | manganese ii acetate,manganese acetate,manganous acetate,diacetylmanganese,manganese diacetate,manganese di acetate,manganese 2+ acetate,octan manganaty czech,acetic acid, manganese 2+ salt,unii-0v6e9q2i0y |
| IUPAC Name | manganese(2+);diacetate |
| InChI Key | UOGMEBQRZBEZQT-UHFFFAOYSA-L |
| Molecular Formula | C4H6MnO4 |
Ethylenediaminetetraacetic acid manganese disodium salt hydrate
CAS: 15375-84-5 Molecular Formula: C10H12MnN2Na2O8 Molecular Weight (g/mol): 389.13 MDL Number: MFCD00661156 InChI Key: ZQHKAIDDHTYINE-UHFFFAOYSA-J Synonym: disodium manganese edta,edta disodium manganese salt,disodium manganese ethylenediaminetetraacetate,manganese disodium ethylene diamine tetraacetate,ethylenediaminetetraacetic acid, disodium manganese salt,disodium ethylenedinitrilo tetraacetato manganese,manganate 2-, disodium,glycine,n'-1,2-ethanediylbis n-carboxymethyl-, manganese disodium salt,manganate 2-,n'-1,2-ethanediylbis n-carboxymethyl glycinato 4--n,n',o,o',on,on'-, disodium, oc-6-21 PubChem CID: 5148022 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;manganese(2+) SMILES: [Na+].[Na+].[Mn++].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 5148022 |
|---|---|
| CAS | 15375-84-5 |
| Molecular Weight (g/mol) | 389.13 |
| MDL Number | MFCD00661156 |
| SMILES | [Na+].[Na+].[Mn++].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O |
| Synonym | disodium manganese edta,edta disodium manganese salt,disodium manganese ethylenediaminetetraacetate,manganese disodium ethylene diamine tetraacetate,ethylenediaminetetraacetic acid, disodium manganese salt,disodium ethylenedinitrilo tetraacetato manganese,manganate 2-, disodium,glycine,n'-1,2-ethanediylbis n-carboxymethyl-, manganese disodium salt,manganate 2-,n'-1,2-ethanediylbis n-carboxymethyl glycinato 4--n,n',o,o',on,on'-, disodium, oc-6-21 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;manganese(2+) |
| InChI Key | ZQHKAIDDHTYINE-UHFFFAOYSA-J |
| Molecular Formula | C10H12MnN2Na2O8 |
Manganese(II) acetate tetrahydrate, Mn 22% (typical)
CAS: 6156-78-1 Molecular Formula: C4H14MnO8 Molecular Weight (g/mol): 245.09 MDL Number: MFCD00062552 InChI Key: CESXSDZNZGSWSP-UHFFFAOYSA-L Synonym: manganese ii acetate tetrahydrate,manganese acetate tetrahydrate,manganous acetate tetrahydrate,unii-9to51d176n,manganese diacetate, tetrahydrate,manganese 2+ diacetate tetrahydrate,acetic acid, manganese 2+ salt, tetrahydrate,manganese ii acetatetetrahydrate,acmc-20akkp PubChem CID: 93021 IUPAC Name: manganese(2+);diacetate;tetrahydrate SMILES: O.O.O.O.[Mn++].CC([O-])=O.CC([O-])=O
| PubChem CID | 93021 |
|---|---|
| CAS | 6156-78-1 |
| Molecular Weight (g/mol) | 245.09 |
| MDL Number | MFCD00062552 |
| SMILES | O.O.O.O.[Mn++].CC([O-])=O.CC([O-])=O |
| Synonym | manganese ii acetate tetrahydrate,manganese acetate tetrahydrate,manganous acetate tetrahydrate,unii-9to51d176n,manganese diacetate, tetrahydrate,manganese 2+ diacetate tetrahydrate,acetic acid, manganese 2+ salt, tetrahydrate,manganese ii acetatetetrahydrate,acmc-20akkp |
| IUPAC Name | manganese(2+);diacetate;tetrahydrate |
| InChI Key | CESXSDZNZGSWSP-UHFFFAOYSA-L |
| Molecular Formula | C4H14MnO8 |
Manganese(II) oxalate dihydrate, Mn 30% min
CAS: 6556-16-7 Molecular Formula: C2H4MnO6 Molecular Weight (g/mol): 178.986 MDL Number: MFCD00150452 InChI Key: HDJUVFZHZGPHCQ-UHFFFAOYSA-L Synonym: manganese ii oxalate 2-hydrate PubChem CID: 131882857 IUPAC Name: manganese(2+);oxalate;dihydrate SMILES: C(=O)(C(=O)[O-])[O-].O.O.[Mn+2]
| PubChem CID | 131882857 |
|---|---|
| CAS | 6556-16-7 |
| Molecular Weight (g/mol) | 178.986 |
| MDL Number | MFCD00150452 |
| SMILES | C(=O)(C(=O)[O-])[O-].O.O.[Mn+2] |
| Synonym | manganese ii oxalate 2-hydrate |
| IUPAC Name | manganese(2+);oxalate;dihydrate |
| InChI Key | HDJUVFZHZGPHCQ-UHFFFAOYSA-L |
| Molecular Formula | C2H4MnO6 |
Bis(pentamethylcyclopentadienyl)manganese, 98%, Thermo Scientific Chemicals
CAS: 67506-86-9 MDL Number: MFCD00058844 Synonym: Decamethylmanganocene
| CAS | 67506-86-9 |
|---|---|
| MDL Number | MFCD00058844 |
| Synonym | Decamethylmanganocene |
Manganese(II) Bis(trifluoromethanesulfonyl)imide 98.0+%, TCI America™
CAS: 207861-55-0 Molecular Formula: C4F12MnN2O8S4 Molecular Weight (g/mol): 615.209 MDL Number: MFCD23380173 InChI Key: NNWDGVNRIAAYMY-UHFFFAOYSA-N Synonym: manganese bis-trifluoromethanesulfonimide PubChem CID: 134159301 IUPAC Name: bis(trifluoromethylsulfonyl)azanide;manganese(2+) SMILES: C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[Mn+2]
| PubChem CID | 134159301 |
|---|---|
| CAS | 207861-55-0 |
| Molecular Weight (g/mol) | 615.209 |
| MDL Number | MFCD23380173 |
| SMILES | C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[Mn+2] |
| Synonym | manganese bis-trifluoromethanesulfonimide |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;manganese(2+) |
| InChI Key | NNWDGVNRIAAYMY-UHFFFAOYSA-N |
| Molecular Formula | C4F12MnN2O8S4 |
Tris(2,4-pentanedionato)manganese(III) 98.0+%, TCI America™
CAS: 14284-89-0 Molecular Formula: C15H21MnO6 Molecular Weight (g/mol): 352.27 MDL Number: MFCD00000023 InChI Key: HYZQBNDRDQEWAN-LNTINUHCSA-K Synonym: mn iii acetylacetonate,tris acetylacetonato manganese iii PubChem CID: 122130696 IUPAC Name: manganese(3+) tris((2Z)-4-oxopent-2-en-2-olate) SMILES: [Mn+3].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
| PubChem CID | 122130696 |
|---|---|
| CAS | 14284-89-0 |
| Molecular Weight (g/mol) | 352.27 |
| MDL Number | MFCD00000023 |
| SMILES | [Mn+3].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | mn iii acetylacetonate,tris acetylacetonato manganese iii |
| IUPAC Name | manganese(3+) tris((2Z)-4-oxopent-2-en-2-olate) |
| InChI Key | HYZQBNDRDQEWAN-LNTINUHCSA-K |
| Molecular Formula | C15H21MnO6 |
Bis(hexafluoroacetylacetonato)manganese(II) Hydrate 95.0+%, TCI America™
CAS: 19648-86-3 Molecular Formula: C10H4F12MnO4 Molecular Weight (g/mol): 471.06 MDL Number: MFCD00042513 InChI Key: DMABZFSNYKYMMQ-UHFFFAOYSA-N Synonym: Hexafluoroacetylacetono Manganese(II) Salt, Manganese(II) Hexafluoroacetylacetonate PubChem CID: 91658961 IUPAC Name: bis(1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one) manganese SMILES: [Mn].OC(=CC(=O)C(F)(F)F)C(F)(F)F.OC(=CC(=O)C(F)(F)F)C(F)(F)F
| PubChem CID | 91658961 |
|---|---|
| CAS | 19648-86-3 |
| Molecular Weight (g/mol) | 471.06 |
| MDL Number | MFCD00042513 |
| SMILES | [Mn].OC(=CC(=O)C(F)(F)F)C(F)(F)F.OC(=CC(=O)C(F)(F)F)C(F)(F)F |
| Synonym | Hexafluoroacetylacetono Manganese(II) Salt, Manganese(II) Hexafluoroacetylacetonate |
| IUPAC Name | bis(1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one) manganese |
| InChI Key | DMABZFSNYKYMMQ-UHFFFAOYSA-N |
| Molecular Formula | C10H4F12MnO4 |
Manganese Naphthenate (Mn ca. 6%), TCI America™
CAS: 1336-93-2 Molecular Formula: C22H14MnO4 Molecular Weight (g/mol): 397.288 MDL Number: MFCD00147533 InChI Key: SGGOJYZMTYGPCH-UHFFFAOYSA-L Synonym: manganese ii naphthenate w/w in mineral spirits mn,manganese ii bis 2-naphthoate,manganese 2+ ;naphthalene-2-carboxylate,manganese 2+ bis 2-naphthoate PubChem CID: 25021872 IUPAC Name: manganese(2+);naphthalene-2-carboxylate SMILES: C1=CC=C2C=C(C=CC2=C1)C(=O)[O-].C1=CC=C2C=C(C=CC2=C1)C(=O)[O-].[Mn+2]
| PubChem CID | 25021872 |
|---|---|
| CAS | 1336-93-2 |
| Molecular Weight (g/mol) | 397.288 |
| MDL Number | MFCD00147533 |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)[O-].C1=CC=C2C=C(C=CC2=C1)C(=O)[O-].[Mn+2] |
| Synonym | manganese ii naphthenate w/w in mineral spirits mn,manganese ii bis 2-naphthoate,manganese 2+ ;naphthalene-2-carboxylate,manganese 2+ bis 2-naphthoate |
| IUPAC Name | manganese(2+);naphthalene-2-carboxylate |
| InChI Key | SGGOJYZMTYGPCH-UHFFFAOYSA-L |
| Molecular Formula | C22H14MnO4 |
Bis(2,4-pentanedionato)manganese(II) Dihydrate 97.0+%, TCI America™
CAS: 14024-58-9 Molecular Formula: C10H14MnO4 Molecular Weight (g/mol): 253.16 MDL Number: MFCD00000022 MFCD09998212 InChI Key: ZQZQURFYFJBOCE-FDGPNNRMSA-L Synonym: bis 4-hydroxypent-3-en-2-one dihydrate manganese PubChem CID: 54669727 IUPAC Name: manganese(2+) bis((2Z)-4-oxopent-2-en-2-olate) SMILES: [Mn++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
| PubChem CID | 54669727 |
|---|---|
| CAS | 14024-58-9 |
| Molecular Weight (g/mol) | 253.16 |
| MDL Number | MFCD00000022 MFCD09998212 |
| SMILES | [Mn++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | bis 4-hydroxypent-3-en-2-one dihydrate manganese |
| IUPAC Name | manganese(2+) bis((2Z)-4-oxopent-2-en-2-olate) |
| InChI Key | ZQZQURFYFJBOCE-FDGPNNRMSA-L |
| Molecular Formula | C10H14MnO4 |