Phthalic acid and derivatives
- (14)
- (2)
- (3)
- (9)
- (2)
- (2)
- (1)
- (36)
- (3)
- (4)
- (6)
- (9)
- (2)
- (2)
- (10)
- (1)
- (2)
- (2)
- (5)
- (4)
- (1)
- (4)
- (4)
- (15)
- (2)
- (2)
- (66)
- (2)
- (2)
- (6)
- (5)
- (1)
- (2)
- (2)
- (2)
- (2)
- (2)
- (1)
- (2)
- (3)
Résultats de la recherche filtrée
2-Aminoterephthalic acid, 99%
CAS: 10312-55-7 Formule moléculaire: C8H5NO4 Poids moléculaire (g/mol): 179.13 Numéro MDL: MFCD00134536 Clé InChI: GPNNOCMCNFXRAO-UHFFFAOYSA-L Synonyme: aminoterephthalic acid,2-aminobenzene-1,4-dicarboxylic acid,2-amino-1,4-benzenedicarboxylic acid,4-carboxyanthranilic acid,1,4-benzenedicarboxylic acid, 2-amino,2-aminoterephthalic,aminoterephthalicacid,2,5-dicarboxyaniline,2-aminoterephtalic acid,timtec-bb sbb006751 CID PubChem: 2724822 Nom IUPAC: 2-aminoterephthalic acid SMILES: NC1=CC(=CC=C1C([O-])=O)C([O-])=O
| Poids moléculaire (g/mol) | 179.13 |
|---|---|
| Synonyme | aminoterephthalic acid,2-aminobenzene-1,4-dicarboxylic acid,2-amino-1,4-benzenedicarboxylic acid,4-carboxyanthranilic acid,1,4-benzenedicarboxylic acid, 2-amino,2-aminoterephthalic,aminoterephthalicacid,2,5-dicarboxyaniline,2-aminoterephtalic acid,timtec-bb sbb006751 |
| Numéro MDL | MFCD00134536 |
| CAS | 10312-55-7 |
| CID PubChem | 2724822 |
| Nom IUPAC | 2-aminoterephthalic acid |
| Clé InChI | GPNNOCMCNFXRAO-UHFFFAOYSA-L |
| SMILES | NC1=CC(=CC=C1C([O-])=O)C([O-])=O |
| Formule moléculaire | C8H5NO4 |
2-Aminoterephthalic acid, 98.5%, Thermo Scientific Chemicals
CAS: 10312-55-7 Formule moléculaire: C8H5NO4 Poids moléculaire (g/mol): 179.13 Numéro MDL: MFCD00134536 Clé InChI: GPNNOCMCNFXRAO-UHFFFAOYSA-L Synonyme: aminoterephthalic acid,2-aminobenzene-1,4-dicarboxylic acid,2-amino-1,4-benzenedicarboxylic acid,4-carboxyanthranilic acid,1,4-benzenedicarboxylic acid, 2-amino,2-aminoterephthalic,aminoterephthalicacid,2,5-dicarboxyaniline,2-aminoterephtalic acid,timtec-bb sbb006751 CID PubChem: 2724822 Nom IUPAC: 2-aminoterephthalic acid SMILES: NC1=CC(=CC=C1C([O-])=O)C([O-])=O
| Poids moléculaire (g/mol) | 179.13 |
|---|---|
| Synonyme | aminoterephthalic acid,2-aminobenzene-1,4-dicarboxylic acid,2-amino-1,4-benzenedicarboxylic acid,4-carboxyanthranilic acid,1,4-benzenedicarboxylic acid, 2-amino,2-aminoterephthalic,aminoterephthalicacid,2,5-dicarboxyaniline,2-aminoterephtalic acid,timtec-bb sbb006751 |
| Numéro MDL | MFCD00134536 |
| CAS | 10312-55-7 |
| CID PubChem | 2724822 |
| Nom IUPAC | 2-aminoterephthalic acid |
| Clé InChI | GPNNOCMCNFXRAO-UHFFFAOYSA-L |
| SMILES | NC1=CC(=CC=C1C([O-])=O)C([O-])=O |
| Formule moléculaire | C8H5NO4 |
Dimethyl isophthalate, 98%
CAS: 1459-93-4 Formule moléculaire: C10H10O4 Poids moléculaire (g/mol): 194.19 Numéro MDL: MFCD00008433 Clé InChI: VNGOYPQMJFJDLV-UHFFFAOYSA-N Synonyme: dimethyl isophthalate,dimethyl m-phthalate,isophthalic acid dimethyl ester,methyl isophthalate,1,3-benzenedicarboxylic acid, dimethyl ester,morflex 1129,dimethyl 1,3-benzenedicarboxylate,dimethylisophthalate,methyl 3-carbomethoxy benzoate,isophthalic acid, dimethyl ester CID PubChem: 15088 Nom IUPAC: dimethyl benzene-1,3-dicarboxylate SMILES: COC(=O)C1=CC(=CC=C1)C(=O)OC
| Poids moléculaire (g/mol) | 194.19 |
|---|---|
| Synonyme | dimethyl isophthalate,dimethyl m-phthalate,isophthalic acid dimethyl ester,methyl isophthalate,1,3-benzenedicarboxylic acid, dimethyl ester,morflex 1129,dimethyl 1,3-benzenedicarboxylate,dimethylisophthalate,methyl 3-carbomethoxy benzoate,isophthalic acid, dimethyl ester |
| Numéro MDL | MFCD00008433 |
| CAS | 1459-93-4 |
| CID PubChem | 15088 |
| Nom IUPAC | dimethyl benzene-1,3-dicarboxylate |
| Clé InChI | VNGOYPQMJFJDLV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC=C1)C(=O)OC |
| Formule moléculaire | C10H10O4 |
Methyl hydrogen isophthalate, 97%
CAS: 1877-71-0 Formule moléculaire: C9H8O4 Poids moléculaire (g/mol): 180.159 Numéro MDL: MFCD00029972 Clé InChI: WMZNGTSLFSJHMZ-UHFFFAOYSA-N Synonyme: 3-methoxycarbonyl benzoic acid,mono-methyl isophthalate,methyl hydrogen isophthalate,isophthalic acid monomethyl ester,monomethyl isophthalate,isophthalic acid methyl ester,isophthalic acid, methyl ester,isophthalic acid, monomethyl ester,methyl m-phthalate,methyl 3-carboxybenzoate CID PubChem: 601880 Nom IUPAC: 3-methoxycarbonylbenzoic acid SMILES: COC(=O)C1=CC=CC(=C1)C(=O)O
| Poids moléculaire (g/mol) | 180.159 |
|---|---|
| Synonyme | 3-methoxycarbonyl benzoic acid,mono-methyl isophthalate,methyl hydrogen isophthalate,isophthalic acid monomethyl ester,monomethyl isophthalate,isophthalic acid methyl ester,isophthalic acid, methyl ester,isophthalic acid, monomethyl ester,methyl m-phthalate,methyl 3-carboxybenzoate |
| Numéro MDL | MFCD00029972 |
| CAS | 1877-71-0 |
| CID PubChem | 601880 |
| Nom IUPAC | 3-methoxycarbonylbenzoic acid |
| Clé InChI | WMZNGTSLFSJHMZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C(=O)O |
| Formule moléculaire | C9H8O4 |
2,5-Dihydroxyterephthalic acid, 97%
CAS: 610-92-4 Formule moléculaire: C8H6O6 Poids moléculaire (g/mol): 198.13 Numéro MDL: MFCD00132933 Clé InChI: OYFRNYNHAZOYNF-UHFFFAOYSA-N Synonyme: 1,4-benzenedicarboxylic acid, 2,5-dihydroxy,2,5-dihydroxyterephthalicacid,2,5-dihydroxy-1,4-benzenedicarboxylic acid,2,5-dihydroxybenzene-1,4-dicarboxylic acid,zlchem 699,acmc-1ayqi,1, 2,5-dihydroxy,2,5-dihydroxytelephthalic acid,#,2,5-dihydroxyterephthalic acid CID PubChem: 69131 Nom IUPAC: 2,5-dihydroxyterephthalic acid SMILES: C1=C(C(=CC(=C1O)C(=O)O)O)C(=O)O
| Poids moléculaire (g/mol) | 198.13 |
|---|---|
| Synonyme | 1,4-benzenedicarboxylic acid, 2,5-dihydroxy,2,5-dihydroxyterephthalicacid,2,5-dihydroxy-1,4-benzenedicarboxylic acid,2,5-dihydroxybenzene-1,4-dicarboxylic acid,zlchem 699,acmc-1ayqi,1, 2,5-dihydroxy,2,5-dihydroxytelephthalic acid,#,2,5-dihydroxyterephthalic acid |
| Numéro MDL | MFCD00132933 |
| CAS | 610-92-4 |
| CID PubChem | 69131 |
| Nom IUPAC | 2,5-dihydroxyterephthalic acid |
| Clé InChI | OYFRNYNHAZOYNF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1O)C(=O)O)O)C(=O)O |
| Formule moléculaire | C8H6O6 |
2-Nitroterephthalic acid 4-methyl ester, 97%
CAS: 55737-66-1 Formule moléculaire: C9H7NO6 Poids moléculaire (g/mol): 225.156 Numéro MDL: MFCD06203344 Clé InChI: VULISSQANNKDCH-UHFFFAOYSA-N Synonyme: 4-methoxycarbonyl-2-nitrobenzoic acid,2-nitro-4-methoxycarbonyl benzoic acid,2-nitroterephthalic acid 4-methyl ester,acmc-1awlg,methyl 4-carboxy-3-nitrobenzoate,4-carbomethoxy-2-nitrobenzoic acid,4-methoxycarbonyl-2-nitrobenzoicacid,2-nitro-terephthalic acid 4-methyl ester CID PubChem: 21906474 SMILES: COC(=O)C1=CC(=C(C=C1)C(=O)O)[N+](=O)[O-]
| Poids moléculaire (g/mol) | 225.156 |
|---|---|
| Synonyme | 4-methoxycarbonyl-2-nitrobenzoic acid,2-nitro-4-methoxycarbonyl benzoic acid,2-nitroterephthalic acid 4-methyl ester,acmc-1awlg,methyl 4-carboxy-3-nitrobenzoate,4-carbomethoxy-2-nitrobenzoic acid,4-methoxycarbonyl-2-nitrobenzoicacid,2-nitro-terephthalic acid 4-methyl ester |
| Numéro MDL | MFCD06203344 |
| CAS | 55737-66-1 |
| CID PubChem | 21906474 |
| Clé InChI | VULISSQANNKDCH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)O)[N+](=O)[O-] |
| Formule moléculaire | C9H7NO6 |
Thermo Scientific Chemicals 6-Carboxyfluorescein, 96%
CAS: 3301-79-9 Formule moléculaire: C21H12O7 Poids moléculaire (g/mol): 376.32 Numéro MDL: MFCD00036873 Clé InChI: BZTDTCNHAFUJOG-UHFFFAOYSA-N Synonyme: 6-carboxyfluorescein,6-fam,carboxyfluorescein,spiro isobenzofuran-1 3h ,9'-9h xanthene-6-carboxylic acid, 3',6'-dihydroxy-3-oxo,3,6,9-trihydroxyxanthen-9-yl terephthalic acid,3',6'-dihydroxy-3-oxo-3h-spiro 2-benzofuran-1,9'-xanthene-6-carboxylic acid,3',6'-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-6-carboxylic acid,5 6-carboxy fluorescein,bidd:gt0504 CID PubChem: 76806 ChEBI: CHEBI:39073 Nom IUPAC: 3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid SMILES: C1=CC2=C(C=C1C(=O)O)C3(C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)OC2=O
| Poids moléculaire (g/mol) | 376.32 |
|---|---|
| Synonyme | 6-carboxyfluorescein,6-fam,carboxyfluorescein,spiro isobenzofuran-1 3h ,9'-9h xanthene-6-carboxylic acid, 3',6'-dihydroxy-3-oxo,3,6,9-trihydroxyxanthen-9-yl terephthalic acid,3',6'-dihydroxy-3-oxo-3h-spiro 2-benzofuran-1,9'-xanthene-6-carboxylic acid,3',6'-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-6-carboxylic acid,5 6-carboxy fluorescein,bidd:gt0504 |
| Numéro MDL | MFCD00036873 |
| CAS | 3301-79-9 |
| CID PubChem | 76806 |
| ChEBI | CHEBI:39073 |
| Nom IUPAC | 3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid |
| Clé InChI | BZTDTCNHAFUJOG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C3(C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)OC2=O |
| Formule moléculaire | C21H12O7 |
TraceCERT™ Dimethyl Terephthalate Solution, 5 mg/g in DMSO-d, Certified Reference Material, MilliporeSigma™ Supelco™
This certified reference material (CRM) is produced and certified in accordance with ISO/IEC 17025 and ISO 17034. This CRM is traceable to the SI through a primary reference material from a NMI. Certified content incl. uncertainty and expiry date are stated on the enclosed certificate.
Terephthalic acid, 98+%
CAS: 100-21-0 Formule moléculaire: C8H6O4 Poids moléculaire (g/mol): 166.132 Numéro MDL: MFCD00002558 Clé InChI: KKEYFWRCBNTPAC-UHFFFAOYSA-N Synonyme: p-phthalic acid,1,4-benzenedicarboxylic acid,benzene-1,4-dicarboxylic acid,p-dicarboxybenzene,p-benzenedicarboxylic acid,p-carboxybenzoic acid,acide terephtalique,para-phthalic acid,tephthol,1,4-dicarboxybenzene CID PubChem: 7489 ChEBI: CHEBI:15702 Nom IUPAC: terephthalic acid SMILES: C1=CC(=CC=C1C(=O)O)C(=O)O
| Poids moléculaire (g/mol) | 166.132 |
|---|---|
| Synonyme | p-phthalic acid,1,4-benzenedicarboxylic acid,benzene-1,4-dicarboxylic acid,p-dicarboxybenzene,p-benzenedicarboxylic acid,p-carboxybenzoic acid,acide terephtalique,para-phthalic acid,tephthol,1,4-dicarboxybenzene |
| Numéro MDL | MFCD00002558 |
| CAS | 100-21-0 |
| CID PubChem | 7489 |
| ChEBI | CHEBI:15702 |
| Nom IUPAC | terephthalic acid |
| Clé InChI | KKEYFWRCBNTPAC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)C(=O)O |
| Formule moléculaire | C8H6O4 |
Diethyl terephthalate, 98%
CAS: 636-09-9 Formule moléculaire: C12H14O4 Poids moléculaire (g/mol): 222.24 Numéro MDL: MFCD00039891 Clé InChI: ONIHPYYWNBVMID-UHFFFAOYSA-N Synonyme: diethyl terephthalate,p-diethyl phthalate,diethylterephthalate,terephthalic acid, diethyl ester,1,4-benzenedicarboxylic acid, diethyl ester,diethyl p-phthalate,terephthalic acid diethyl ester,unii-n97x85l3cd,1,4-diethyl benzene-1,4-dicarboxylate,1,4-benzenedicarboxylic acid, 1,4-diethyl ester CID PubChem: 12483 Nom IUPAC: diethyl benzene-1,4-dicarboxylate SMILES: CCOC(=O)C1=CC=C(C=C1)C(=O)OCC
| Poids moléculaire (g/mol) | 222.24 |
|---|---|
| Synonyme | diethyl terephthalate,p-diethyl phthalate,diethylterephthalate,terephthalic acid, diethyl ester,1,4-benzenedicarboxylic acid, diethyl ester,diethyl p-phthalate,terephthalic acid diethyl ester,unii-n97x85l3cd,1,4-diethyl benzene-1,4-dicarboxylate,1,4-benzenedicarboxylic acid, 1,4-diethyl ester |
| Numéro MDL | MFCD00039891 |
| CAS | 636-09-9 |
| CID PubChem | 12483 |
| Nom IUPAC | diethyl benzene-1,4-dicarboxylate |
| Clé InChI | ONIHPYYWNBVMID-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C(=O)OCC |
| Formule moléculaire | C12H14O4 |
Dimethyl terephthalate, 99%, Thermo Scientific Chemicals
CAS: 120-61-6 Formule moléculaire: C10H10O4 Poids moléculaire (g/mol): 194.19 Numéro MDL: MFCD00008440 Clé InChI: WOZVHXUHUFLZGK-UHFFFAOYSA-N Synonyme: dimethyl terephthalate,dimethyl p-phthalate,1,4-benzenedicarboxylic acid, dimethyl ester,dimethyl p-benzenedicarboxylate,di-me terephthalate,dimethyl 4-phthalate,terephthalic acid, dimethyl ester,dimethyl 1,4-benzenedicarboxylate,terephthalic acid dimethyl ester,methyl p-methoxycarbonyl benzoate CID PubChem: 8441 Nom IUPAC: 1,4-dimethyl benzene-1,4-dicarboxylate SMILES: COC(=O)C1=CC=C(C=C1)C(=O)OC
| Poids moléculaire (g/mol) | 194.19 |
|---|---|
| Synonyme | dimethyl terephthalate,dimethyl p-phthalate,1,4-benzenedicarboxylic acid, dimethyl ester,dimethyl p-benzenedicarboxylate,di-me terephthalate,dimethyl 4-phthalate,terephthalic acid, dimethyl ester,dimethyl 1,4-benzenedicarboxylate,terephthalic acid dimethyl ester,methyl p-methoxycarbonyl benzoate |
| Numéro MDL | MFCD00008440 |
| CAS | 120-61-6 |
| CID PubChem | 8441 |
| Nom IUPAC | 1,4-dimethyl benzene-1,4-dicarboxylate |
| Clé InChI | WOZVHXUHUFLZGK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(=O)OC |
| Formule moléculaire | C10H10O4 |
Diethyl terephthalate, 95%
CAS: 636-09-9 Formule moléculaire: C12H14O4 Poids moléculaire (g/mol): 222.24 Numéro MDL: MFCD00039891 Clé InChI: ONIHPYYWNBVMID-UHFFFAOYSA-N Synonyme: diethyl terephthalate,p-diethyl phthalate,diethylterephthalate,terephthalic acid, diethyl ester,1,4-benzenedicarboxylic acid, diethyl ester,diethyl p-phthalate,terephthalic acid diethyl ester,unii-n97x85l3cd,1,4-diethyl benzene-1,4-dicarboxylate,1,4-benzenedicarboxylic acid, 1,4-diethyl ester CID PubChem: 12483 Nom IUPAC: diethyl benzene-1,4-dicarboxylate SMILES: CCOC(=O)C1=CC=C(C=C1)C(=O)OCC
| Poids moléculaire (g/mol) | 222.24 |
|---|---|
| Synonyme | diethyl terephthalate,p-diethyl phthalate,diethylterephthalate,terephthalic acid, diethyl ester,1,4-benzenedicarboxylic acid, diethyl ester,diethyl p-phthalate,terephthalic acid diethyl ester,unii-n97x85l3cd,1,4-diethyl benzene-1,4-dicarboxylate,1,4-benzenedicarboxylic acid, 1,4-diethyl ester |
| Numéro MDL | MFCD00039891 |
| CAS | 636-09-9 |
| CID PubChem | 12483 |
| Nom IUPAC | diethyl benzene-1,4-dicarboxylate |
| Clé InChI | ONIHPYYWNBVMID-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C(=O)OCC |
| Formule moléculaire | C12H14O4 |
Dimethyl 5-aminoisophthalate, 98%
CAS: 99-27-4 Formule moléculaire: C10H11NO4 Poids moléculaire (g/mol): 209.201 Numéro MDL: MFCD00008435 Clé InChI: DEKPYXUDJRABNK-UHFFFAOYSA-N CID PubChem: 66831 Nom IUPAC: dimethyl 5-aminobenzene-1,3-dicarboxylate SMILES: COC(=O)C1=CC(=CC(=C1)N)C(=O)OC
| Poids moléculaire (g/mol) | 209.201 |
|---|---|
| Numéro MDL | MFCD00008435 |
| CAS | 99-27-4 |
| CID PubChem | 66831 |
| Nom IUPAC | dimethyl 5-aminobenzene-1,3-dicarboxylate |
| Clé InChI | DEKPYXUDJRABNK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)N)C(=O)OC |
| Formule moléculaire | C10H11NO4 |
Dimethyl aminoterephthalate, 99%
CAS: 5372-81-6 Formule moléculaire: C10H11NO4 Poids moléculaire (g/mol): 209.201 Numéro MDL: MFCD00008427 Clé InChI: DSSKDXUDARIMTR-UHFFFAOYSA-N Synonyme: dimethyl 2-aminoterephthalate,dimethyl aminoterephthalate,dimethyl 3-aminoterephthalate,1,4-benzenedicarboxylic acid, 2-amino-, dimethyl ester,aminoterephthalic acid dimethyl ester,1,4-dimethyl 2-aminobenzene-1,4-dicarboxylate,unii-91sf4e6i9w,2-aminoterephthalic acid, dimethyl ester,3-amino-4-methoxycarbonylbenzoic acid, methyl ester,terephthalic acid, amino-, dimethyl ester CID PubChem: 79336 Nom IUPAC: dimethyl 2-aminobenzene-1,4-dicarboxylate SMILES: COC(=O)C1=CC(=C(C=C1)C(=O)OC)N
| Poids moléculaire (g/mol) | 209.201 |
|---|---|
| Synonyme | dimethyl 2-aminoterephthalate,dimethyl aminoterephthalate,dimethyl 3-aminoterephthalate,1,4-benzenedicarboxylic acid, 2-amino-, dimethyl ester,aminoterephthalic acid dimethyl ester,1,4-dimethyl 2-aminobenzene-1,4-dicarboxylate,unii-91sf4e6i9w,2-aminoterephthalic acid, dimethyl ester,3-amino-4-methoxycarbonylbenzoic acid, methyl ester,terephthalic acid, amino-, dimethyl ester |
| Numéro MDL | MFCD00008427 |
| CAS | 5372-81-6 |
| CID PubChem | 79336 |
| Nom IUPAC | dimethyl 2-aminobenzene-1,4-dicarboxylate |
| Clé InChI | DSSKDXUDARIMTR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)OC)N |
| Formule moléculaire | C10H11NO4 |
2-Nitroterephthalic acid 1-methyl ester, 97%
CAS: 35092-89-8 Formule moléculaire: C9H7NO6 Poids moléculaire (g/mol): 225.16 Numéro MDL: MFCD00024510 Clé InChI: MIIADZYPHVTLPR-UHFFFAOYSA-N Synonyme: 4-methoxycarbonyl-3-nitrobenzoic acid,1-methyl 2-nitroterephthalate,methyl hydrogen 2-nitroterephthalate,3-nitro-4-carbomethoxybenzoic acid,2-nitroterephthalic acid 1-methyl ester,methyl 2-nitro-4-carboxybenzoate,methyl-2-nitro-4-carboxy-benzoate,4-carbomethoxy-3-nitro-benzoic acid CID PubChem: 98592 Nom IUPAC: 4-(methoxycarbonyl)-3-nitrobenzoic acid SMILES: COC(=O)C1=CC=C(C=C1[N+]([O-])=O)C(O)=O
| Poids moléculaire (g/mol) | 225.16 |
|---|---|
| Synonyme | 4-methoxycarbonyl-3-nitrobenzoic acid,1-methyl 2-nitroterephthalate,methyl hydrogen 2-nitroterephthalate,3-nitro-4-carbomethoxybenzoic acid,2-nitroterephthalic acid 1-methyl ester,methyl 2-nitro-4-carboxybenzoate,methyl-2-nitro-4-carboxy-benzoate,4-carbomethoxy-3-nitro-benzoic acid |
| Numéro MDL | MFCD00024510 |
| CAS | 35092-89-8 |
| CID PubChem | 98592 |
| Nom IUPAC | 4-(methoxycarbonyl)-3-nitrobenzoic acid |
| Clé InChI | MIIADZYPHVTLPR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1[N+]([O-])=O)C(O)=O |
| Formule moléculaire | C9H7NO6 |