Benzophenones
- (36)
- (2)
- (17)
- (43)
- (3)
- (1)
- (1)
- (2)
- (3)
- (5)
- (8)
- (6)
- (12)
- (10)
- (8)
- (5)
- (2)
- (1)
- (2)
- (6)
- (2)
- (2)
- (7)
- (3)
- (4)
- (204)
- (2)
- (3)
- (3)
- (2)
- (1)
- (5)
- (3)
- (3)
- (1)
- (3)
- (1)
- (2)
- (2)
- (2)
Résultats de la recherche filtrée
(2-Amino-5-nitrophenyl)(2-chlorophenyl)methanone, British Pharmacopoeia (BP) Reference Standard, MilliporeSigma™ Supelco™
This product is provided as delivered and specified by the issuing Pharmacopoeia. All information provided in support of this product, including SDS and any product information leaflets, has been developed and issued under the Authority of the issuing Pharmacopoeia.
2-Aminobenzophenone, 98%
CAS: 2835-77-0 Formule moléculaire: C13H11NO Poids moléculaire (g/mol): 197.24 Numéro MDL: MFCD00007713 Clé InChI: MAOBFOXLCJIFLV-UHFFFAOYSA-N Synonyme: 2-aminobenzophenone,2-benzoylaniline,o-benzoylaniline,o-aminobenzophenone,2-aminophenyl phenyl methanone,methanone, 2-aminophenyl phenyl,benzophenone, 2-amino,2-amino-phenyl-phenyl-methanone,2-aminophenyl phenyl ketone,methanone, aminophenyl phenyl CID PubChem: 76080 Nom IUPAC: (2-aminophenyl)-phenylmethanone SMILES: NC1=CC=CC=C1C(=O)C1=CC=CC=C1
| Poids moléculaire (g/mol) | 197.24 |
|---|---|
| Synonyme | 2-aminobenzophenone,2-benzoylaniline,o-benzoylaniline,o-aminobenzophenone,2-aminophenyl phenyl methanone,methanone, 2-aminophenyl phenyl,benzophenone, 2-amino,2-amino-phenyl-phenyl-methanone,2-aminophenyl phenyl ketone,methanone, aminophenyl phenyl |
| Numéro MDL | MFCD00007713 |
| CAS | 2835-77-0 |
| CID PubChem | 76080 |
| Nom IUPAC | (2-aminophenyl)-phenylmethanone |
| Clé InChI | MAOBFOXLCJIFLV-UHFFFAOYSA-N |
| SMILES | NC1=CC=CC=C1C(=O)C1=CC=CC=C1 |
| Formule moléculaire | C13H11NO |
2-Benzoylbenzoic acid, 98%
CAS: 85-52-9 Formule moléculaire: C14H10O3 Poids moléculaire (g/mol): 226.23 Numéro MDL: MFCD00002472 Clé InChI: FGTYTUFKXYPTML-UHFFFAOYSA-N Synonyme: o-benzoylbenzoic acid,benzoic acid, 2-benzoyl,2-carboxybenzophenone,benzophenone-2-carboxylic acid,benzoic acid, o-benzoyl,o-carboxybenzophenone,benzophenone-2-carbonic acid,2-benzoquinonecarboxylic acid,benzoylbenzoic acid,2-phenylcarbonyl benzoic acid CID PubChem: 6813 Nom IUPAC: 2-benzoylbenzoic acid SMILES: OC(=O)C1=CC=CC=C1C(=O)C1=CC=CC=C1
| Poids moléculaire (g/mol) | 226.23 |
|---|---|
| Synonyme | o-benzoylbenzoic acid,benzoic acid, 2-benzoyl,2-carboxybenzophenone,benzophenone-2-carboxylic acid,benzoic acid, o-benzoyl,o-carboxybenzophenone,benzophenone-2-carbonic acid,2-benzoquinonecarboxylic acid,benzoylbenzoic acid,2-phenylcarbonyl benzoic acid |
| Numéro MDL | MFCD00002472 |
| CAS | 85-52-9 |
| CID PubChem | 6813 |
| Nom IUPAC | 2-benzoylbenzoic acid |
| Clé InChI | FGTYTUFKXYPTML-UHFFFAOYSA-N |
| SMILES | OC(=O)C1=CC=CC=C1C(=O)C1=CC=CC=C1 |
| Formule moléculaire | C14H10O3 |
Benzophenone, 99%, pure
CAS: 119-61-9 Formule moléculaire: C13H10O Poids moléculaire (g/mol): 182.22 Clé InChI: RWCCWEUUXYIKHB-UHFFFAOYSA-N Synonyme: benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone CID PubChem: 3102 ChEBI: CHEBI:41308 Nom IUPAC: diphenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2
| Poids moléculaire (g/mol) | 182.22 |
|---|---|
| Synonyme | benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone |
| CAS | 119-61-9 |
| CID PubChem | 3102 |
| ChEBI | CHEBI:41308 |
| Nom IUPAC | diphenylmethanone |
| Clé InChI | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Formule moléculaire | C13H10O |
2-Hydroxybenzophenone, 99%
CAS: 117-99-7 Formule moléculaire: C13H10O2 Poids moléculaire (g/mol): 198.22 Numéro MDL: MFCD00002216 Clé InChI: HJIAMFHSAAEUKR-UHFFFAOYSA-N Synonyme: 2-hydroxybenzophenone,o-benzoylphenol,2-hydroxyphenyl phenyl methanone,o-hydroxybenzophenone,benzophenone, 2-hydroxy,methanone, 2-hydroxyphenyl phenyl,phenyl 2-hydroxyphenyl ketone,unii-lqv22w4v05,ortho-hydroxybenzophenone,2-hydroxyphenyl phenylmethanone CID PubChem: 8348 Nom IUPAC: (2-hydroxyphenyl)-phenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2O
| Poids moléculaire (g/mol) | 198.22 |
|---|---|
| Synonyme | 2-hydroxybenzophenone,o-benzoylphenol,2-hydroxyphenyl phenyl methanone,o-hydroxybenzophenone,benzophenone, 2-hydroxy,methanone, 2-hydroxyphenyl phenyl,phenyl 2-hydroxyphenyl ketone,unii-lqv22w4v05,ortho-hydroxybenzophenone,2-hydroxyphenyl phenylmethanone |
| Numéro MDL | MFCD00002216 |
| CAS | 117-99-7 |
| CID PubChem | 8348 |
| Nom IUPAC | (2-hydroxyphenyl)-phenylmethanone |
| Clé InChI | HJIAMFHSAAEUKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2O |
| Formule moléculaire | C13H10O2 |
Michler's Ketone, 98%
CAS: 90-94-8 Formule moléculaire: C17H20N2O Poids moléculaire (g/mol): 268.36 Numéro MDL: MFCD00008312 Clé InChI: VVBLNCFGVYUYGU-UHFFFAOYSA-N Synonyme: michler's ketone,4,4'-bis dimethylamino benzophenone,michler ketone,bis 4-dimethylamino phenyl methanone,p,p'-michler's ketone,michlers ketone,methanone, bis 4-dimethylamino phenyl,tetramethyldiaminobenzophenone,p,p'-bis dimethylamino benzophenone CID PubChem: 7031 ChEBI: CHEBI:82347 Nom IUPAC: bis[4-(dimethylamino)phenyl]methanone SMILES: CN(C)C1=CC=C(C=C1)C(=O)C1=CC=C(C=C1)N(C)C
| Poids moléculaire (g/mol) | 268.36 |
|---|---|
| Synonyme | michler's ketone,4,4'-bis dimethylamino benzophenone,michler ketone,bis 4-dimethylamino phenyl methanone,p,p'-michler's ketone,michlers ketone,methanone, bis 4-dimethylamino phenyl,tetramethyldiaminobenzophenone,p,p'-bis dimethylamino benzophenone |
| Numéro MDL | MFCD00008312 |
| CAS | 90-94-8 |
| CID PubChem | 7031 |
| ChEBI | CHEBI:82347 |
| Nom IUPAC | bis[4-(dimethylamino)phenyl]methanone |
| Clé InChI | VVBLNCFGVYUYGU-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(=O)C1=CC=C(C=C1)N(C)C |
| Formule moléculaire | C17H20N2O |
4,4'-Difluorobenzophenone, 98+%
CAS: 345-92-6 Formule moléculaire: C13H8F2O Poids moléculaire (g/mol): 218.20 Numéro MDL: MFCD00000353 Clé InChI: LSQARZALBDFYQZ-UHFFFAOYSA-N Synonyme: 4,4'-difluorobenzophenone,bis 4-fluorophenyl methanone,bis 4-fluorophenyl-methanone,methanone, bis 4-fluorophenyl,p,p'-difluorobenzophenone,di-p-fluorophenyl ketone,bis p-fluorophenyl ketone,bis 4-fluorophenyl ketone,benzophenone, 4,4'-difluoro,unii-88bnc11b9c CID PubChem: 9582 Nom IUPAC: bis(4-fluorophenyl)methanone SMILES: FC1=CC=C(C=C1)C(=O)C1=CC=C(F)C=C1
| Poids moléculaire (g/mol) | 218.20 |
|---|---|
| Synonyme | 4,4'-difluorobenzophenone,bis 4-fluorophenyl methanone,bis 4-fluorophenyl-methanone,methanone, bis 4-fluorophenyl,p,p'-difluorobenzophenone,di-p-fluorophenyl ketone,bis p-fluorophenyl ketone,bis 4-fluorophenyl ketone,benzophenone, 4,4'-difluoro,unii-88bnc11b9c |
| Numéro MDL | MFCD00000353 |
| CAS | 345-92-6 |
| CID PubChem | 9582 |
| Nom IUPAC | bis(4-fluorophenyl)methanone |
| Clé InChI | LSQARZALBDFYQZ-UHFFFAOYSA-N |
| SMILES | FC1=CC=C(C=C1)C(=O)C1=CC=C(F)C=C1 |
| Formule moléculaire | C13H8F2O |
4,4'-Difluorobenzophenone, 99%
CAS: 345-92-6 Formule moléculaire: C13H8F2O Poids moléculaire (g/mol): 218.20 Numéro MDL: MFCD00000353 Clé InChI: LSQARZALBDFYQZ-UHFFFAOYSA-N Synonyme: 4,4'-difluorobenzophenone,bis 4-fluorophenyl methanone,bis 4-fluorophenyl-methanone,methanone, bis 4-fluorophenyl,p,p'-difluorobenzophenone,di-p-fluorophenyl ketone,bis p-fluorophenyl ketone,bis 4-fluorophenyl ketone,benzophenone, 4,4'-difluoro,unii-88bnc11b9c CID PubChem: 9582 Nom IUPAC: bis(4-fluorophenyl)methanone SMILES: FC1=CC=C(C=C1)C(=O)C1=CC=C(F)C=C1
| Poids moléculaire (g/mol) | 218.20 |
|---|---|
| Synonyme | 4,4'-difluorobenzophenone,bis 4-fluorophenyl methanone,bis 4-fluorophenyl-methanone,methanone, bis 4-fluorophenyl,p,p'-difluorobenzophenone,di-p-fluorophenyl ketone,bis p-fluorophenyl ketone,bis 4-fluorophenyl ketone,benzophenone, 4,4'-difluoro,unii-88bnc11b9c |
| Numéro MDL | MFCD00000353 |
| CAS | 345-92-6 |
| CID PubChem | 9582 |
| Nom IUPAC | bis(4-fluorophenyl)methanone |
| Clé InChI | LSQARZALBDFYQZ-UHFFFAOYSA-N |
| SMILES | FC1=CC=C(C=C1)C(=O)C1=CC=C(F)C=C1 |
| Formule moléculaire | C13H8F2O |
Flubendazole, 98%
CAS: 31430-15-6 Formule moléculaire: C16H12FN3O3 Poids moléculaire (g/mol): 313.28 Clé InChI: CPEUVMUXAHMANV-UHFFFAOYSA-N Synonyme: flubendazole,flumoxane,flubendazol,fluvermal,flubenol,flubendazolum,flumoxal,flutelmium,methyl 5-4-fluorobenzoyl-1h-benzo d imidazol-2-yl carbamate,flubendazol inn-spanish CID PubChem: 35802 ChEBI: CHEBI:77095 Nom IUPAC: methyl N-[6-(4-fluorobenzoyl)-1H-benzimidazol-2-yl]carbamate SMILES: COC(=O)NC1=NC2=C(N1)C=C(C=C2)C(=O)C3=CC=C(C=C3)F
| Poids moléculaire (g/mol) | 313.28 |
|---|---|
| Synonyme | flubendazole,flumoxane,flubendazol,fluvermal,flubenol,flubendazolum,flumoxal,flutelmium,methyl 5-4-fluorobenzoyl-1h-benzo d imidazol-2-yl carbamate,flubendazol inn-spanish |
| CAS | 31430-15-6 |
| CID PubChem | 35802 |
| ChEBI | CHEBI:77095 |
| Nom IUPAC | methyl N-[6-(4-fluorobenzoyl)-1H-benzimidazol-2-yl]carbamate |
| Clé InChI | CPEUVMUXAHMANV-UHFFFAOYSA-N |
| SMILES | COC(=O)NC1=NC2=C(N1)C=C(C=C2)C(=O)C3=CC=C(C=C3)F |
| Formule moléculaire | C16H12FN3O3 |
3-Chlorobenzophenone, 98+%
CAS: 1016-78-0 Formule moléculaire: C13H9ClO Poids moléculaire (g/mol): 216.664 Numéro MDL: MFCD00009816 Clé InChI: CPLWKNRPZVNELG-UHFFFAOYSA-N Synonyme: 3-chlorobenzophenone,3-chlorophenyl phenyl methanone,benzophenone, 3-chloro,methanone, 3-chlorophenyl phenyl,m-chlorobenzophenone,3-chlorophenyl-phenylmethanone,methanone, 3-chlorophenyl pheny,3-chlorophenyl phenyl ketone,5-chlorobenzophenone,pubchem24414 CID PubChem: 66098 Nom IUPAC: (3-chlorophenyl)-phenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=CC(=CC=C2)Cl
| Poids moléculaire (g/mol) | 216.664 |
|---|---|
| Synonyme | 3-chlorobenzophenone,3-chlorophenyl phenyl methanone,benzophenone, 3-chloro,methanone, 3-chlorophenyl phenyl,m-chlorobenzophenone,3-chlorophenyl-phenylmethanone,methanone, 3-chlorophenyl pheny,3-chlorophenyl phenyl ketone,5-chlorobenzophenone,pubchem24414 |
| Numéro MDL | MFCD00009816 |
| CAS | 1016-78-0 |
| CID PubChem | 66098 |
| Nom IUPAC | (3-chlorophenyl)-phenylmethanone |
| Clé InChI | CPLWKNRPZVNELG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=CC=C2)Cl |
| Formule moléculaire | C13H9ClO |
3-Benzoylbenzoic acid, 98%
CAS: 579-18-0 Formule moléculaire: C14H10O3 Poids moléculaire (g/mol): 226.23 Numéro MDL: MFCD00002518 Clé InChI: AXJXRLHTQQONQR-UHFFFAOYSA-N CID PubChem: 101386 Nom IUPAC: 3-benzoylbenzoic acid SMILES: OC(=O)C1=CC=CC(=C1)C(=O)C1=CC=CC=C1
| Poids moléculaire (g/mol) | 226.23 |
|---|---|
| Numéro MDL | MFCD00002518 |
| CAS | 579-18-0 |
| CID PubChem | 101386 |
| Nom IUPAC | 3-benzoylbenzoic acid |
| Clé InChI | AXJXRLHTQQONQR-UHFFFAOYSA-N |
| SMILES | OC(=O)C1=CC=CC(=C1)C(=O)C1=CC=CC=C1 |
| Formule moléculaire | C14H10O3 |
4,4'-Bis(diethylamino)benzophenone, 98+%
CAS: 90-93-7 Formule moléculaire: C21H28N2O Poids moléculaire (g/mol): 324.47 Numéro MDL: MFCD00009044 Clé InChI: VYHBFRJRBHMIQZ-UHFFFAOYSA-N Synonyme: 4,4'-bis diethylamino benzophenone,michler's ethyl ketone,bis 4-diethylamino phenyl methanone,methanone, bis 4-diethylamino phenyl,4,4'-tetraethyldiamino benzophenone,p,p'-bis diethylamino benzophenone,p,p'-tetraethyldiamino benzophenone,ethyl michler ketone CID PubChem: 66663 Nom IUPAC: bis[4-(diethylamino)phenyl]methanone SMILES: CCN(CC)C1=CC=C(C=C1)C(=O)C1=CC=C(C=C1)N(CC)CC
| Poids moléculaire (g/mol) | 324.47 |
|---|---|
| Synonyme | 4,4'-bis diethylamino benzophenone,michler's ethyl ketone,bis 4-diethylamino phenyl methanone,methanone, bis 4-diethylamino phenyl,4,4'-tetraethyldiamino benzophenone,p,p'-bis diethylamino benzophenone,p,p'-tetraethyldiamino benzophenone,ethyl michler ketone |
| Numéro MDL | MFCD00009044 |
| CAS | 90-93-7 |
| CID PubChem | 66663 |
| Nom IUPAC | bis[4-(diethylamino)phenyl]methanone |
| Clé InChI | VYHBFRJRBHMIQZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)C(=O)C1=CC=C(C=C1)N(CC)CC |
| Formule moléculaire | C21H28N2O |
2-Methylbenzophenone, 98+%
CAS: 131-58-8 Formule moléculaire: C14H12O Poids moléculaire (g/mol): 196.249 Numéro MDL: MFCD00008518 Clé InChI: CKGKXGQVRVAKEA-UHFFFAOYSA-N Synonyme: 2-methylbenzophenone,o-methylbenzophenone,methanone, 2-methylphenyl phenyl,phenyl o-tolyl ketone,2-methylphenyl phenyl methanone,benzophenone, 2-methyl,2-methylphenyl-phenylmethanone,unii-lsn1480nff,phenyl tolyl ketone,phenyl 2-tolyl ketone CID PubChem: 67230 Nom IUPAC: (2-methylphenyl)-phenylmethanone SMILES: CC1=CC=CC=C1C(=O)C2=CC=CC=C2
| Poids moléculaire (g/mol) | 196.249 |
|---|---|
| Synonyme | 2-methylbenzophenone,o-methylbenzophenone,methanone, 2-methylphenyl phenyl,phenyl o-tolyl ketone,2-methylphenyl phenyl methanone,benzophenone, 2-methyl,2-methylphenyl-phenylmethanone,unii-lsn1480nff,phenyl tolyl ketone,phenyl 2-tolyl ketone |
| Numéro MDL | MFCD00008518 |
| CAS | 131-58-8 |
| CID PubChem | 67230 |
| Nom IUPAC | (2-methylphenyl)-phenylmethanone |
| Clé InChI | CKGKXGQVRVAKEA-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(=O)C2=CC=CC=C2 |
| Formule moléculaire | C14H12O |
4-Chlorobenzophenone, 99%
CAS: 134-85-0 Formule moléculaire: C13H9ClO Poids moléculaire (g/mol): 216.664 Numéro MDL: MFCD00000622 Clé InChI: UGVRJVHOJNYEHR-UHFFFAOYSA-N Synonyme: 4-chlorobenzophenone,4-chlorophenyl phenyl methanone,p-chlorobenzophenone,methanone, 4-chlorophenyl phenyl,benzophenone, 4-chloro,p-cbp,unii-wih1iz728u,4-chloro benzophenone,4-chlorophenyl-phenylmethanone,wih1iz728u CID PubChem: 8653 Nom IUPAC: (4-chlorophenyl)-phenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)Cl
| Poids moléculaire (g/mol) | 216.664 |
|---|---|
| Synonyme | 4-chlorobenzophenone,4-chlorophenyl phenyl methanone,p-chlorobenzophenone,methanone, 4-chlorophenyl phenyl,benzophenone, 4-chloro,p-cbp,unii-wih1iz728u,4-chloro benzophenone,4-chlorophenyl-phenylmethanone,wih1iz728u |
| Numéro MDL | MFCD00000622 |
| CAS | 134-85-0 |
| CID PubChem | 8653 |
| Nom IUPAC | (4-chlorophenyl)-phenylmethanone |
| Clé InChI | UGVRJVHOJNYEHR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)Cl |
| Formule moléculaire | C13H9ClO |