Organic sulfuric acids and derivatives
- (5)
- (2)
- (3)
- (6)
- (16)
- (4)
- (6)
- (1)
- (8)
- (1)
- (2)
- (3)
- (1)
- (6)
- (3)
- (2)
- (1)
- (4)
- (17)
- (3)
- (3)
- (2)
- (3)
- (2)
- (2)
- (3)
- (1)
- (2)
- (5)
- (1)
- (2)
- (4)
- (3)
- (5)
- (20)
- (2)
- (15)
- (4)
- (4)
- (3)
- (2)
- (1)
- (3)
- (1)
- (1)
Filtered Search Results
Sodium cyclamate, 99%
CAS: 139-05-9 Molecular Formula: C6H12NNaO3S Molecular Weight (g/mol): 201.22 MDL Number: MFCD00003827 InChI Key: UDIPTWFVPPPURJ-UHFFFAOYSA-M Synonym: sodium cyclamate,sodium cyclohexylsulfamate,sodium n-cyclohexylsulfamate,cyclamate sodium,cyclamic acid sodium salt,assugrin,ibiosuc,suessette,suestamin,sugarin PubChem CID: 23665706 ChEBI: CHEBI:82431 IUPAC Name: sodium;N-cyclohexylsulfamate SMILES: [Na+].[O-]S(=O)(=O)NC1CCCCC1
| PubChem CID | 23665706 |
|---|---|
| CAS | 139-05-9 |
| Molecular Weight (g/mol) | 201.22 |
| ChEBI | CHEBI:82431 |
| MDL Number | MFCD00003827 |
| SMILES | [Na+].[O-]S(=O)(=O)NC1CCCCC1 |
| Synonym | sodium cyclamate,sodium cyclohexylsulfamate,sodium n-cyclohexylsulfamate,cyclamate sodium,cyclamic acid sodium salt,assugrin,ibiosuc,suessette,suestamin,sugarin |
| IUPAC Name | sodium;N-cyclohexylsulfamate |
| InChI Key | UDIPTWFVPPPURJ-UHFFFAOYSA-M |
| Molecular Formula | C6H12NNaO3S |
Sodium cyclamate, 98%
CAS: 139-05-9 Molecular Formula: C6H12NNaO3S Molecular Weight (g/mol): 201.22 MDL Number: MFCD00003827 InChI Key: UDIPTWFVPPPURJ-UHFFFAOYSA-M Synonym: sodium cyclamate,sodium cyclohexylsulfamate,sodium n-cyclohexylsulfamate,cyclamate sodium,cyclamic acid sodium salt,assugrin,ibiosuc,suessette,suestamin,sugarin PubChem CID: 23665706 ChEBI: CHEBI:82431 SMILES: [Na+].[O-]S(=O)(=O)NC1CCCCC1
| PubChem CID | 23665706 |
|---|---|
| CAS | 139-05-9 |
| Molecular Weight (g/mol) | 201.22 |
| ChEBI | CHEBI:82431 |
| MDL Number | MFCD00003827 |
| SMILES | [Na+].[O-]S(=O)(=O)NC1CCCCC1 |
| Synonym | sodium cyclamate,sodium cyclohexylsulfamate,sodium n-cyclohexylsulfamate,cyclamate sodium,cyclamic acid sodium salt,assugrin,ibiosuc,suessette,suestamin,sugarin |
| InChI Key | UDIPTWFVPPPURJ-UHFFFAOYSA-M |
| Molecular Formula | C6H12NNaO3S |
Decyl sodium sulfate, HPLC grade
CAS: 142-87-0 MDL Number: MFCD00041881 InChI Key: XZTJQQLJJCXOLP-UHFFFAOYSA-M Synonym: sodium decyl sulfate,sodium n-decyl sulfate,decyl sodium sulfate,sulfuric acid, monodecyl ester, sodium salt,sodium decyl sulphate,unii-al92m833sy,n-decyl sodium sulfate,sodium n-decylsulphate,sulfuric acid, monodecyl ester, sodium salt 1:1,sulfuric acid, decyl ester, sodium salt PubChem CID: 23665771 IUPAC Name: sodium;decyl sulfate SMILES: CCCCCCCCCCOS(=O)(=O)[O-].[Na+]
| PubChem CID | 23665771 |
|---|---|
| CAS | 142-87-0 |
| MDL Number | MFCD00041881 |
| SMILES | CCCCCCCCCCOS(=O)(=O)[O-].[Na+] |
| Synonym | sodium decyl sulfate,sodium n-decyl sulfate,decyl sodium sulfate,sulfuric acid, monodecyl ester, sodium salt,sodium decyl sulphate,unii-al92m833sy,n-decyl sodium sulfate,sodium n-decylsulphate,sulfuric acid, monodecyl ester, sodium salt 1:1,sulfuric acid, decyl ester, sodium salt |
| IUPAC Name | sodium;decyl sulfate |
| InChI Key | XZTJQQLJJCXOLP-UHFFFAOYSA-M |
Sodium n-decyl sulfate, 98%
CAS: 142-87-0 Molecular Formula: C10H21NaO4S Molecular Weight (g/mol): 260.324 MDL Number: MFCD00041881 InChI Key: XZTJQQLJJCXOLP-UHFFFAOYSA-M Synonym: sodium decyl sulfate,sodium n-decyl sulfate,decyl sodium sulfate,sulfuric acid, monodecyl ester, sodium salt,sodium decyl sulphate,unii-al92m833sy,n-decyl sodium sulfate,sodium n-decylsulphate,sulfuric acid, monodecyl ester, sodium salt 1:1,sulfuric acid, decyl ester, sodium salt PubChem CID: 23665771 IUPAC Name: sodium;decyl sulfate SMILES: CCCCCCCCCCOS(=O)(=O)[O-].[Na+]
| PubChem CID | 23665771 |
|---|---|
| CAS | 142-87-0 |
| Molecular Weight (g/mol) | 260.324 |
| MDL Number | MFCD00041881 |
| SMILES | CCCCCCCCCCOS(=O)(=O)[O-].[Na+] |
| Synonym | sodium decyl sulfate,sodium n-decyl sulfate,decyl sodium sulfate,sulfuric acid, monodecyl ester, sodium salt,sodium decyl sulphate,unii-al92m833sy,n-decyl sodium sulfate,sodium n-decylsulphate,sulfuric acid, monodecyl ester, sodium salt 1:1,sulfuric acid, decyl ester, sodium salt |
| IUPAC Name | sodium;decyl sulfate |
| InChI Key | XZTJQQLJJCXOLP-UHFFFAOYSA-M |
| Molecular Formula | C10H21NaO4S |
Sodium n-octyl sulfate, 99%
CAS: 142-31-4 Molecular Formula: C8H17NaO4S Molecular Weight (g/mol): 232.27 MDL Number: MFCD00007470 InChI Key: WFRKJMRGXGWHBM-UHFFFAOYSA-M Synonym: sodium octyl sulfate,sodium n-octyl sulfate,sodium octyl sulphate,sipex ols,cycloryl os,duponol 80,sodium capryl sulfate,octyl sodium sulfate,sulfuric acid, monooctyl ester, sodium salt,octyl sulfate sodium salt PubChem CID: 2735107 IUPAC Name: sodium;octyl sulfate SMILES: CCCCCCCCOS(=O)(=O)[O-].[Na+]
| PubChem CID | 2735107 |
|---|---|
| CAS | 142-31-4 |
| Molecular Weight (g/mol) | 232.27 |
| MDL Number | MFCD00007470 |
| SMILES | CCCCCCCCOS(=O)(=O)[O-].[Na+] |
| Synonym | sodium octyl sulfate,sodium n-octyl sulfate,sodium octyl sulphate,sipex ols,cycloryl os,duponol 80,sodium capryl sulfate,octyl sodium sulfate,sulfuric acid, monooctyl ester, sodium salt,octyl sulfate sodium salt |
| IUPAC Name | sodium;octyl sulfate |
| InChI Key | WFRKJMRGXGWHBM-UHFFFAOYSA-M |
| Molecular Formula | C8H17NaO4S |
Sodium 1-tetradecyl sulfate, 95%, cont. up to ca 5% sodium methyl sulfate
CAS: 1191-50-0 Molecular Formula: C14H29NaO4S Molecular Weight (g/mol): 316.43 MDL Number: MFCD00007468 InChI Key: UPUIQOIQVMNQAP-UHFFFAOYSA-M Synonym: sodium tetradecyl sulfate,sodium myristyl sulfate,niaproof 4,sodium tetradecyl sulphate,tesapon k 14,texapon k 14,trombavar,natri tetradecylsulfas,sotradecol sodium,tetradecyl sodium sulfate PubChem CID: 23665770 IUPAC Name: sodium;tetradecyl sulfate SMILES: [Na+].CCCCCCCCCCCCCCOS([O-])(=O)=O
| PubChem CID | 23665770 |
|---|---|
| CAS | 1191-50-0 |
| Molecular Weight (g/mol) | 316.43 |
| MDL Number | MFCD00007468 |
| SMILES | [Na+].CCCCCCCCCCCCCCOS([O-])(=O)=O |
| Synonym | sodium tetradecyl sulfate,sodium myristyl sulfate,niaproof 4,sodium tetradecyl sulphate,tesapon k 14,texapon k 14,trombavar,natri tetradecylsulfas,sotradecol sodium,tetradecyl sodium sulfate |
| IUPAC Name | sodium;tetradecyl sulfate |
| InChI Key | UPUIQOIQVMNQAP-UHFFFAOYSA-M |
| Molecular Formula | C14H29NaO4S |
Methylsulfuric acid sodium salt, 99%, pract.
CAS: 512-42-5 Molecular Formula: CH3NaO4S Molecular Weight (g/mol): 134.08 MDL Number: MFCD00013457 InChI Key: DZXBHDRHRFLQCJ-UHFFFAOYSA-M Synonym: sodium methyl sulfate,methylsulfuric acid sodium salt,methyl sodium sulfate,sodium methyl sulphate,sodium monomethylsulfate,unii-38w76yj3jn,sodium methylsulfate,methyl sulfate sodium salt,methyl sulfate, sodium salt,sulfuric acid, monomethyl ester, sodium salt PubChem CID: 2735086 IUPAC Name: sodium;methyl sulfate SMILES: [Na+].COS([O-])(=O)=O
| PubChem CID | 2735086 |
|---|---|
| CAS | 512-42-5 |
| Molecular Weight (g/mol) | 134.08 |
| MDL Number | MFCD00013457 |
| SMILES | [Na+].COS([O-])(=O)=O |
| Synonym | sodium methyl sulfate,methylsulfuric acid sodium salt,methyl sodium sulfate,sodium methyl sulphate,sodium monomethylsulfate,unii-38w76yj3jn,sodium methylsulfate,methyl sulfate sodium salt,methyl sulfate, sodium salt,sulfuric acid, monomethyl ester, sodium salt |
| IUPAC Name | sodium;methyl sulfate |
| InChI Key | DZXBHDRHRFLQCJ-UHFFFAOYSA-M |
| Molecular Formula | CH3NaO4S |
Sodium Hexadecyl Sulfate (contains ca. 40% Sodium Stearyl Sulfate) 95.0+%, TCI America™
CAS: 1120-01-0 Molecular Formula: C16H33NaO3S Molecular Weight (g/mol): 328.49 MDL Number: MFCD00047766 InChI Key: PNGBYKXZVCIZRN-UHFFFAOYSA-M Synonym: sodium hexadecyl sulfate,sodium cetyl sulfate,sodium n-hexadecyl sulfate,unii-3v3y3o7biq,conco sulfate c,avitex c,avitex sf,sodium hexyldecyl sulfate,tergitol anionic 7,3v3y3o7biq PubChem CID: 23695542 IUPAC Name: sodium hexadecane-1-sulfonate SMILES: [Na+].CCCCCCCCCCCCCCCCS([O-])(=O)=O
| PubChem CID | 23695542 |
|---|---|
| CAS | 1120-01-0 |
| Molecular Weight (g/mol) | 328.49 |
| MDL Number | MFCD00047766 |
| SMILES | [Na+].CCCCCCCCCCCCCCCCS([O-])(=O)=O |
| Synonym | sodium hexadecyl sulfate,sodium cetyl sulfate,sodium n-hexadecyl sulfate,unii-3v3y3o7biq,conco sulfate c,avitex c,avitex sf,sodium hexyldecyl sulfate,tergitol anionic 7,3v3y3o7biq |
| IUPAC Name | sodium hexadecane-1-sulfonate |
| InChI Key | PNGBYKXZVCIZRN-UHFFFAOYSA-M |
| Molecular Formula | C16H33NaO3S |
Octyl sulfate, sodium salt, 99%, HPLC grade
CAS: 142-31-4 Molecular Formula: C8H15Na·H2SO4 Molecular Weight (g/mol): 232.28 InChI Key: WFRKJMRGXGWHBM-UHFFFAOYSA-M Synonym: sodium octyl sulfate,sodium n-octyl sulfate,sodium octyl sulphate,sipex ols,cycloryl os,duponol 80,sodium capryl sulfate,octyl sodium sulfate,sulfuric acid, monooctyl ester, sodium salt,octyl sulfate sodium salt PubChem CID: 2735107 IUPAC Name: sodium;octyl sulfate SMILES: CCCCCCCCOS(=O)(=O)[O-].[Na+]
| PubChem CID | 2735107 |
|---|---|
| CAS | 142-31-4 |
| Molecular Weight (g/mol) | 232.28 |
| SMILES | CCCCCCCCOS(=O)(=O)[O-].[Na+] |
| Synonym | sodium octyl sulfate,sodium n-octyl sulfate,sodium octyl sulphate,sipex ols,cycloryl os,duponol 80,sodium capryl sulfate,octyl sodium sulfate,sulfuric acid, monooctyl ester, sodium salt,octyl sulfate sodium salt |
| IUPAC Name | sodium;octyl sulfate |
| InChI Key | WFRKJMRGXGWHBM-UHFFFAOYSA-M |
| Molecular Formula | C8H15Na·H2SO4 |
Sodium Sulfamate 98.0+%, TCI America™
CAS: 13845-18-6 Molecular Formula: H2NNaO3S Molecular Weight (g/mol): 119.07 MDL Number: MFCD00059940 InChI Key: QDWYPRSFEZRKDK-UHFFFAOYSA-M Synonym: Aminosulfonic Acid Sodium Salt, Sulfamic Acid Sodium Salt PubChem CID: 23700090 IUPAC Name: sodium;sulfamate SMILES: NS(=O)(=O)[O-].[Na+]
| PubChem CID | 23700090 |
|---|---|
| CAS | 13845-18-6 |
| Molecular Weight (g/mol) | 119.07 |
| MDL Number | MFCD00059940 |
| SMILES | NS(=O)(=O)[O-].[Na+] |
| Synonym | Aminosulfonic Acid Sodium Salt, Sulfamic Acid Sodium Salt |
| IUPAC Name | sodium;sulfamate |
| InChI Key | QDWYPRSFEZRKDK-UHFFFAOYSA-M |
| Molecular Formula | H2NNaO3S |
Thermo Scientific Chemicals Sodium n-dodecyl sulfate, 99%, Molecular Biology Grade
CAS: 151-21-3 Molecular Formula: C12H25NaO4S Molecular Weight (g/mol): 288.38 MDL Number: MFCD00036175 InChI Key: DBMJMQXJHONAFJ-UHFFFAOYSA-M Synonym: sodium dodecyl sulfate,sodium lauryl sulfate,sodium dodecylsulfate,sodium lauryl sulphate,sodium dodecyl sulphate,dodecyl sulfate, sodium salt,anticerumen,gardinol,neutrazyme,duponal PubChem CID: 3423265 ChEBI: CHEBI:8984 SMILES: [Na+].CCCCCCCCCCCCOS([O-])(=O)=O
| PubChem CID | 3423265 |
|---|---|
| CAS | 151-21-3 |
| Molecular Weight (g/mol) | 288.38 |
| ChEBI | CHEBI:8984 |
| MDL Number | MFCD00036175 |
| SMILES | [Na+].CCCCCCCCCCCCOS([O-])(=O)=O |
| Synonym | sodium dodecyl sulfate,sodium lauryl sulfate,sodium dodecylsulfate,sodium lauryl sulphate,sodium dodecyl sulphate,dodecyl sulfate, sodium salt,anticerumen,gardinol,neutrazyme,duponal |
| InChI Key | DBMJMQXJHONAFJ-UHFFFAOYSA-M |
| Molecular Formula | C12H25NaO4S |
Sodium Methyl Sulfate 98.0+%, TCI America™
CAS: 512-42-5 Molecular Formula: CH3NaO4S Molecular Weight (g/mol): 134.08 MDL Number: MFCD00013457 InChI Key: DZXBHDRHRFLQCJ-UHFFFAOYSA-M Synonym: sodium methyl sulfate,methylsulfuric acid sodium salt,methyl sodium sulfate,sodium methyl sulphate,sodium monomethylsulfate,unii-38w76yj3jn,sodium methylsulfate,methyl sulfate sodium salt,methyl sulfate, sodium salt,sulfuric acid, monomethyl ester, sodium salt PubChem CID: 2735086 IUPAC Name: sodium methyl sulfate SMILES: [Na+].COS([O-])(=O)=O
| PubChem CID | 2735086 |
|---|---|
| CAS | 512-42-5 |
| Molecular Weight (g/mol) | 134.08 |
| MDL Number | MFCD00013457 |
| SMILES | [Na+].COS([O-])(=O)=O |
| Synonym | sodium methyl sulfate,methylsulfuric acid sodium salt,methyl sodium sulfate,sodium methyl sulphate,sodium monomethylsulfate,unii-38w76yj3jn,sodium methylsulfate,methyl sulfate sodium salt,methyl sulfate, sodium salt,sulfuric acid, monomethyl ester, sodium salt |
| IUPAC Name | sodium methyl sulfate |
| InChI Key | DZXBHDRHRFLQCJ-UHFFFAOYSA-M |
| Molecular Formula | CH3NaO4S |
Sodium Decyl Sulfate 98.0+%, TCI America™
CAS: 142-87-0 Molecular Formula: C10H21NaO4S Molecular Weight (g/mol): 260.324 MDL Number: MFCD00041881 InChI Key: XZTJQQLJJCXOLP-UHFFFAOYSA-M Synonym: sodium decyl sulfate,sodium n-decyl sulfate,decyl sodium sulfate,sulfuric acid, monodecyl ester, sodium salt,sodium decyl sulphate,unii-al92m833sy,n-decyl sodium sulfate,sodium n-decylsulphate,sulfuric acid, monodecyl ester, sodium salt 1:1,sulfuric acid, decyl ester, sodium salt PubChem CID: 23665771 IUPAC Name: sodium;decyl sulfate SMILES: CCCCCCCCCCOS(=O)(=O)[O-].[Na+]
| PubChem CID | 23665771 |
|---|---|
| CAS | 142-87-0 |
| Molecular Weight (g/mol) | 260.324 |
| MDL Number | MFCD00041881 |
| SMILES | CCCCCCCCCCOS(=O)(=O)[O-].[Na+] |
| Synonym | sodium decyl sulfate,sodium n-decyl sulfate,decyl sodium sulfate,sulfuric acid, monodecyl ester, sodium salt,sodium decyl sulphate,unii-al92m833sy,n-decyl sodium sulfate,sodium n-decylsulphate,sulfuric acid, monodecyl ester, sodium salt 1:1,sulfuric acid, decyl ester, sodium salt |
| IUPAC Name | sodium;decyl sulfate |
| InChI Key | XZTJQQLJJCXOLP-UHFFFAOYSA-M |
| Molecular Formula | C10H21NaO4S |
Sodium Dodecyl Sulfate 97.0+%, TCI America™
CAS: 151-21-3 Molecular Formula: C12H25NaO4S Molecular Weight (g/mol): 288.38 MDL Number: MFCD00036175 InChI Key: DBMJMQXJHONAFJ-UHFFFAOYSA-M Synonym: sodium dodecyl sulfate,sodium lauryl sulfate,sodium dodecylsulfate,sodium lauryl sulphate,sodium dodecyl sulphate,dodecyl sulfate, sodium salt,anticerumen,gardinol,neutrazyme,duponal PubChem CID: 3423265 ChEBI: CHEBI:8984 IUPAC Name: sodium dodecyl sulfate SMILES: [Na+].CCCCCCCCCCCCOS([O-])(=O)=O
| PubChem CID | 3423265 |
|---|---|
| CAS | 151-21-3 |
| Molecular Weight (g/mol) | 288.38 |
| ChEBI | CHEBI:8984 |
| MDL Number | MFCD00036175 |
| SMILES | [Na+].CCCCCCCCCCCCOS([O-])(=O)=O |
| Synonym | sodium dodecyl sulfate,sodium lauryl sulfate,sodium dodecylsulfate,sodium lauryl sulphate,sodium dodecyl sulphate,dodecyl sulfate, sodium salt,anticerumen,gardinol,neutrazyme,duponal |
| IUPAC Name | sodium dodecyl sulfate |
| InChI Key | DBMJMQXJHONAFJ-UHFFFAOYSA-M |
| Molecular Formula | C12H25NaO4S |
Sodium N-Cyclohexylsulfamate 98.0+%, TCI America™
CAS: 139-05-9 Molecular Formula: C6H12NNaO3S Molecular Weight (g/mol): 201.22 MDL Number: MFCD00003827 InChI Key: UDIPTWFVPPPURJ-UHFFFAOYSA-M Synonym: sodium cyclamate,sodium cyclohexylsulfamate,sodium n-cyclohexylsulfamate,cyclamate sodium,cyclamic acid sodium salt,assugrin,ibiosuc,suessette,suestamin,sugarin PubChem CID: 23665706 ChEBI: CHEBI:82431 IUPAC Name: sodium N-cyclohexylsulfamate SMILES: [Na+].[O-]S(=O)(=O)NC1CCCCC1
| PubChem CID | 23665706 |
|---|---|
| CAS | 139-05-9 |
| Molecular Weight (g/mol) | 201.22 |
| ChEBI | CHEBI:82431 |
| MDL Number | MFCD00003827 |
| SMILES | [Na+].[O-]S(=O)(=O)NC1CCCCC1 |
| Synonym | sodium cyclamate,sodium cyclohexylsulfamate,sodium n-cyclohexylsulfamate,cyclamate sodium,cyclamic acid sodium salt,assugrin,ibiosuc,suessette,suestamin,sugarin |
| IUPAC Name | sodium N-cyclohexylsulfamate |
| InChI Key | UDIPTWFVPPPURJ-UHFFFAOYSA-M |
| Molecular Formula | C6H12NNaO3S |