Alpha-halocarboxylic acids and derivatives
- (1)
- (25)
- (2)
- (1)
- (1)
- (14)
- (1)
- (1)
- (7)
- (1)
- (2)
- (9)
- (3)
- (1)
- (4)
- (2)
- (2)
- (1)
- (3)
- (2)
- (14)
- (1)
- (2)
- (5)
- (2)
- (3)
- (2)
- (1)
- (3)
- (3)
- (2)
- (1)
- (2)
- (3)
- (4)
- (2)
- (1)
- (40)
- (2)
- (2)
Filtered Search Results
Ethyl 2,2-difluoropropionate, 97%
CAS: 28781-85-3 Molecular Formula: C5H8F2O2 Molecular Weight (g/mol): 138.114 MDL Number: MFCD06657970 InChI Key: ISVLDAIKRGXNCZ-UHFFFAOYSA-N Synonym: 2,2-difluoropropionic acid ethyl ester,ethyl 2,2-difluoropropionate,2,2-difluoropropionicacidethylester,2,2-difluoro-propionic acid ethyl ester,propanoic acid, 2,2-difluoro-, ethyl ester,ethyl difluoropropionate,ethyl 2,2 difluoropropionate,difluoropropionic acid ethyl ester,2,2-difluoropropionic acidethyl ester PubChem CID: 2761188 IUPAC Name: ethyl 2,2-difluoropropanoate SMILES: CCOC(=O)C(C)(F)F
| PubChem CID | 2761188 |
|---|---|
| CAS | 28781-85-3 |
| Molecular Weight (g/mol) | 138.114 |
| MDL Number | MFCD06657970 |
| SMILES | CCOC(=O)C(C)(F)F |
| Synonym | 2,2-difluoropropionic acid ethyl ester,ethyl 2,2-difluoropropionate,2,2-difluoropropionicacidethylester,2,2-difluoro-propionic acid ethyl ester,propanoic acid, 2,2-difluoro-, ethyl ester,ethyl difluoropropionate,ethyl 2,2 difluoropropionate,difluoropropionic acid ethyl ester,2,2-difluoropropionic acidethyl ester |
| IUPAC Name | ethyl 2,2-difluoropropanoate |
| InChI Key | ISVLDAIKRGXNCZ-UHFFFAOYSA-N |
| Molecular Formula | C5H8F2O2 |
tert-Butyl 2-bromobutyrate, 98%
CAS: 24457-21-4 Molecular Formula: C8H15BrO2 Molecular Weight (g/mol): 223.11 MDL Number: MFCD00209634 InChI Key: RIUJWUWLGXBICR-UHFFFAOYSA-N Synonym: tert-butyl 2-bromobutyrate,tert-butyl2-bromobutanoate,t-butyl 2-bromobutyrate,2-bromobutyric acid tert-butyl ester,2-bromobutanoic acid tert-butyl ester,butanoic acid, 2-bromo-, 1,1-dimethylethyl ester,tertbutyl 2-bromobutyrate,tert-butyl-2-bromobutyrat,acmc-1cb0d,tert-butyl-2-bromobutyrate PubChem CID: 13124118 IUPAC Name: tert-butyl 2-bromobutanoate SMILES: CCC(C(=O)OC(C)(C)C)Br
| PubChem CID | 13124118 |
|---|---|
| CAS | 24457-21-4 |
| Molecular Weight (g/mol) | 223.11 |
| MDL Number | MFCD00209634 |
| SMILES | CCC(C(=O)OC(C)(C)C)Br |
| Synonym | tert-butyl 2-bromobutyrate,tert-butyl2-bromobutanoate,t-butyl 2-bromobutyrate,2-bromobutyric acid tert-butyl ester,2-bromobutanoic acid tert-butyl ester,butanoic acid, 2-bromo-, 1,1-dimethylethyl ester,tertbutyl 2-bromobutyrate,tert-butyl-2-bromobutyrat,acmc-1cb0d,tert-butyl-2-bromobutyrate |
| IUPAC Name | tert-butyl 2-bromobutanoate |
| InChI Key | RIUJWUWLGXBICR-UHFFFAOYSA-N |
| Molecular Formula | C8H15BrO2 |
Sodium trifluoroacetate, 98%
CAS: 2923-18-4 Molecular Formula: C2F3NaO2 Molecular Weight (g/mol): 136.01 MDL Number: MFCD00013217 InChI Key: UYCAUPASBSROMS-UHFFFAOYSA-M Synonym: sodium trifluoroacetate,trifluoroacetic acid sodium salt,acetic acid, trifluoro-, sodium salt,sodium perfluoroacetate,trifluoroacetate sodium,sodium 2,2,2-trifluoroacetate,trifluoroacetic acid sodium,trifluoroacetic acid,sodium salt,acetic acid, 2,2,2-trifluoro-, sodium salt 1:1,trifluoroacetic acid, sodium salt PubChem CID: 517019 SMILES: [Na+].[O-]C(=O)C(F)(F)F
| PubChem CID | 517019 |
|---|---|
| CAS | 2923-18-4 |
| Molecular Weight (g/mol) | 136.01 |
| MDL Number | MFCD00013217 |
| SMILES | [Na+].[O-]C(=O)C(F)(F)F |
| Synonym | sodium trifluoroacetate,trifluoroacetic acid sodium salt,acetic acid, trifluoro-, sodium salt,sodium perfluoroacetate,trifluoroacetate sodium,sodium 2,2,2-trifluoroacetate,trifluoroacetic acid sodium,trifluoroacetic acid,sodium salt,acetic acid, 2,2,2-trifluoro-, sodium salt 1:1,trifluoroacetic acid, sodium salt |
| InChI Key | UYCAUPASBSROMS-UHFFFAOYSA-M |
| Molecular Formula | C2F3NaO2 |
Dimethyl fluoromalonate, 97%
CAS: 344-14-9 Molecular Formula: C5H7FO4 Molecular Weight (g/mol): 150.105 MDL Number: MFCD00054680 InChI Key: ZVXHZSXYHFBIEW-UHFFFAOYSA-N PubChem CID: 2737111 IUPAC Name: dimethyl 2-fluoropropanedioate SMILES: COC(=O)C(C(=O)OC)F
| PubChem CID | 2737111 |
|---|---|
| CAS | 344-14-9 |
| Molecular Weight (g/mol) | 150.105 |
| MDL Number | MFCD00054680 |
| SMILES | COC(=O)C(C(=O)OC)F |
| IUPAC Name | dimethyl 2-fluoropropanedioate |
| InChI Key | ZVXHZSXYHFBIEW-UHFFFAOYSA-N |
| Molecular Formula | C5H7FO4 |
2-Fluoroisobutyric acid, 95%
CAS: 63812-15-7 Molecular Formula: C4H7FO2 Molecular Weight (g/mol): 106.096 MDL Number: MFCD03452788 InChI Key: NZDOWZQRNZLBOY-UHFFFAOYSA-N Synonym: 2-fluoroisobutyric acid,2-fluoroisobutanoic acid,2-fluoro-2-methyl-propanoic acid,2-fluoro-2-methylpropionic acid,fluoroisobutyric acid,acmc-1b6kg,2-methyl-2-fluoropropionic acid,2-fluoro-2-methyl-propionic acid,2-fluoranyl-2-methyl-propanoic acid,propanoic acid, 2-fluoro-2-methyl PubChem CID: 2782828 IUPAC Name: 2-fluoro-2-methylpropanoic acid SMILES: CC(C)(C(=O)O)F
| PubChem CID | 2782828 |
|---|---|
| CAS | 63812-15-7 |
| Molecular Weight (g/mol) | 106.096 |
| MDL Number | MFCD03452788 |
| SMILES | CC(C)(C(=O)O)F |
| Synonym | 2-fluoroisobutyric acid,2-fluoroisobutanoic acid,2-fluoro-2-methyl-propanoic acid,2-fluoro-2-methylpropionic acid,fluoroisobutyric acid,acmc-1b6kg,2-methyl-2-fluoropropionic acid,2-fluoro-2-methyl-propionic acid,2-fluoranyl-2-methyl-propanoic acid,propanoic acid, 2-fluoro-2-methyl |
| IUPAC Name | 2-fluoro-2-methylpropanoic acid |
| InChI Key | NZDOWZQRNZLBOY-UHFFFAOYSA-N |
| Molecular Formula | C4H7FO2 |
Ethyl 2-bromoisobutyrate, 98%
CAS: 600-00-0 Molecular Formula: C6H11BrO2 Molecular Weight (g/mol): 195.06 MDL Number: MFCD00000123 InChI Key: IOLQWGVDEFWYNP-UHFFFAOYSA-N Synonym: ethyl 2-bromoisobutyrate,ethyl 2-bromo-2-methylpropionate,ethyl alpha-bromoisobutyrate,ethyl .alpha.-bromoisobutyrate,propanoic acid, 2-bromo-2-methyl-, ethyl ester,2-bromo-2-methylpropanoic acid, ethyl ester,ethyl-2-bromoisobutyrate,propanoic acid, bromo-2-methyl-, ethyl ester,ethyl 2-bromo-2-methyl-propanoate,propionic acid, 2-bromo-2-methyl-, ethyl ester PubChem CID: 11745 IUPAC Name: ethyl 2-bromo-2-methylpropanoate SMILES: CCOC(=O)C(C)(C)Br
| PubChem CID | 11745 |
|---|---|
| CAS | 600-00-0 |
| Molecular Weight (g/mol) | 195.06 |
| MDL Number | MFCD00000123 |
| SMILES | CCOC(=O)C(C)(C)Br |
| Synonym | ethyl 2-bromoisobutyrate,ethyl 2-bromo-2-methylpropionate,ethyl alpha-bromoisobutyrate,ethyl .alpha.-bromoisobutyrate,propanoic acid, 2-bromo-2-methyl-, ethyl ester,2-bromo-2-methylpropanoic acid, ethyl ester,ethyl-2-bromoisobutyrate,propanoic acid, bromo-2-methyl-, ethyl ester,ethyl 2-bromo-2-methyl-propanoate,propionic acid, 2-bromo-2-methyl-, ethyl ester |
| IUPAC Name | ethyl 2-bromo-2-methylpropanoate |
| InChI Key | IOLQWGVDEFWYNP-UHFFFAOYSA-N |
| Molecular Formula | C6H11BrO2 |
Ethyl bromoacetate, 98%
CAS: 105-36-2 MDL Number: MFCD00000191 InChI Key: PQJJJMRNHATNKG-UHFFFAOYSA-N Synonym: ethyl bromoacetate,antol,ethyl bromacetate,bromoacetic acid ethyl ester,ethyl monobromoacetate,acetic acid, bromo-, ethyl ester,ethoxycarbonylmethyl bromide,bromoacetic acid, ethyl ester,ethyl alpha-bromoacetate,ethyl bromo acetate PubChem CID: 7748 IUPAC Name: ethyl 2-bromoacetate SMILES: CCOC(=O)CBr
| PubChem CID | 7748 |
|---|---|
| CAS | 105-36-2 |
| MDL Number | MFCD00000191 |
| SMILES | CCOC(=O)CBr |
| Synonym | ethyl bromoacetate,antol,ethyl bromacetate,bromoacetic acid ethyl ester,ethyl monobromoacetate,acetic acid, bromo-, ethyl ester,ethoxycarbonylmethyl bromide,bromoacetic acid, ethyl ester,ethyl alpha-bromoacetate,ethyl bromo acetate |
| IUPAC Name | ethyl 2-bromoacetate |
| InChI Key | PQJJJMRNHATNKG-UHFFFAOYSA-N |
alpha-Fluorophenylacetic acid, 97%
CAS: 1578-63-8 Molecular Formula: C8H7FO2 Molecular Weight (g/mol): 154.14 MDL Number: MFCD00004221 InChI Key: ATPPNMLQNZHDOG-UHFFFAOYSA-N Synonym: alpha-fluorophenylacetic acid,fluorophenylacetic acid,fluoro phenyl acetic acid,.alpha.-fluorophenylacetic acid,benzeneacetic acid, .alpha.-fluoro,fluorophenyl acetic acid,a-fluorophenylacetic acid,a-fluorobenzeneacetic acid,a-fluorophenyl acetic acid,acmc-1bt6i PubChem CID: 102649 IUPAC Name: 2-fluoro-2-phenylacetic acid SMILES: C1=CC=C(C=C1)C(C(=O)O)F
| PubChem CID | 102649 |
|---|---|
| CAS | 1578-63-8 |
| Molecular Weight (g/mol) | 154.14 |
| MDL Number | MFCD00004221 |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)F |
| Synonym | alpha-fluorophenylacetic acid,fluorophenylacetic acid,fluoro phenyl acetic acid,.alpha.-fluorophenylacetic acid,benzeneacetic acid, .alpha.-fluoro,fluorophenyl acetic acid,a-fluorophenylacetic acid,a-fluorobenzeneacetic acid,a-fluorophenyl acetic acid,acmc-1bt6i |
| IUPAC Name | 2-fluoro-2-phenylacetic acid |
| InChI Key | ATPPNMLQNZHDOG-UHFFFAOYSA-N |
| Molecular Formula | C8H7FO2 |
tert-Butyl chloroacetate, 97%
CAS: 107-59-5 Molecular Formula: C6H11ClO2 Molecular Weight (g/mol): 150 MDL Number: MFCD00000930 InChI Key: KUYMVWXKHQSIAS-UHFFFAOYSA-N Synonym: tert-butyl chloroacetate,chloroacetic acid tert-butyl ester,acetic acid, chloro-, 1,1-dimethylethyl ester,t-butyl chloroacetate,tert-butylchloroacetate,acetic acid, chloro-, tert-butyl ester,chloroacetic acid t-butyl ester,acetic acid, 2-chloro-, 1,1-dimethylethyl ester,t-butylchloroacetate,t-butyl-chloroacetate PubChem CID: 66052 IUPAC Name: tert-butyl 2-chloroacetate SMILES: CC(C)(C)OC(=O)CCl
| PubChem CID | 66052 |
|---|---|
| CAS | 107-59-5 |
| Molecular Weight (g/mol) | 150 |
| MDL Number | MFCD00000930 |
| SMILES | CC(C)(C)OC(=O)CCl |
| Synonym | tert-butyl chloroacetate,chloroacetic acid tert-butyl ester,acetic acid, chloro-, 1,1-dimethylethyl ester,t-butyl chloroacetate,tert-butylchloroacetate,acetic acid, chloro-, tert-butyl ester,chloroacetic acid t-butyl ester,acetic acid, 2-chloro-, 1,1-dimethylethyl ester,t-butylchloroacetate,t-butyl-chloroacetate |
| IUPAC Name | tert-butyl 2-chloroacetate |
| InChI Key | KUYMVWXKHQSIAS-UHFFFAOYSA-N |
| Molecular Formula | C6H11ClO2 |
Lead(II) trifluoroacetate hemihydrate, Thermo Scientific Chemicals
CAS: 4146-73-0 Molecular Formula: C4F6O4Pb Molecular Weight (g/mol): 433.23 MDL Number: MFCD00061594 InChI Key: XVULNTYAIWEMSW-UHFFFAOYSA-L Synonym: lead trifluoroacetate,lead ii 2,2,2-trifluoroacetate,acmc-1asut,bis trifluoroacetoxy lead ii PubChem CID: 71311182 IUPAC Name: lead(2+);2,2,2-trifluoroacetate SMILES: C(=O)(C(F)(F)F)[O-].C(=O)(C(F)(F)F)[O-].[Pb+2]
| PubChem CID | 71311182 |
|---|---|
| CAS | 4146-73-0 |
| Molecular Weight (g/mol) | 433.23 |
| MDL Number | MFCD00061594 |
| SMILES | C(=O)(C(F)(F)F)[O-].C(=O)(C(F)(F)F)[O-].[Pb+2] |
| Synonym | lead trifluoroacetate,lead ii 2,2,2-trifluoroacetate,acmc-1asut,bis trifluoroacetoxy lead ii |
| IUPAC Name | lead(2+);2,2,2-trifluoroacetate |
| InChI Key | XVULNTYAIWEMSW-UHFFFAOYSA-L |
| Molecular Formula | C4F6O4Pb |
Isopropyl trifluoroacetate, 97%
CAS: 400-38-4 Molecular Formula: C5H7F3O2 Molecular Weight (g/mol): 156.10 MDL Number: MFCD00013566 InChI Key: ASAXRKSDVDALDT-UHFFFAOYSA-N Synonym: isopropyl trifluoroacetate,isopropyltrifluoroacetate,isopropyl 2,2,2-trifluoroacetate,acetic acid, trifluoro-, 1-methylethyl ester,iso-propyl trifluoroacetate,trifluoroacetic acid isopropyl ester,pubchem12590,acmc-1ctsh,methylethyl 2,2,2-trifluoroacetate PubChem CID: 78998 IUPAC Name: propan-2-yl 2,2,2-trifluoroacetate SMILES: CC(C)OC(=O)C(F)(F)F
| PubChem CID | 78998 |
|---|---|
| CAS | 400-38-4 |
| Molecular Weight (g/mol) | 156.10 |
| MDL Number | MFCD00013566 |
| SMILES | CC(C)OC(=O)C(F)(F)F |
| Synonym | isopropyl trifluoroacetate,isopropyltrifluoroacetate,isopropyl 2,2,2-trifluoroacetate,acetic acid, trifluoro-, 1-methylethyl ester,iso-propyl trifluoroacetate,trifluoroacetic acid isopropyl ester,pubchem12590,acmc-1ctsh,methylethyl 2,2,2-trifluoroacetate |
| IUPAC Name | propan-2-yl 2,2,2-trifluoroacetate |
| InChI Key | ASAXRKSDVDALDT-UHFFFAOYSA-N |
| Molecular Formula | C5H7F3O2 |
Ethyl trifluoroacetate, 99%
CAS: 383-63-1 Molecular Formula: C4H5F3O2 Molecular Weight (g/mol): 142.08 MDL Number: MFCD00000419 InChI Key: STSCVKRWJPWALQ-UHFFFAOYSA-N Synonym: ethyl trifluoroacetate,trifluoroacetic acid ethyl ester,ethyltrifluoroacetate,acetic acid, trifluoro-, ethyl ester,trifluoroacetic acid, ethyl ester,ethyl trifluoroethanoate,unii-a6tzk6x11x,acetic acid, 2,2,2-trifluoro-, ethyl ester,a6tzk6x11x,ethyl ester of trifluoroacetic acid PubChem CID: 9794 IUPAC Name: ethyl 2,2,2-trifluoroacetate SMILES: CCOC(=O)C(F)(F)F
| PubChem CID | 9794 |
|---|---|
| CAS | 383-63-1 |
| Molecular Weight (g/mol) | 142.08 |
| MDL Number | MFCD00000419 |
| SMILES | CCOC(=O)C(F)(F)F |
| Synonym | ethyl trifluoroacetate,trifluoroacetic acid ethyl ester,ethyltrifluoroacetate,acetic acid, trifluoro-, ethyl ester,trifluoroacetic acid, ethyl ester,ethyl trifluoroethanoate,unii-a6tzk6x11x,acetic acid, 2,2,2-trifluoro-, ethyl ester,a6tzk6x11x,ethyl ester of trifluoroacetic acid |
| IUPAC Name | ethyl 2,2,2-trifluoroacetate |
| InChI Key | STSCVKRWJPWALQ-UHFFFAOYSA-N |
| Molecular Formula | C4H5F3O2 |
2-Bromo-3-fluoropropionic acid, 96%, Thermo Scientific Chemicals
CAS: 16652-36-1 Molecular Formula: C3H4BrFO2 Molecular Weight (g/mol): 170.97 MDL Number: MFCD09800640 InChI Key: FBPUCVAAEPPEMG-UHFFFAOYNA-N Synonym: 2-bromo-3-fluoropropionic acid,acmc-20ao2z,3-fluoro-2-bromo-propionic acid PubChem CID: 316511 IUPAC Name: 2-bromo-3-fluoropropanoic acid SMILES: OC(=O)C(Br)CF
| PubChem CID | 316511 |
|---|---|
| CAS | 16652-36-1 |
| Molecular Weight (g/mol) | 170.97 |
| MDL Number | MFCD09800640 |
| SMILES | OC(=O)C(Br)CF |
| Synonym | 2-bromo-3-fluoropropionic acid,acmc-20ao2z,3-fluoro-2-bromo-propionic acid |
| IUPAC Name | 2-bromo-3-fluoropropanoic acid |
| InChI Key | FBPUCVAAEPPEMG-UHFFFAOYNA-N |
| Molecular Formula | C3H4BrFO2 |
Iodoacetic acid, 97+%
CAS: 64-69-7 Molecular Formula: C2H3IO2 Molecular Weight (g/mol): 185.948 MDL Number: MFCD00002685 InChI Key: JDNTWHVOXJZDSN-UHFFFAOYSA-N Synonym: iodoacetic acid,acetic acid, iodo,iodoacetate,monoiodoacetic acid,monoiodoacetate,monoiodine acetate,iodoaceticacid,iodoethanoic acid,acetic acid, 2-iodo,kyselina jodoctova PubChem CID: 5240 ChEBI: CHEBI:74571 IUPAC Name: 2-iodoacetic acid SMILES: C(C(=O)O)I
| PubChem CID | 5240 |
|---|---|
| CAS | 64-69-7 |
| Molecular Weight (g/mol) | 185.948 |
| ChEBI | CHEBI:74571 |
| MDL Number | MFCD00002685 |
| SMILES | C(C(=O)O)I |
| Synonym | iodoacetic acid,acetic acid, iodo,iodoacetate,monoiodoacetic acid,monoiodoacetate,monoiodine acetate,iodoaceticacid,iodoethanoic acid,acetic acid, 2-iodo,kyselina jodoctova |
| IUPAC Name | 2-iodoacetic acid |
| InChI Key | JDNTWHVOXJZDSN-UHFFFAOYSA-N |
| Molecular Formula | C2H3IO2 |
2,2,2-Trifluoroethyl trifluoroacetate, 97+%, Thermo Scientific Chemicals
CAS: 407-38-5 Molecular Formula: C4H2F6O2 Molecular Weight (g/mol): 196.05 MDL Number: MFCD00000418 InChI Key: ZKUJOCJJXCPCFS-UHFFFAOYSA-N Synonym: 2,2,2-trifluoroethyl trifluoroacetate,acetic acid, trifluoro-, 2,2,2-trifluoroethyl ester,trifluoroacetic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethyltrifluoroacetate,pubchem12623,acmc-1ake7,cf3co2ch2cf3,cf3c o och2cf3,ksc496e0r,trifluoroethyl trifluoroacetate PubChem CID: 67888 IUPAC Name: 2,2,2-trifluoroethyl 2,2,2-trifluoroacetate SMILES: FC(F)(F)COC(=O)C(F)(F)F
| PubChem CID | 67888 |
|---|---|
| CAS | 407-38-5 |
| Molecular Weight (g/mol) | 196.05 |
| MDL Number | MFCD00000418 |
| SMILES | FC(F)(F)COC(=O)C(F)(F)F |
| Synonym | 2,2,2-trifluoroethyl trifluoroacetate,acetic acid, trifluoro-, 2,2,2-trifluoroethyl ester,trifluoroacetic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethyltrifluoroacetate,pubchem12623,acmc-1ake7,cf3co2ch2cf3,cf3c o och2cf3,ksc496e0r,trifluoroethyl trifluoroacetate |
| IUPAC Name | 2,2,2-trifluoroethyl 2,2,2-trifluoroacetate |
| InChI Key | ZKUJOCJJXCPCFS-UHFFFAOYSA-N |
| Molecular Formula | C4H2F6O2 |