Phenol esters
- (6)
- (3)
- (2)
- (8)
- (2)
- (3)
- (4)
- (6)
- (14)
- (1)
- (3)
- (9)
- (1)
- (1)
- (1)
- (53)
- (2)
- (2)
- (1)
- (6)
- (3)
- (2)
- (16)
- (1)
- (6)
- (42)
- (58)
- (3)
- (2)
- (2)
- (1)
- (2)
- (1)
- (2)
- (2)
- (1)
- (1)
Filtered Search Results
4-Acetoxystyrene, 96%, stabilized with 200-300 ppm MEHQ, Thermo Scientific Chemicals
CAS: 2628-16-2 Molecular Formula: C10H10O2 Molecular Weight (g/mol): 162.19 MDL Number: MFCD00075734 InChI Key: JAMNSIXSLVPNLC-UHFFFAOYSA-N Synonym: 4-acetoxystyrene,4-vinylphenyl acetate,4-ethenylphenol acetate,p-acetoxystyrene,phenol, 4-ethenyl-, acetate,p-vinylphenol acetate,unii-7s21904ayn,phenol, 4-ethenyl-, 1-acetate,4-ethenylphenyl acetate,acetic acid 4-vinylphenyl ester PubChem CID: 75821 IUPAC Name: (4-ethenylphenyl) acetate SMILES: CC(=O)OC1=CC=C(C=C1)C=C
| PubChem CID | 75821 |
|---|---|
| CAS | 2628-16-2 |
| Molecular Weight (g/mol) | 162.19 |
| MDL Number | MFCD00075734 |
| SMILES | CC(=O)OC1=CC=C(C=C1)C=C |
| Synonym | 4-acetoxystyrene,4-vinylphenyl acetate,4-ethenylphenol acetate,p-acetoxystyrene,phenol, 4-ethenyl-, acetate,p-vinylphenol acetate,unii-7s21904ayn,phenol, 4-ethenyl-, 1-acetate,4-ethenylphenyl acetate,acetic acid 4-vinylphenyl ester |
| IUPAC Name | (4-ethenylphenyl) acetate |
| InChI Key | JAMNSIXSLVPNLC-UHFFFAOYSA-N |
| Molecular Formula | C10H10O2 |
Phenyl acetate, 97%
CAS: 122-79-2 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 MDL Number: MFCD00008699 InChI Key: IPBVNPXQWQGGJP-UHFFFAOYSA-N Synonym: acetic acid phenyl ester,phenol acetate,acetylphenol,acetic acid, phenyl ester,acetyl phenol,acetoxybenzene,acetates,acetic acid,phenyl ester,fenylester kyseliny octove,fenylester kyseliny octove czech PubChem CID: 31229 ChEBI: CHEBI:8082 IUPAC Name: phenyl acetate SMILES: CC(=O)OC1=CC=CC=C1
| PubChem CID | 31229 |
|---|---|
| CAS | 122-79-2 |
| Molecular Weight (g/mol) | 136.15 |
| ChEBI | CHEBI:8082 |
| MDL Number | MFCD00008699 |
| SMILES | CC(=O)OC1=CC=CC=C1 |
| Synonym | acetic acid phenyl ester,phenol acetate,acetylphenol,acetic acid, phenyl ester,acetyl phenol,acetoxybenzene,acetates,acetic acid,phenyl ester,fenylester kyseliny octove,fenylester kyseliny octove czech |
| IUPAC Name | phenyl acetate |
| InChI Key | IPBVNPXQWQGGJP-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |
4-Acetoxy-3-methoxybenzaldehyde, 98%
CAS: 881-68-5 Molecular Formula: C10H10O4 Molecular Weight (g/mol): 194.19 MDL Number: MFCD00003362 InChI Key: PZSJOBKRSVRODF-UHFFFAOYSA-N Synonym: vanillin acetate,4-acetoxy-3-methoxybenzaldehyde,acetovanillin,acetylvanillin,vanillin, acetate,4-o-acetylvanillin,o-acetylvanillin,benzaldehyde, 4-acetyloxy-3-methoxy,3-methoxy-4-acetoxybenzaldehyde,acetyl vanillin PubChem CID: 61229 ChEBI: CHEBI:86956 IUPAC Name: (4-formyl-2-methoxyphenyl) acetate SMILES: CC(=O)OC1=C(C=C(C=C1)C=O)OC
| PubChem CID | 61229 |
|---|---|
| CAS | 881-68-5 |
| Molecular Weight (g/mol) | 194.19 |
| ChEBI | CHEBI:86956 |
| MDL Number | MFCD00003362 |
| SMILES | CC(=O)OC1=C(C=C(C=C1)C=O)OC |
| Synonym | vanillin acetate,4-acetoxy-3-methoxybenzaldehyde,acetovanillin,acetylvanillin,vanillin, acetate,4-o-acetylvanillin,o-acetylvanillin,benzaldehyde, 4-acetyloxy-3-methoxy,3-methoxy-4-acetoxybenzaldehyde,acetyl vanillin |
| IUPAC Name | (4-formyl-2-methoxyphenyl) acetate |
| InChI Key | PZSJOBKRSVRODF-UHFFFAOYSA-N |
| Molecular Formula | C10H10O4 |
4-Nitrophenyl acetate, 97%
CAS: 830-03-5 Molecular Formula: C8H7NO4 Molecular Weight (g/mol): 181.15 MDL Number: MFCD00007326 InChI Key: QAUUDNIGJSLPSX-UHFFFAOYSA-N Synonym: p-nitrophenyl acetate,p-acetoxynitrobenzene,acetic acid, 4-nitrophenyl ester,p-nitrophenol acetate,acetic acid p-nitrophenyl ester,acetic acid, p-nitrophenyl ester,p-nitrophenyl acetate van,4-nitrophenyl acetate,unii-i902j0qh9s,acetic acid 4-nitrophenyl ester PubChem CID: 13243 ChEBI: CHEBI:82635 SMILES: CC(=O)OC1=CC=C(C=C1)[N+]([O-])=O
| PubChem CID | 13243 |
|---|---|
| CAS | 830-03-5 |
| Molecular Weight (g/mol) | 181.15 |
| ChEBI | CHEBI:82635 |
| MDL Number | MFCD00007326 |
| SMILES | CC(=O)OC1=CC=C(C=C1)[N+]([O-])=O |
| Synonym | p-nitrophenyl acetate,p-acetoxynitrobenzene,acetic acid, 4-nitrophenyl ester,p-nitrophenol acetate,acetic acid p-nitrophenyl ester,acetic acid, p-nitrophenyl ester,p-nitrophenyl acetate van,4-nitrophenyl acetate,unii-i902j0qh9s,acetic acid 4-nitrophenyl ester |
| InChI Key | QAUUDNIGJSLPSX-UHFFFAOYSA-N |
| Molecular Formula | C8H7NO4 |
4-Nitrophenyl palmitate, 98+%
CAS: 1492-30-4 Molecular Formula: C22H35NO4 Molecular Weight (g/mol): 377.525 MDL Number: MFCD00047732 InChI Key: LVZSQWIWCANHPF-UHFFFAOYSA-N Synonym: 4-nitrophenyl palmitate,p-nitrophenyl palmitate,hexadecanoic acid 4-nitrophenyl ester,4-nitrophenyl hexadecanoate,hexadecanoic acid, 4-nitrophenyl ester,4-nitrophenylpalmitate,paranitrophenyl palmitate,para-nitrophenyl palmitate,p-nitrophenyl hexadecanoate,4-nitrophenyl palmitate # PubChem CID: 73891 ChEBI: CHEBI:85645 IUPAC Name: (4-nitrophenyl) hexadecanoate SMILES: CCCCCCCCCCCCCCCC(=O)OC1=CC=C(C=C1)[N+](=O)[O-]
| PubChem CID | 73891 |
|---|---|
| CAS | 1492-30-4 |
| Molecular Weight (g/mol) | 377.525 |
| ChEBI | CHEBI:85645 |
| MDL Number | MFCD00047732 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
| Synonym | 4-nitrophenyl palmitate,p-nitrophenyl palmitate,hexadecanoic acid 4-nitrophenyl ester,4-nitrophenyl hexadecanoate,hexadecanoic acid, 4-nitrophenyl ester,4-nitrophenylpalmitate,paranitrophenyl palmitate,para-nitrophenyl palmitate,p-nitrophenyl hexadecanoate,4-nitrophenyl palmitate # |
| IUPAC Name | (4-nitrophenyl) hexadecanoate |
| InChI Key | LVZSQWIWCANHPF-UHFFFAOYSA-N |
| Molecular Formula | C22H35NO4 |
4-Acetoxybenzeneboronic acid, 97%, Thermo Scientific Chemicals
CAS: 177490-82-3 Molecular Formula: C8H9BO4 Molecular Weight (g/mol): 179.97 MDL Number: MFCD09027198 InChI Key: VILXJXDXZGKJLU-UHFFFAOYSA-N Synonym: 4-acetoxyphenyl boronic acid,4-acetoxyphenylboronic acid,4-acetoxybenzeneboronic acid,4-acetyloxy phenylboronic acid,boronic acid, 4-acetyloxy phenyl,boronic acid,b-4-acetyloxy phenyl,4-boronophenyl acetate,pubchem20170,acmc-209ecy,4-acetoxyphenyl boronicacid PubChem CID: 44119577 IUPAC Name: (4-acetyloxyphenyl)boronic acid SMILES: CC(=O)OC1=CC=C(C=C1)B(O)O
| PubChem CID | 44119577 |
|---|---|
| CAS | 177490-82-3 |
| Molecular Weight (g/mol) | 179.97 |
| MDL Number | MFCD09027198 |
| SMILES | CC(=O)OC1=CC=C(C=C1)B(O)O |
| Synonym | 4-acetoxyphenyl boronic acid,4-acetoxyphenylboronic acid,4-acetoxybenzeneboronic acid,4-acetyloxy phenylboronic acid,boronic acid, 4-acetyloxy phenyl,boronic acid,b-4-acetyloxy phenyl,4-boronophenyl acetate,pubchem20170,acmc-209ecy,4-acetoxyphenyl boronicacid |
| IUPAC Name | (4-acetyloxyphenyl)boronic acid |
| InChI Key | VILXJXDXZGKJLU-UHFFFAOYSA-N |
| Molecular Formula | C8H9BO4 |
Phenyl acetate, 97%
CAS: 122-79-2 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 MDL Number: MFCD00008699 InChI Key: IPBVNPXQWQGGJP-UHFFFAOYSA-N Synonym: acetic acid phenyl ester,phenol acetate,acetylphenol,acetic acid, phenyl ester,acetyl phenol,acetoxybenzene,acetates,acetic acid,phenyl ester,fenylester kyseliny octove,fenylester kyseliny octove czech PubChem CID: 31229 ChEBI: CHEBI:8082 IUPAC Name: phenyl acetate SMILES: CC(=O)OC1=CC=CC=C1
| PubChem CID | 31229 |
|---|---|
| CAS | 122-79-2 |
| Molecular Weight (g/mol) | 136.15 |
| ChEBI | CHEBI:8082 |
| MDL Number | MFCD00008699 |
| SMILES | CC(=O)OC1=CC=CC=C1 |
| Synonym | acetic acid phenyl ester,phenol acetate,acetylphenol,acetic acid, phenyl ester,acetyl phenol,acetoxybenzene,acetates,acetic acid,phenyl ester,fenylester kyseliny octove,fenylester kyseliny octove czech |
| IUPAC Name | phenyl acetate |
| InChI Key | IPBVNPXQWQGGJP-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |
4-Nitrophenyl acetate, 97%
CAS: 830-03-5 Molecular Formula: C8H7NO4 Molecular Weight (g/mol): 181.15 MDL Number: MFCD00007326 InChI Key: QAUUDNIGJSLPSX-UHFFFAOYSA-N Synonym: p-nitrophenyl acetate,p-acetoxynitrobenzene,acetic acid, 4-nitrophenyl ester,p-nitrophenol acetate,acetic acid p-nitrophenyl ester,acetic acid, p-nitrophenyl ester,p-nitrophenyl acetate van,4-nitrophenyl acetate,unii-i902j0qh9s,acetic acid 4-nitrophenyl ester PubChem CID: 13243 ChEBI: CHEBI:82635 IUPAC Name: (4-nitrophenyl) acetate SMILES: CC(=O)OC1=CC=C(C=C1)[N+]([O-])=O
| PubChem CID | 13243 |
|---|---|
| CAS | 830-03-5 |
| Molecular Weight (g/mol) | 181.15 |
| ChEBI | CHEBI:82635 |
| MDL Number | MFCD00007326 |
| SMILES | CC(=O)OC1=CC=C(C=C1)[N+]([O-])=O |
| Synonym | p-nitrophenyl acetate,p-acetoxynitrobenzene,acetic acid, 4-nitrophenyl ester,p-nitrophenol acetate,acetic acid p-nitrophenyl ester,acetic acid, p-nitrophenyl ester,p-nitrophenyl acetate van,4-nitrophenyl acetate,unii-i902j0qh9s,acetic acid 4-nitrophenyl ester |
| IUPAC Name | (4-nitrophenyl) acetate |
| InChI Key | QAUUDNIGJSLPSX-UHFFFAOYSA-N |
| Molecular Formula | C8H7NO4 |
Phenyl acrylate, 97%
CAS: 937-41-7 Molecular Formula: C9H8O2 Molecular Weight (g/mol): 148.161 MDL Number: MFCD00048145 InChI Key: WRAQQYDMVSCOTE-UHFFFAOYSA-N Synonym: phenyl acrylate,phenylacrylate,2-propenoic acid, phenyl ester,phenol acrylate,phenyl-acrylate,acrylic acid phenyl ester,phenyl acrylate 5g,2-propenoic acid,phenyl ester,acrylic acid phenyl ester, stabilized with bht PubChem CID: 61242 IUPAC Name: phenyl prop-2-enoate SMILES: C=CC(=O)OC1=CC=CC=C1
| PubChem CID | 61242 |
|---|---|
| CAS | 937-41-7 |
| Molecular Weight (g/mol) | 148.161 |
| MDL Number | MFCD00048145 |
| SMILES | C=CC(=O)OC1=CC=CC=C1 |
| Synonym | phenyl acrylate,phenylacrylate,2-propenoic acid, phenyl ester,phenol acrylate,phenyl-acrylate,acrylic acid phenyl ester,phenyl acrylate 5g,2-propenoic acid,phenyl ester,acrylic acid phenyl ester, stabilized with bht |
| IUPAC Name | phenyl prop-2-enoate |
| InChI Key | WRAQQYDMVSCOTE-UHFFFAOYSA-N |
| Molecular Formula | C9H8O2 |
4-Acetoxy-3-methoxybenzaldehyde, 98%
CAS: 881-68-5 Molecular Formula: C10H10O4 Molecular Weight (g/mol): 194.186 MDL Number: MFCD00003362 InChI Key: PZSJOBKRSVRODF-UHFFFAOYSA-N Synonym: vanillin acetate,4-acetoxy-3-methoxybenzaldehyde,acetovanillin,acetylvanillin,vanillin, acetate,4-o-acetylvanillin,o-acetylvanillin,benzaldehyde, 4-acetyloxy-3-methoxy,3-methoxy-4-acetoxybenzaldehyde,acetyl vanillin PubChem CID: 61229 ChEBI: CHEBI:86956 IUPAC Name: (4-formyl-2-methoxyphenyl) acetate SMILES: CC(=O)OC1=C(C=C(C=C1)C=O)OC
| PubChem CID | 61229 |
|---|---|
| CAS | 881-68-5 |
| Molecular Weight (g/mol) | 194.186 |
| ChEBI | CHEBI:86956 |
| MDL Number | MFCD00003362 |
| SMILES | CC(=O)OC1=C(C=C(C=C1)C=O)OC |
| Synonym | vanillin acetate,4-acetoxy-3-methoxybenzaldehyde,acetovanillin,acetylvanillin,vanillin, acetate,4-o-acetylvanillin,o-acetylvanillin,benzaldehyde, 4-acetyloxy-3-methoxy,3-methoxy-4-acetoxybenzaldehyde,acetyl vanillin |
| IUPAC Name | (4-formyl-2-methoxyphenyl) acetate |
| InChI Key | PZSJOBKRSVRODF-UHFFFAOYSA-N |
| Molecular Formula | C10H10O4 |
1,4-Diacetoxybenzene, 98%
CAS: 1205-91-0 Molecular Formula: C10H10O4 Molecular Weight (g/mol): 194.19 MDL Number: MFCD00011643 InChI Key: AKOGNYJNGMLDOA-UHFFFAOYSA-N Synonym: 1,4-diacetoxybenzene,hydroquinone diacetate,p-diacetoxybenzene,1,4-benzenediol, diacetate,p-phenylene diacetate,hydroquinone, diacetate,4-acetyloxy phenyl acetate,1,4-phenylene diacetate,1,4-benzenediol, 1,4-diacetate,benzene-1,4-diyl diacetate PubChem CID: 71006 IUPAC Name: (4-acetyloxyphenyl) acetate SMILES: CC(=O)OC1=CC=C(OC(C)=O)C=C1
| PubChem CID | 71006 |
|---|---|
| CAS | 1205-91-0 |
| Molecular Weight (g/mol) | 194.19 |
| MDL Number | MFCD00011643 |
| SMILES | CC(=O)OC1=CC=C(OC(C)=O)C=C1 |
| Synonym | 1,4-diacetoxybenzene,hydroquinone diacetate,p-diacetoxybenzene,1,4-benzenediol, diacetate,p-phenylene diacetate,hydroquinone, diacetate,4-acetyloxy phenyl acetate,1,4-phenylene diacetate,1,4-benzenediol, 1,4-diacetate,benzene-1,4-diyl diacetate |
| IUPAC Name | (4-acetyloxyphenyl) acetate |
| InChI Key | AKOGNYJNGMLDOA-UHFFFAOYSA-N |
| Molecular Formula | C10H10O4 |
1,3-Diacetoxybenzene, 97%
CAS: 108-58-7 Molecular Formula: C10H10O4 Molecular Weight (g/mol): 194.186 MDL Number: MFCD00008701 InChI Key: STOUHHBZBQBYHH-UHFFFAOYSA-N Synonym: 1,3-diacetoxybenzene,resorcinol diacetate,1,3-benzenediol, diacetate,m-phenylenediacetate,resorcinol, diacetate,m-phenylene di acetate,1,3-dihydroxybenzene diacetate,dihydroxybenzene diacetate,1,3-phenylene diacetate,1,3-benzenediol, 1,3-diacetate PubChem CID: 7942 IUPAC Name: (3-acetyloxyphenyl) acetate SMILES: CC(=O)OC1=CC(=CC=C1)OC(=O)C
| PubChem CID | 7942 |
|---|---|
| CAS | 108-58-7 |
| Molecular Weight (g/mol) | 194.186 |
| MDL Number | MFCD00008701 |
| SMILES | CC(=O)OC1=CC(=CC=C1)OC(=O)C |
| Synonym | 1,3-diacetoxybenzene,resorcinol diacetate,1,3-benzenediol, diacetate,m-phenylenediacetate,resorcinol, diacetate,m-phenylene di acetate,1,3-dihydroxybenzene diacetate,dihydroxybenzene diacetate,1,3-phenylene diacetate,1,3-benzenediol, 1,3-diacetate |
| IUPAC Name | (3-acetyloxyphenyl) acetate |
| InChI Key | STOUHHBZBQBYHH-UHFFFAOYSA-N |
| Molecular Formula | C10H10O4 |
1-Acetoxy-2-methoxybenzene, 98%
CAS: 15212-03-0 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.176 MDL Number: MFCD00017221 InChI Key: BHJHPYFAYGAPLS-UHFFFAOYSA-N Synonym: guaiacol acetate,1-acetoxy-2-methoxybenzene,guaiacyl acetate,o-acetoxyanisole,o-methoxyphenyl acetate,o-anisyl acetate,acetyl guaiacol,phenol, 2-methoxy-, acetate,o-acetylguaiacol,eucol PubChem CID: 61155 ChEBI: CHEBI:86645 IUPAC Name: (2-methoxyphenyl) acetate SMILES: CC(=O)OC1=CC=CC=C1OC
| PubChem CID | 61155 |
|---|---|
| CAS | 15212-03-0 |
| Molecular Weight (g/mol) | 166.176 |
| ChEBI | CHEBI:86645 |
| MDL Number | MFCD00017221 |
| SMILES | CC(=O)OC1=CC=CC=C1OC |
| Synonym | guaiacol acetate,1-acetoxy-2-methoxybenzene,guaiacyl acetate,o-acetoxyanisole,o-methoxyphenyl acetate,o-anisyl acetate,acetyl guaiacol,phenol, 2-methoxy-, acetate,o-acetylguaiacol,eucol |
| IUPAC Name | (2-methoxyphenyl) acetate |
| InChI Key | BHJHPYFAYGAPLS-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
4-Acetoxybenzonitrile, 97%, Thermo Scientific™
CAS: 13031-41-9 Molecular Formula: C9H7NO2 Molecular Weight (g/mol): 161.16 MDL Number: MFCD00129158 InChI Key: CJGXWABHYYJNJH-UHFFFAOYSA-N Synonym: p-cyanophenyl acetate,benzonitrile, 4-acetyloxy,4-acetoxybenzonitrile,unii-eel1pcp8am,eel1pcp8am,4-cyanophenyl acetate,4-acetyloxy benzonitrile,benzonitrile, p-hydroxy-, acetate ester PubChem CID: 83062 IUPAC Name: (4-cyanophenyl) acetate SMILES: CC(=O)OC1=CC=C(C=C1)C#N
| PubChem CID | 83062 |
|---|---|
| CAS | 13031-41-9 |
| Molecular Weight (g/mol) | 161.16 |
| MDL Number | MFCD00129158 |
| SMILES | CC(=O)OC1=CC=C(C=C1)C#N |
| Synonym | p-cyanophenyl acetate,benzonitrile, 4-acetyloxy,4-acetoxybenzonitrile,unii-eel1pcp8am,eel1pcp8am,4-cyanophenyl acetate,4-acetyloxy benzonitrile,benzonitrile, p-hydroxy-, acetate ester |
| IUPAC Name | (4-cyanophenyl) acetate |
| InChI Key | CJGXWABHYYJNJH-UHFFFAOYSA-N |
| Molecular Formula | C9H7NO2 |
Pentafluorophenyl trifluoroacetate, 98+%
CAS: 14533-84-7 Molecular Formula: C8F8O2 Molecular Weight (g/mol): 280.07 MDL Number: MFCD00134438 InChI Key: VCQURUZYYSOUHP-UHFFFAOYSA-N Synonym: pentafluorophenyl trifluoroacetate,perfluorophenyl 2,2,2-trifluoroacetate,trifluoroacetic acid pentafluorophenyl ester,pentafluorphenyl trifluoracetate,pentafluorophenyltrifluoroacetate,pentafluorophenyl 2,2,2-trifluoroacetate,acetic acid, trifluoro-, pentafluorophenyl ester,acetic acid,2,2,2-trifluoro-, 2,3,4,5,6-pentafluorophenyl ester,ambotzrl-1046,acmc-1bui8 PubChem CID: 4327891 IUPAC Name: (2,3,4,5,6-pentafluorophenyl) 2,2,2-trifluoroacetate SMILES: FC1=C(F)C(F)=C(OC(=O)C(F)(F)F)C(F)=C1F
| PubChem CID | 4327891 |
|---|---|
| CAS | 14533-84-7 |
| Molecular Weight (g/mol) | 280.07 |
| MDL Number | MFCD00134438 |
| SMILES | FC1=C(F)C(F)=C(OC(=O)C(F)(F)F)C(F)=C1F |
| Synonym | pentafluorophenyl trifluoroacetate,perfluorophenyl 2,2,2-trifluoroacetate,trifluoroacetic acid pentafluorophenyl ester,pentafluorphenyl trifluoracetate,pentafluorophenyltrifluoroacetate,pentafluorophenyl 2,2,2-trifluoroacetate,acetic acid, trifluoro-, pentafluorophenyl ester,acetic acid,2,2,2-trifluoro-, 2,3,4,5,6-pentafluorophenyl ester,ambotzrl-1046,acmc-1bui8 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2,2,2-trifluoroacetate |
| InChI Key | VCQURUZYYSOUHP-UHFFFAOYSA-N |
| Molecular Formula | C8F8O2 |