Vinyl halides
- (3)
- (4)
- (2)
- (4)
- (4)
- (4)
- (1)
- (2)
- (17)
- (6)
- (2)
- (1)
- (3)
- (3)
- (2)
- (20)
- (2)
- (1)
- (3)
- (4)
- (1)
- (13)
- (2)
- (25)
- (2)
- (19)
- (43)
- (2)
- (2)
- (1)
- (3)
- (4)
- (1)
- (2)
- (2)
- (2)
- (2)
Filtered Search Results
2-Bromo-2-butene, 98%, mixture of cis and trans
CAS: 13294-71-8 Molecular Formula: C4H7Br Molecular Weight (g/mol): 135.00 MDL Number: MFCD00000141 InChI Key: UILZQFGKPHAAOU-ONEGZZNKSA-N Synonym: 2-bromo-2-butene,trans-2-bromo-2-butene,2-butene, 2-bromo,e-2-bromobut-2-ene,2-bromo-2-butene cis,e-2-bromo-2-butene,1-methyl-1-propenyl bromide,cis-2-bromo-2-butene,e-2-bromo-but-2-ene,2e-2-bromo-2-butene # PubChem CID: 5364387 IUPAC Name: (E)-2-bromobut-2-ene SMILES: C\C=C(/C)Br
| PubChem CID | 5364387 |
|---|---|
| CAS | 13294-71-8 |
| Molecular Weight (g/mol) | 135.00 |
| MDL Number | MFCD00000141 |
| SMILES | C\C=C(/C)Br |
| Synonym | 2-bromo-2-butene,trans-2-bromo-2-butene,2-butene, 2-bromo,e-2-bromobut-2-ene,2-bromo-2-butene cis,e-2-bromo-2-butene,1-methyl-1-propenyl bromide,cis-2-bromo-2-butene,e-2-bromo-but-2-ene,2e-2-bromo-2-butene # |
| IUPAC Name | (E)-2-bromobut-2-ene |
| InChI Key | UILZQFGKPHAAOU-ONEGZZNKSA-N |
| Molecular Formula | C4H7Br |
2-Bromoindene, 98%
CAS: 10485-09-3 Molecular Formula: C9H7Br Molecular Weight (g/mol): 195.059 MDL Number: MFCD06797863 InChI Key: CCUYEVNCRQDQRF-UHFFFAOYSA-N Synonym: 2-bromoindene,1h-indene, 2-bromo,indene, 2-bromo,2-bromanyl-1h-indene,2-bromoindene, 95+%,2-bromo-indene,pubchem9657,#,acmc-1c5rn,sodium perborate,tetrahydrate PubChem CID: 575586 IUPAC Name: 2-bromo-1H-indene SMILES: C1C2=CC=CC=C2C=C1Br
| PubChem CID | 575586 |
|---|---|
| CAS | 10485-09-3 |
| Molecular Weight (g/mol) | 195.059 |
| MDL Number | MFCD06797863 |
| SMILES | C1C2=CC=CC=C2C=C1Br |
| Synonym | 2-bromoindene,1h-indene, 2-bromo,indene, 2-bromo,2-bromanyl-1h-indene,2-bromoindene, 95+%,2-bromo-indene,pubchem9657,#,acmc-1c5rn,sodium perborate,tetrahydrate |
| IUPAC Name | 2-bromo-1H-indene |
| InChI Key | CCUYEVNCRQDQRF-UHFFFAOYSA-N |
| Molecular Formula | C9H7Br |
Ethyl 3-chloro-5-(trifluoromethyl)pyridine-2-carboxylate, 96%, Thermo Scientific Chemicals
CAS: 128073-16-5 Molecular Formula: C9H7ClF3NO2 Molecular Weight (g/mol): 253.605 MDL Number: MFCD06656414 InChI Key: COMQYNZHBCNPNW-UHFFFAOYSA-N Synonym: ethyl 3-chloro-5-trifluoromethyl picolinate,ethyl 3-chloro-5-trifluoromethyl pyridine-2-carboxylate,ethyl 3-chloro-5-trifluoromethyl-2-pyridinecarboxylate,2-pyridinecarboxylic acid, 3-chloro-5-trifluoromethyl-, ethyl ester,3-chloro-5-trifluoromethylpyridine-2-carboxylic acid ethyl ester,ethyl 5-trifluoromethyl-3-chloropyridine-2-carboxylate,ethyl 3-chloro-5-trifluoromethyl picolite,ethyl 3-chloro-5trifluoromethyl-2-pyridinecarboxylate PubChem CID: 22013558 IUPAC Name: ethyl 3-chloro-5-(trifluoromethyl)pyridine-2-carboxylate SMILES: CCOC(=O)C1=C(C=C(C=N1)C(F)(F)F)Cl
| PubChem CID | 22013558 |
|---|---|
| CAS | 128073-16-5 |
| Molecular Weight (g/mol) | 253.605 |
| MDL Number | MFCD06656414 |
| SMILES | CCOC(=O)C1=C(C=C(C=N1)C(F)(F)F)Cl |
| Synonym | ethyl 3-chloro-5-trifluoromethyl picolinate,ethyl 3-chloro-5-trifluoromethyl pyridine-2-carboxylate,ethyl 3-chloro-5-trifluoromethyl-2-pyridinecarboxylate,2-pyridinecarboxylic acid, 3-chloro-5-trifluoromethyl-, ethyl ester,3-chloro-5-trifluoromethylpyridine-2-carboxylic acid ethyl ester,ethyl 5-trifluoromethyl-3-chloropyridine-2-carboxylate,ethyl 3-chloro-5-trifluoromethyl picolite,ethyl 3-chloro-5trifluoromethyl-2-pyridinecarboxylate |
| IUPAC Name | ethyl 3-chloro-5-(trifluoromethyl)pyridine-2-carboxylate |
| InChI Key | COMQYNZHBCNPNW-UHFFFAOYSA-N |
| Molecular Formula | C9H7ClF3NO2 |
4-Bromo-1,1,2-trifluoro-1-butene, 98%
CAS: 10493-44-4 Molecular Formula: C4H4BrF3 Molecular Weight (g/mol): 188.975 MDL Number: MFCD00039274 InChI Key: GQCQMFYIFUDARF-UHFFFAOYSA-N Synonym: 4-bromo-1,1,2-trifluoro-1-butene,4-bromo-1,1,2-trifluorobutene-1,1-butene, 4-bromo-1,1,2-trifluoro,1,1,2-trifluoro-4-bromobutene,acmc-20amo8,timtec-bb sbb006604,gqcqmfyifudarf-uhfffaoysa,4-bromo-1,1,2-trifluorobutene.,3,4,4-trifluoro-3-butenyl bromide,3,4,4-trifluorobut-3-enyl bromide PubChem CID: 66333 IUPAC Name: 4-bromo-1,1,2-trifluorobut-1-ene SMILES: C(CBr)C(=C(F)F)F
| PubChem CID | 66333 |
|---|---|
| CAS | 10493-44-4 |
| Molecular Weight (g/mol) | 188.975 |
| MDL Number | MFCD00039274 |
| SMILES | C(CBr)C(=C(F)F)F |
| Synonym | 4-bromo-1,1,2-trifluoro-1-butene,4-bromo-1,1,2-trifluorobutene-1,1-butene, 4-bromo-1,1,2-trifluoro,1,1,2-trifluoro-4-bromobutene,acmc-20amo8,timtec-bb sbb006604,gqcqmfyifudarf-uhfffaoysa,4-bromo-1,1,2-trifluorobutene.,3,4,4-trifluoro-3-butenyl bromide,3,4,4-trifluorobut-3-enyl bromide |
| IUPAC Name | 4-bromo-1,1,2-trifluorobut-1-ene |
| InChI Key | GQCQMFYIFUDARF-UHFFFAOYSA-N |
| Molecular Formula | C4H4BrF3 |
3-Fluorophthalic anhydride, 98%
CAS: 652-39-1 Molecular Formula: C8H3FO3 Molecular Weight (g/mol): 166.11 MDL Number: MFCD00039696 InChI Key: WWJAZKZLSDRAIV-UHFFFAOYSA-N Synonym: 3-fluorophthalic anhydride,4-fluoroisobenzofuran-1,3-dione,3-fluorophthalicanhydride,4-fluoro-1,3-isobenzofurandione,1,3-isobenzofurandione, 4-fluoro,5-fluoro-isobenzofurandione,4-fluoro-1,3-dihydro-2-benzofuran-1,3-dione,4-fluor-2-benzofuran-1,3-dion,pubchem1949,fluorophthalic anhydride PubChem CID: 69551 IUPAC Name: 4-fluoro-2-benzofuran-1,3-dione SMILES: FC1=CC=CC2=C1C(=O)OC2=O
| PubChem CID | 69551 |
|---|---|
| CAS | 652-39-1 |
| Molecular Weight (g/mol) | 166.11 |
| MDL Number | MFCD00039696 |
| SMILES | FC1=CC=CC2=C1C(=O)OC2=O |
| Synonym | 3-fluorophthalic anhydride,4-fluoroisobenzofuran-1,3-dione,3-fluorophthalicanhydride,4-fluoro-1,3-isobenzofurandione,1,3-isobenzofurandione, 4-fluoro,5-fluoro-isobenzofurandione,4-fluoro-1,3-dihydro-2-benzofuran-1,3-dione,4-fluor-2-benzofuran-1,3-dion,pubchem1949,fluorophthalic anhydride |
| IUPAC Name | 4-fluoro-2-benzofuran-1,3-dione |
| InChI Key | WWJAZKZLSDRAIV-UHFFFAOYSA-N |
| Molecular Formula | C8H3FO3 |
2-Bromopropene, 99%, stabilized
CAS: 557-93-7 Molecular Formula: C3H5Br Molecular Weight (g/mol): 120.98 MDL Number: MFCD00000140 InChI Key: PHMRPWPDDRGGGF-UHFFFAOYSA-N Synonym: 2-bromopropene,isopropenyl bromide,1-propene, 2-bromo,2-bromo-1-propene,2-bromopropylene,propene, 2-bromo,isopropylene bromide,alpha-methylvinyl bromide,.alpha.-methylvinyl bromide,2-bromo-propene PubChem CID: 11202 IUPAC Name: 2-bromoprop-1-ene SMILES: CC(=C)Br
| PubChem CID | 11202 |
|---|---|
| CAS | 557-93-7 |
| Molecular Weight (g/mol) | 120.98 |
| MDL Number | MFCD00000140 |
| SMILES | CC(=C)Br |
| Synonym | 2-bromopropene,isopropenyl bromide,1-propene, 2-bromo,2-bromo-1-propene,2-bromopropylene,propene, 2-bromo,isopropylene bromide,alpha-methylvinyl bromide,.alpha.-methylvinyl bromide,2-bromo-propene |
| IUPAC Name | 2-bromoprop-1-ene |
| InChI Key | PHMRPWPDDRGGGF-UHFFFAOYSA-N |
| Molecular Formula | C3H5Br |
3-Bromo-3-buten-1-ol, 97+%
CAS: 76334-36-6 Molecular Formula: C4H7BrO Molecular Weight (g/mol): 151 MDL Number: MFCD00154041 InChI Key: RTKMFQOHBDVEBC-UHFFFAOYSA-N Synonym: 3-bromo-3-buten-1-ol,3-buten-1-ol, 3-bromo,3bb,zlchem 79,acmc-20an90,3-bromanylbut-3-en-1-ol PubChem CID: 533975 IUPAC Name: 3-bromobut-3-en-1-ol SMILES: C=C(CCO)Br
| PubChem CID | 533975 |
|---|---|
| CAS | 76334-36-6 |
| Molecular Weight (g/mol) | 151 |
| MDL Number | MFCD00154041 |
| SMILES | C=C(CCO)Br |
| Synonym | 3-bromo-3-buten-1-ol,3-buten-1-ol, 3-bromo,3bb,zlchem 79,acmc-20an90,3-bromanylbut-3-en-1-ol |
| IUPAC Name | 3-bromobut-3-en-1-ol |
| InChI Key | RTKMFQOHBDVEBC-UHFFFAOYSA-N |
| Molecular Formula | C4H7BrO |
Perfluoro(2-methyl-2-pentene), 97%
CAS: 1584-03-8 Molecular Formula: C6F12 Molecular Weight (g/mol): 300.047 MDL Number: MFCD00015724 InChI Key: FAEGGADNHFKDQX-UHFFFAOYSA-N Synonym: perfluoro-2-methyl-2-pentene,perfluoro 2-methylpent-2-ene,hexafluoropropene dimer,perfluoro-2-methylpent-2-ene,1,1,1,3,4,4,5,5,5-nonafluoro-2-trifluoromethyl pent-2-ene,perfluoro 2-methyl-2-pentene,nonafluoro-2-trifluoromethyl pent-2-ene,1,1,1,3,4,4,5,5,5-nonafluoro-2-trifluoromethyl pent-4-ene,2-pentene, 1,1,1,3,4,4,5,5,5-nonafluoro-2-trifluoromethyl,1,1,1,3,4,4,5,5,5-nonafluoro-2-trifluoromethyl-2-pentene PubChem CID: 74105 IUPAC Name: 1,1,1,3,4,4,5,5,5-nonafluoro-2-(trifluoromethyl)pent-2-ene SMILES: C(=C(C(C(F)(F)F)(F)F)F)(C(F)(F)F)C(F)(F)F
| PubChem CID | 74105 |
|---|---|
| CAS | 1584-03-8 |
| Molecular Weight (g/mol) | 300.047 |
| MDL Number | MFCD00015724 |
| SMILES | C(=C(C(C(F)(F)F)(F)F)F)(C(F)(F)F)C(F)(F)F |
| Synonym | perfluoro-2-methyl-2-pentene,perfluoro 2-methylpent-2-ene,hexafluoropropene dimer,perfluoro-2-methylpent-2-ene,1,1,1,3,4,4,5,5,5-nonafluoro-2-trifluoromethyl pent-2-ene,perfluoro 2-methyl-2-pentene,nonafluoro-2-trifluoromethyl pent-2-ene,1,1,1,3,4,4,5,5,5-nonafluoro-2-trifluoromethyl pent-4-ene,2-pentene, 1,1,1,3,4,4,5,5,5-nonafluoro-2-trifluoromethyl,1,1,1,3,4,4,5,5,5-nonafluoro-2-trifluoromethyl-2-pentene |
| IUPAC Name | 1,1,1,3,4,4,5,5,5-nonafluoro-2-(trifluoromethyl)pent-2-ene |
| InChI Key | FAEGGADNHFKDQX-UHFFFAOYSA-N |
| Molecular Formula | C6F12 |
2-Bromopropene, 99%, stab.
CAS: 557-93-7 Molecular Formula: C3H5Br Molecular Weight (g/mol): 120.977 MDL Number: MFCD00000140 InChI Key: PHMRPWPDDRGGGF-UHFFFAOYSA-N Synonym: 2-bromopropene,isopropenyl bromide,1-propene, 2-bromo,2-bromo-1-propene,2-bromopropylene,propene, 2-bromo,isopropylene bromide,alpha-methylvinyl bromide,.alpha.-methylvinyl bromide,2-bromo-propene PubChem CID: 11202 IUPAC Name: 2-bromoprop-1-ene SMILES: CC(=C)Br
| PubChem CID | 11202 |
|---|---|
| CAS | 557-93-7 |
| Molecular Weight (g/mol) | 120.977 |
| MDL Number | MFCD00000140 |
| SMILES | CC(=C)Br |
| Synonym | 2-bromopropene,isopropenyl bromide,1-propene, 2-bromo,2-bromo-1-propene,2-bromopropylene,propene, 2-bromo,isopropylene bromide,alpha-methylvinyl bromide,.alpha.-methylvinyl bromide,2-bromo-propene |
| IUPAC Name | 2-bromoprop-1-ene |
| InChI Key | PHMRPWPDDRGGGF-UHFFFAOYSA-N |
| Molecular Formula | C3H5Br |
cis-3-Chloroacrylic acid, 98+%
CAS: 1609-93-4 Molecular Formula: C3H3ClO2 Molecular Weight (g/mol): 106.51 MDL Number: MFCD00004368 InChI Key: MHMUCYJKZUZMNJ-UPHRSURJSA-N Synonym: cis-3-chloroacrylic acid,z-3-chloroacrylic acid,cis-beta-chloroacrylic acid,2-propenoic acid, 3-chloro-, z,cis-3-chloropropenoic acid,2z-3-chloroacrylic acid,2-propenoic acid, 3-chloro-, 2z,cis-.beta.-chloroacrylic acid,z-3-chloroprop-2-enoic acid,acrylic acid, 3-chloro-, z-8ci PubChem CID: 643794 ChEBI: CHEBI:27397 IUPAC Name: (Z)-3-chloroprop-2-enoic acid SMILES: OC(=O)\C=C/Cl
| PubChem CID | 643794 |
|---|---|
| CAS | 1609-93-4 |
| Molecular Weight (g/mol) | 106.51 |
| ChEBI | CHEBI:27397 |
| MDL Number | MFCD00004368 |
| SMILES | OC(=O)\C=C/Cl |
| Synonym | cis-3-chloroacrylic acid,z-3-chloroacrylic acid,cis-beta-chloroacrylic acid,2-propenoic acid, 3-chloro-, z,cis-3-chloropropenoic acid,2z-3-chloroacrylic acid,2-propenoic acid, 3-chloro-, 2z,cis-.beta.-chloroacrylic acid,z-3-chloroprop-2-enoic acid,acrylic acid, 3-chloro-, z-8ci |
| IUPAC Name | (Z)-3-chloroprop-2-enoic acid |
| InChI Key | MHMUCYJKZUZMNJ-UPHRSURJSA-N |
| Molecular Formula | C3H3ClO2 |
Tetrabromophthalic anhydride, 98%
CAS: 632-79-1 Molecular Formula: C8Br4O3 Molecular Weight (g/mol): 463.701 MDL Number: MFCD00005919 InChI Key: QHWKHLYUUZGSCW-UHFFFAOYSA-N PubChem CID: 12443 IUPAC Name: 4,5,6,7-tetrabromo-2-benzofuran-1,3-dione SMILES: C12=C(C(=C(C(=C1Br)Br)Br)Br)C(=O)OC2=O
| PubChem CID | 12443 |
|---|---|
| CAS | 632-79-1 |
| Molecular Weight (g/mol) | 463.701 |
| MDL Number | MFCD00005919 |
| SMILES | C12=C(C(=C(C(=C1Br)Br)Br)Br)C(=O)OC2=O |
| IUPAC Name | 4,5,6,7-tetrabromo-2-benzofuran-1,3-dione |
| InChI Key | QHWKHLYUUZGSCW-UHFFFAOYSA-N |
| Molecular Formula | C8Br4O3 |
Tetrachlorophthalic anhydride, 98%
CAS: 117-08-8 Molecular Formula: C8Cl4O3 Molecular Weight (g/mol): 285.885 MDL Number: MFCD00005920 InChI Key: AUHHYELHRWCWEZ-UHFFFAOYSA-N Synonym: tetrachlorophthalic anhydride,tetrathal,4,5,6,7-tetrachloro-1,3-isobenzofurandione,niagathal,1,3-isobenzofurandione, 4,5,6,7-tetrachloro,phthalic anhydride, tetrachloro,4,5,6,7-tetrachloroisobenzofuran-1,3-dione,1,3-dioxy-4,5,6,7-tetrachloroisobenzofuran,unii-76glw0lbek,ccris 6202 PubChem CID: 8326 ChEBI: CHEBI:59097 IUPAC Name: 4,5,6,7-tetrachloro-2-benzofuran-1,3-dione SMILES: C12=C(C(=C(C(=C1Cl)Cl)Cl)Cl)C(=O)OC2=O
| PubChem CID | 8326 |
|---|---|
| CAS | 117-08-8 |
| Molecular Weight (g/mol) | 285.885 |
| ChEBI | CHEBI:59097 |
| MDL Number | MFCD00005920 |
| SMILES | C12=C(C(=C(C(=C1Cl)Cl)Cl)Cl)C(=O)OC2=O |
| Synonym | tetrachlorophthalic anhydride,tetrathal,4,5,6,7-tetrachloro-1,3-isobenzofurandione,niagathal,1,3-isobenzofurandione, 4,5,6,7-tetrachloro,phthalic anhydride, tetrachloro,4,5,6,7-tetrachloroisobenzofuran-1,3-dione,1,3-dioxy-4,5,6,7-tetrachloroisobenzofuran,unii-76glw0lbek,ccris 6202 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-benzofuran-1,3-dione |
| InChI Key | AUHHYELHRWCWEZ-UHFFFAOYSA-N |
| Molecular Formula | C8Cl4O3 |
trans-3-chloroacrylic acid, 99%
CAS: 2345-61-1 Molecular Formula: C3H3ClO2 Molecular Weight (g/mol): 106.51 MDL Number: MFCD00064237 InChI Key: MHMUCYJKZUZMNJ-OWOJBTEDSA-N Synonym: trans-3-chloroacrylic acid,e-3-chloroacrylic acid,3-chloroacrylic acid,3-chloroprop-2-enoic acid,acrylic acid, 3-chloro-, trans,acrylic acid, 3-chloro-, e,trans-3-chloropropenoic acid,trans-beta-chloroacrylic acid,2-propenoic acid, 3-chloro-, e,ccris 3546 PubChem CID: 638124 IUPAC Name: (E)-3-chloroprop-2-enoic acid SMILES: C(=CCl)C(=O)O
| PubChem CID | 638124 |
|---|---|
| CAS | 2345-61-1 |
| Molecular Weight (g/mol) | 106.51 |
| MDL Number | MFCD00064237 |
| SMILES | C(=CCl)C(=O)O |
| Synonym | trans-3-chloroacrylic acid,e-3-chloroacrylic acid,3-chloroacrylic acid,3-chloroprop-2-enoic acid,acrylic acid, 3-chloro-, trans,acrylic acid, 3-chloro-, e,trans-3-chloropropenoic acid,trans-beta-chloroacrylic acid,2-propenoic acid, 3-chloro-, e,ccris 3546 |
| IUPAC Name | (E)-3-chloroprop-2-enoic acid |
| InChI Key | MHMUCYJKZUZMNJ-OWOJBTEDSA-N |
| Molecular Formula | C3H3ClO2 |
2-Bromo-1-butene, 97%
CAS: 23074-36-4 Molecular Formula: C4H7Br Molecular Weight (g/mol): 135.004 MDL Number: MFCD00039178 InChI Key: HQMXRIGBXOFKIU-UHFFFAOYSA-N PubChem CID: 89990 IUPAC Name: 2-bromobut-1-ene SMILES: CCC(=C)Br
| PubChem CID | 89990 |
|---|---|
| CAS | 23074-36-4 |
| Molecular Weight (g/mol) | 135.004 |
| MDL Number | MFCD00039178 |
| SMILES | CCC(=C)Br |
| IUPAC Name | 2-bromobut-1-ene |
| InChI Key | HQMXRIGBXOFKIU-UHFFFAOYSA-N |
| Molecular Formula | C4H7Br |
2-Bromo-3,3,3-trifluoro-1-propene, 97%, Thermo Scientific Chemicals
CAS: 1514-82-5 Molecular Formula: C3H2BrF3 Molecular Weight (g/mol): 174.95 MDL Number: MFCD00077469 InChI Key: QKBKGNDTLQFSEU-UHFFFAOYSA-N Synonym: 2-bromo-3,3,3-trifluoropropene,2-bromo-3,3,3-trifluoro-1-propene,1-propene, 2-bromo-3,3,3-trifluoro,2-bromo-3,3,3-trifluoro-propene,2-bromo-3,3,3-trifluoro-prop-1-ene,3,3,3-trifluoro-2-bromo-1-propene,2-bromotrifluoropropene,acmc-1bt5r,ksc495o1d,3,3,3-trifluoro-2-bromopropene PubChem CID: 272696 IUPAC Name: 2-bromo-3,3,3-trifluoroprop-1-ene SMILES: FC(F)(F)C(Br)=C
| PubChem CID | 272696 |
|---|---|
| CAS | 1514-82-5 |
| Molecular Weight (g/mol) | 174.95 |
| MDL Number | MFCD00077469 |
| SMILES | FC(F)(F)C(Br)=C |
| Synonym | 2-bromo-3,3,3-trifluoropropene,2-bromo-3,3,3-trifluoro-1-propene,1-propene, 2-bromo-3,3,3-trifluoro,2-bromo-3,3,3-trifluoro-propene,2-bromo-3,3,3-trifluoro-prop-1-ene,3,3,3-trifluoro-2-bromo-1-propene,2-bromotrifluoropropene,acmc-1bt5r,ksc495o1d,3,3,3-trifluoro-2-bromopropene |
| IUPAC Name | 2-bromo-3,3,3-trifluoroprop-1-ene |
| InChI Key | QKBKGNDTLQFSEU-UHFFFAOYSA-N |
| Molecular Formula | C3H2BrF3 |