Organic potassium salts
- (6)
- (10)
- (4)
- (2)
- (4)
- (7)
- (1)
- (4)
- (1)
- (22)
- (2)
- (1)
- (1)
- (20)
- (2)
- (5)
- (6)
- (5)
- (3)
- (6)
- (10)
- (4)
- (3)
- (2)
- (2)
- (65)
- (6)
- (2)
- (1)
- (2)
- (8)
- (7)
- (4)
- (5)
- (2)
- (2)
- (2)
- (2)
- (1)
- (8)
Filtered Search Results
Potassium Hydrogen Phthalate (Primary Standard/Meets ACS Specifications), Fisher Chemical™
CAS: 877-24-7 Molecular Formula: C8H5KO4 Molecular Weight (g/mol): 204.222 MDL Number: MFCD00013070 InChI Key: IWZKICVEHNUQTL-UHFFFAOYSA-M Synonym: potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic PubChem CID: 23676735 IUPAC Name: potassium;2-carboxybenzoate SMILES: C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+]
| PubChem CID | 23676735 |
|---|---|
| CAS | 877-24-7 |
| Molecular Weight (g/mol) | 204.222 |
| MDL Number | MFCD00013070 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| Synonym | potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic |
| IUPAC Name | potassium;2-carboxybenzoate |
| InChI Key | IWZKICVEHNUQTL-UHFFFAOYSA-M |
| Molecular Formula | C8H5KO4 |
Acesulfame K, For Food Analysis, 99.0%, MilliporeSigma™ Supelco™
CAS: 55589-62-3 Molecular Formula: C4H4KNO4S Molecular Weight (g/mol): 201.24 MDL Number: MFCD00043833 InChI Key: JLEKLYQXZHJOTQ-UHFFFAOYSA-M Synonym: 6-Methyl-1,2,3-oxathiazin-4(3 H)-one 2,2-dioxide potassium salt IUPAC Name: potassium 6-methyl-2,4-dioxo-4H-1,2λ⁶,3-oxathiazin-2-olate SMILES: [K+].CC1=CC(=O)N=S([O-])(=O)O1
| CAS | 55589-62-3 |
|---|---|
| Molecular Weight (g/mol) | 201.24 |
| MDL Number | MFCD00043833 |
| SMILES | [K+].CC1=CC(=O)N=S([O-])(=O)O1 |
| Synonym | 6-Methyl-1,2,3-oxathiazin-4(3 H)-one 2,2-dioxide potassium salt |
| IUPAC Name | potassium 6-methyl-2,4-dioxo-4H-1,2λ⁶,3-oxathiazin-2-olate |
| InChI Key | JLEKLYQXZHJOTQ-UHFFFAOYSA-M |
| Molecular Formula | C4H4KNO4S |
Potassium oxalate monohydrate, 99+%, for analysis
CAS: 6487-48-5 Molecular Formula: C2H2K2O5 Molecular Weight (g/mol): 184.23 MDL Number: MFCD00150033 InChI Key: QCPTVXCMROGZOL-UHFFFAOYSA-L Synonym: potassium oxalate monohydrate,potassium oxalate hydrate,oxalic acid potassium salt,ethanedioic acid, dipotassium salt, monohydrate,dipotassium oxalate hydrate,dipotassium hydrate oxalate,acmc-1bcm6,ksc495a4h,dipotassium oxalate monohydrate,dipotassium ethanedioate hydrate PubChem CID: 2724193 IUPAC Name: dipotassium;oxalate;hydrate SMILES: O.[K+].[K+].[O-]C(=O)C([O-])=O
| PubChem CID | 2724193 |
|---|---|
| CAS | 6487-48-5 |
| Molecular Weight (g/mol) | 184.23 |
| MDL Number | MFCD00150033 |
| SMILES | O.[K+].[K+].[O-]C(=O)C([O-])=O |
| Synonym | potassium oxalate monohydrate,potassium oxalate hydrate,oxalic acid potassium salt,ethanedioic acid, dipotassium salt, monohydrate,dipotassium oxalate hydrate,dipotassium hydrate oxalate,acmc-1bcm6,ksc495a4h,dipotassium oxalate monohydrate,dipotassium ethanedioate hydrate |
| IUPAC Name | dipotassium;oxalate;hydrate |
| InChI Key | QCPTVXCMROGZOL-UHFFFAOYSA-L |
| Molecular Formula | C2H2K2O5 |
Phthalimide, potassium derivative, 99%
CAS: 1074-82-4 Molecular Formula: C8H4KNO2 Molecular Weight (g/mol): 185.22 MDL Number: MFCD00005887 InChI Key: FYRHIOVKTDQVFC-UHFFFAOYSA-M Synonym: potassium phthalimide,potassium 1,3-dioxoisoindolin-2-ide,n-potassiophthalimide,phthalimide potassium salt,n-potassium phthalimide,unii-x6kka27dil,phthalimide, potassium salt,potassium phthalamide,1h-isoindole-1,3 2h-dione, potassium salt,x6kka27dil PubChem CID: 3356745 IUPAC Name: potassium;isoindol-2-ide-1,3-dione SMILES: [K+].O=C1[N-]C(=O)C2=CC=CC=C12
| PubChem CID | 3356745 |
|---|---|
| CAS | 1074-82-4 |
| Molecular Weight (g/mol) | 185.22 |
| MDL Number | MFCD00005887 |
| SMILES | [K+].O=C1[N-]C(=O)C2=CC=CC=C12 |
| Synonym | potassium phthalimide,potassium 1,3-dioxoisoindolin-2-ide,n-potassiophthalimide,phthalimide potassium salt,n-potassium phthalimide,unii-x6kka27dil,phthalimide, potassium salt,potassium phthalamide,1h-isoindole-1,3 2h-dione, potassium salt,x6kka27dil |
| IUPAC Name | potassium;isoindol-2-ide-1,3-dione |
| InChI Key | FYRHIOVKTDQVFC-UHFFFAOYSA-M |
| Molecular Formula | C8H4KNO2 |
Potassium hydrogen phthalate, 99+%
CAS: 877-24-7 Molecular Formula: C8H5KO4 Molecular Weight (g/mol): 204.22 MDL Number: MFCD00013070 InChI Key: IWZKICVEHNUQTL-UHFFFAOYSA-M Synonym: potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic PubChem CID: 23676735 IUPAC Name: potassium;2-carboxybenzoate SMILES: C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+]
| PubChem CID | 23676735 |
|---|---|
| CAS | 877-24-7 |
| Molecular Weight (g/mol) | 204.22 |
| MDL Number | MFCD00013070 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| Synonym | potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic |
| IUPAC Name | potassium;2-carboxybenzoate |
| InChI Key | IWZKICVEHNUQTL-UHFFFAOYSA-M |
| Molecular Formula | C8H5KO4 |
Oxalic acid, potassium salt dihydrate, 99%, extra pure
CAS: 6100-20-5 Molecular Formula: C4H3KO8 Molecular Weight (g/mol): 218.16 MDL Number: MFCD00150443,MFCD00150443 InChI Key: GANDVAJEIJXBQJ-UHFFFAOYSA-M Synonym: potassium trihydrogen dioxalate dihydrate,potassium ion oxalic acid dihydrate hydrogen oxalate,potassium oxalic acid dihydrate hydrogen oxalate PubChem CID: 131698588 IUPAC Name: potassium;hydron;oxalate;dihydrate SMILES: [K+].OC(=O)C(O)=O.OC(=O)C([O-])=O
| PubChem CID | 131698588 |
|---|---|
| CAS | 6100-20-5 |
| Molecular Weight (g/mol) | 218.16 |
| MDL Number | MFCD00150443,MFCD00150443 |
| SMILES | [K+].OC(=O)C(O)=O.OC(=O)C([O-])=O |
| Synonym | potassium trihydrogen dioxalate dihydrate,potassium ion oxalic acid dihydrate hydrogen oxalate,potassium oxalic acid dihydrate hydrogen oxalate |
| IUPAC Name | potassium;hydron;oxalate;dihydrate |
| InChI Key | GANDVAJEIJXBQJ-UHFFFAOYSA-M |
| Molecular Formula | C4H3KO8 |
| Linear Formula | (CH3)3COK |
|---|---|
| Molecular Weight (g/mol) | 112.21 |
| Color | Amber to Colorless |
| Physical Form | Solution |
| Chemical Name or Material | Potassium tert-butoxide |
| Grade | Pure |
| SMILES | CC(C)(C)[O-].[K+] |
| InChI Key | LPNYRYFBWFDTMA-UHFFFAOYSA-N |
| Density | 0.9290g/mL |
| PubChem CID | 23665647 |
| Fieser | 01,911; 02,336; 03,233; 04,399; 05,544; 06,477; 08,407; 09,380; 10,323; 11,432; 12,97; 14,264; 17,289 |
| CAS | 109-99-9 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. May cause respiratory irritation. Highly flammable liquid and vapour. Suspected of causing cancer. Reacts violently with water. May form explosive peroxides.<br |
| Solubility Information | Solubility in water: reacts with water. |
| Packaging | Glass bottle |
| Flash Point | −21°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | potassium tert-butoxide,potassium tert-butanolate,potassium t-butoxide,potassium 2-methylpropan-2-olate,potassium tert-butylate,kotbu,2-methyl-2-propanol, potassium salt,tert-butoxypotassium,potassium-t-butoxide,t-buok |
| IUPAC Name | potassium;2-methylpropan-2-olate |
| Molecular Formula | C4H9KO |
| EINECS Number | 212-740-3 |
| Formula Weight | 112.21 |
| Specific Gravity | 0.929 |
Potassium oxalate monohydrate, ACS, 98.5-101.0%
CAS: 6487-48-5 Molecular Formula: C2H2K2O5 Molecular Weight (g/mol): 184.23 MDL Number: MFCD00150033 InChI Key: QCPTVXCMROGZOL-UHFFFAOYSA-L Synonym: potassium oxalate monohydrate,potassium oxalate hydrate,oxalic acid potassium salt,ethanedioic acid, dipotassium salt, monohydrate,dipotassium oxalate hydrate,dipotassium hydrate oxalate,acmc-1bcm6,ksc495a4h,dipotassium oxalate monohydrate,dipotassium ethanedioate hydrate PubChem CID: 2724193 IUPAC Name: dipotassium;oxalate;hydrate SMILES: O.[K+].[K+].[O-]C(=O)C([O-])=O
| PubChem CID | 2724193 |
|---|---|
| CAS | 6487-48-5 |
| Molecular Weight (g/mol) | 184.23 |
| MDL Number | MFCD00150033 |
| SMILES | O.[K+].[K+].[O-]C(=O)C([O-])=O |
| Synonym | potassium oxalate monohydrate,potassium oxalate hydrate,oxalic acid potassium salt,ethanedioic acid, dipotassium salt, monohydrate,dipotassium oxalate hydrate,dipotassium hydrate oxalate,acmc-1bcm6,ksc495a4h,dipotassium oxalate monohydrate,dipotassium ethanedioate hydrate |
| IUPAC Name | dipotassium;oxalate;hydrate |
| InChI Key | QCPTVXCMROGZOL-UHFFFAOYSA-L |
| Molecular Formula | C2H2K2O5 |
Potassium bis(trifluoromethylsulfonyl)imide
CAS: 90076-67-8 Molecular Formula: C2F6KNO4S2 Molecular Weight (g/mol): 319.234 MDL Number: MFCD06200829 InChI Key: KVFIZLDWRFTUEM-UHFFFAOYSA-N Synonym: potassium bistriflylimide anion,methanesulfonamide,1,1,1-trifluoro-n-trifluoromethyl sulfonyl-, potassium salt 1:1,potassium bis trifluoromethanesulfonly imide,ktfsi,potassium trifluoromethanesulfonimide,potassiobis trifluoromethylsulfonyl amine,potassium bis trifluoromethanesulfonyl amide,potassium bis trifluoromethyl sulfonyl imide,1,1,1-trifluoro-n-potassio-n-trifluoromethanesulfonylmethanesulfonamide PubChem CID: 11099217 IUPAC Name: potassium;bis(trifluoromethylsulfonyl)azanide SMILES: C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[K+]
| PubChem CID | 11099217 |
|---|---|
| CAS | 90076-67-8 |
| Molecular Weight (g/mol) | 319.234 |
| MDL Number | MFCD06200829 |
| SMILES | C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[K+] |
| Synonym | potassium bistriflylimide anion,methanesulfonamide,1,1,1-trifluoro-n-trifluoromethyl sulfonyl-, potassium salt 1:1,potassium bis trifluoromethanesulfonly imide,ktfsi,potassium trifluoromethanesulfonimide,potassiobis trifluoromethylsulfonyl amine,potassium bis trifluoromethanesulfonyl amide,potassium bis trifluoromethyl sulfonyl imide,1,1,1-trifluoro-n-potassio-n-trifluoromethanesulfonylmethanesulfonamide |
| IUPAC Name | potassium;bis(trifluoromethylsulfonyl)azanide |
| InChI Key | KVFIZLDWRFTUEM-UHFFFAOYSA-N |
| Molecular Formula | C2F6KNO4S2 |
Phosphoenolpyruvic acid monopotassium salt, 99%
CAS: 4265-07-0 Molecular Formula: C3H4KO6P Molecular Weight (g/mol): 206.131 MDL Number: MFCD00044476 InChI Key: SOSDSEAIODNVPX-UHFFFAOYSA-M Synonym: potassium 1-carboxyvinyl hydrogenphosphate,potassium hydrogen 2-phosphonatooxy acrylate,2-propenoic acid, 2-phosphonooxy-, monopotassium salt,potassium 1-carboxyvinyl hydrogen phosphate,phospho enol pyruvic acid monopotassium salt,phosphoenolpyruvic acid monopotassium salt,2-propenoic acid, 2-phosphonooxy-, potassium salt 1:1,potassium 2-hydrogen phosphonooxy prop-2-enoic acid,phosphoenolpyruvate potassium salt,potassium 2-hydrogen phosphonatooxy prop-2-enoic acid PubChem CID: 23678879 IUPAC Name: potassium;1-carboxyethenyl hydrogen phosphate SMILES: C=C(C(=O)O)OP(=O)(O)[O-].[K+]
| PubChem CID | 23678879 |
|---|---|
| CAS | 4265-07-0 |
| Molecular Weight (g/mol) | 206.131 |
| MDL Number | MFCD00044476 |
| SMILES | C=C(C(=O)O)OP(=O)(O)[O-].[K+] |
| Synonym | potassium 1-carboxyvinyl hydrogenphosphate,potassium hydrogen 2-phosphonatooxy acrylate,2-propenoic acid, 2-phosphonooxy-, monopotassium salt,potassium 1-carboxyvinyl hydrogen phosphate,phospho enol pyruvic acid monopotassium salt,phosphoenolpyruvic acid monopotassium salt,2-propenoic acid, 2-phosphonooxy-, potassium salt 1:1,potassium 2-hydrogen phosphonooxy prop-2-enoic acid,phosphoenolpyruvate potassium salt,potassium 2-hydrogen phosphonatooxy prop-2-enoic acid |
| IUPAC Name | potassium;1-carboxyethenyl hydrogen phosphate |
| InChI Key | SOSDSEAIODNVPX-UHFFFAOYSA-M |
| Molecular Formula | C3H4KO6P |
Potassium tert-pentyloxide, 14-18% w/v in cyclohexane
CAS: 41233-93-6 Molecular Formula: C5H11KO Molecular Weight (g/mol): 126.24 MDL Number: MFCD00064808 InChI Key: ZRLVQFQTCMUIRM-UHFFFAOYSA-N Synonym: potassium 2-methylbutan-2-olate,potassium tert-amylate,potassium tert-pentoxide,potassium tert-pentylate,potassium tert-pentoxide solution,potassium 2-methyl-2-butoxide,2-butanol, 2-methyl-, potassium salt,potassium tert-amyloxide,2-butanol, 2-methyl-, potassium salt 1:1 PubChem CID: 23683543 SMILES: [K+].CCC(C)(C)[O-]
| PubChem CID | 23683543 |
|---|---|
| CAS | 41233-93-6 |
| Molecular Weight (g/mol) | 126.24 |
| MDL Number | MFCD00064808 |
| SMILES | [K+].CCC(C)(C)[O-] |
| Synonym | potassium 2-methylbutan-2-olate,potassium tert-amylate,potassium tert-pentoxide,potassium tert-pentylate,potassium tert-pentoxide solution,potassium 2-methyl-2-butoxide,2-butanol, 2-methyl-, potassium salt,potassium tert-amyloxide,2-butanol, 2-methyl-, potassium salt 1:1 |
| InChI Key | ZRLVQFQTCMUIRM-UHFFFAOYSA-N |
| Molecular Formula | C5H11KO |
Potassium isopropoxide, 99% (metals basis), 5% w/v in isopropanol
CAS: 6831-82-9 Molecular Formula: C3H7KO Molecular Weight (g/mol): 98.186 MDL Number: MFCD00210641 InChI Key: WQKGAJDYBZOFSR-UHFFFAOYSA-N Synonym: potassium isopropoxide,potassium propan-2-olate,koipr,potassium isopropoxide w/v in isopropanol,potassium isopropoxide w/v in 2-propanol trace metals basis 25ml PubChem CID: 23663646 IUPAC Name: potassium;propan-2-olate SMILES: CC(C)[O-].[K+]
| PubChem CID | 23663646 |
|---|---|
| CAS | 6831-82-9 |
| Molecular Weight (g/mol) | 98.186 |
| MDL Number | MFCD00210641 |
| SMILES | CC(C)[O-].[K+] |
| Synonym | potassium isopropoxide,potassium propan-2-olate,koipr,potassium isopropoxide w/v in isopropanol,potassium isopropoxide w/v in 2-propanol trace metals basis 25ml |
| IUPAC Name | potassium;propan-2-olate |
| InChI Key | WQKGAJDYBZOFSR-UHFFFAOYSA-N |
| Molecular Formula | C3H7KO |
Potassium benzoate, 99%
CAS: 582-25-2 Molecular Formula: C7H5KO2 Molecular Weight (g/mol): 160.213 MDL Number: MFCD00013061 InChI Key: XAEFZNCEHLXOMS-UHFFFAOYSA-M Synonym: potassium benzoate,benzoic acid, potassium salt,potassium salt,unii-763yqn2k7k,potassium benzoate nf,benzoic acid potassium salt,potassium ion benzoate,acmc-20ajv6,dsstox_cid_7219 PubChem CID: 23661960 IUPAC Name: potassium;benzoate SMILES: C1=CC=C(C=C1)C(=O)[O-].[K+]
| PubChem CID | 23661960 |
|---|---|
| CAS | 582-25-2 |
| Molecular Weight (g/mol) | 160.213 |
| MDL Number | MFCD00013061 |
| SMILES | C1=CC=C(C=C1)C(=O)[O-].[K+] |
| Synonym | potassium benzoate,benzoic acid, potassium salt,potassium salt,unii-763yqn2k7k,potassium benzoate nf,benzoic acid potassium salt,potassium ion benzoate,acmc-20ajv6,dsstox_cid_7219 |
| IUPAC Name | potassium;benzoate |
| InChI Key | XAEFZNCEHLXOMS-UHFFFAOYSA-M |
| Molecular Formula | C7H5KO2 |
Acetic acid, potassium salt, 99+%, for biochemistry
CAS: 127-08-2 Molecular Formula: C2H3KO2 Molecular Weight (g/mol): 98.14 InChI Key: SCVFZCLFOSHCOH-UHFFFAOYSA-M Synonym: potassium acetate,acetic acid, potassium salt,diuretic salt,potassium ethanoate,koac,octan draselny czech,potassiumacetate,acetic acid potassium salt,acok,fema no. 2920 PubChem CID: 517044 ChEBI: CHEBI:32029 IUPAC Name: potassium;acetate SMILES: CC(=O)[O-].[K+]
| PubChem CID | 517044 |
|---|---|
| CAS | 127-08-2 |
| Molecular Weight (g/mol) | 98.14 |
| ChEBI | CHEBI:32029 |
| SMILES | CC(=O)[O-].[K+] |
| Synonym | potassium acetate,acetic acid, potassium salt,diuretic salt,potassium ethanoate,koac,octan draselny czech,potassiumacetate,acetic acid potassium salt,acok,fema no. 2920 |
| IUPAC Name | potassium;acetate |
| InChI Key | SCVFZCLFOSHCOH-UHFFFAOYSA-M |
| Molecular Formula | C2H3KO2 |
Potassium phthalimide, 98+%
CAS: 1074-82-4 Molecular Formula: C8H4KNO2 Molecular Weight (g/mol): 185.22 MDL Number: MFCD00005887 InChI Key: FYRHIOVKTDQVFC-UHFFFAOYSA-M Synonym: potassium phthalimide,potassium 1,3-dioxoisoindolin-2-ide,n-potassiophthalimide,phthalimide potassium salt,n-potassium phthalimide,unii-x6kka27dil,phthalimide, potassium salt,potassium phthalamide,1h-isoindole-1,3 2h-dione, potassium salt,x6kka27dil PubChem CID: 3356745 IUPAC Name: potassium;isoindol-2-ide-1,3-dione SMILES: [K+].O=C1[N-]C(=O)C2=CC=CC=C12
| PubChem CID | 3356745 |
|---|---|
| CAS | 1074-82-4 |
| Molecular Weight (g/mol) | 185.22 |
| MDL Number | MFCD00005887 |
| SMILES | [K+].O=C1[N-]C(=O)C2=CC=CC=C12 |
| Synonym | potassium phthalimide,potassium 1,3-dioxoisoindolin-2-ide,n-potassiophthalimide,phthalimide potassium salt,n-potassium phthalimide,unii-x6kka27dil,phthalimide, potassium salt,potassium phthalamide,1h-isoindole-1,3 2h-dione, potassium salt,x6kka27dil |
| IUPAC Name | potassium;isoindol-2-ide-1,3-dione |
| InChI Key | FYRHIOVKTDQVFC-UHFFFAOYSA-M |
| Molecular Formula | C8H4KNO2 |