Solvents
Various organic solvents suitable for industrial, analytical, educational, medical, and research applications, including chromatography, chemical and organic syntheses, and purification processes. Products, including an extensive line of water products, an essential solvent for any laboratory, are available in a range of chemical compositions, quantities, purity levels, and reagent grades, and are curated to optimize your workflows.
Filtered Search Results
2,6-Dimethylphenylboronic acid, 98%
CAS: 100379-00-8 Molecular Formula: C8H11BO2 Molecular Weight (g/mol): 149.98 MDL Number: MFCD01009693 InChI Key: ZXDTWWZIHJEZOG-UHFFFAOYSA-N Synonym: 2,6-dimethylphenyl boronic acid,2,6-dimethylbenzeneboronic acid,2,6-dimethylphenyl boranediol,2,6-dimethylboronic acid,m-xylene-2-boronic acid,2,6-dimethyl-phenylboronic acid,boronic acid, 2,6-dimethylphenyl,2-borono-m-xylene,pubchem16357,acmc-1c3za PubChem CID: 583322 IUPAC Name: (2,6-dimethylphenyl)boronic acid SMILES: CC1=CC=CC(C)=C1B(O)O
| PubChem CID | 583322 |
|---|---|
| CAS | 100379-00-8 |
| Molecular Weight (g/mol) | 149.98 |
| MDL Number | MFCD01009693 |
| SMILES | CC1=CC=CC(C)=C1B(O)O |
| Synonym | 2,6-dimethylphenyl boronic acid,2,6-dimethylbenzeneboronic acid,2,6-dimethylphenyl boranediol,2,6-dimethylboronic acid,m-xylene-2-boronic acid,2,6-dimethyl-phenylboronic acid,boronic acid, 2,6-dimethylphenyl,2-borono-m-xylene,pubchem16357,acmc-1c3za |
| IUPAC Name | (2,6-dimethylphenyl)boronic acid |
| InChI Key | ZXDTWWZIHJEZOG-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO2 |
2-Chlorophenylboronic acid, 97%
CAS: 3900-89-8 Molecular Formula: C6H6BClO2 Molecular Weight (g/mol): 156.37 MDL Number: MFCD00674012 InChI Key: RRCMGJCFMJBHQC-UHFFFAOYSA-N Synonym: 2-chlorophenyl boronic acid,2-chlorobenzeneboronic acid,2-chlorophenylboronicacid,2-chlorophenylbornic acid,o-chlorophenylboronic acid,2-chlorophenyl boranediol,boronic acid, 2-chlorophenyl,2-chloro-phenyl-boronic acid,boronic acid, b-2-chlorophenyl PubChem CID: 2734322 IUPAC Name: (2-chlorophenyl)boronic acid SMILES: OB(O)C1=CC=CC=C1Cl
| PubChem CID | 2734322 |
|---|---|
| CAS | 3900-89-8 |
| Molecular Weight (g/mol) | 156.37 |
| MDL Number | MFCD00674012 |
| SMILES | OB(O)C1=CC=CC=C1Cl |
| Synonym | 2-chlorophenyl boronic acid,2-chlorobenzeneboronic acid,2-chlorophenylboronicacid,2-chlorophenylbornic acid,o-chlorophenylboronic acid,2-chlorophenyl boranediol,boronic acid, 2-chlorophenyl,2-chloro-phenyl-boronic acid,boronic acid, b-2-chlorophenyl |
| IUPAC Name | (2-chlorophenyl)boronic acid |
| InChI Key | RRCMGJCFMJBHQC-UHFFFAOYSA-N |
| Molecular Formula | C6H6BClO2 |
2-Chlorophenylacetic acid, 98.5+%
CAS: 2444-36-2 Molecular Formula: C8H7ClO2 Molecular Weight (g/mol): 170.6 MDL Number: MFCD00004317 InChI Key: IUJAAIZKRJJZGQ-UHFFFAOYSA-N Synonym: 2-chlorophenylacetic acid,o-chlorophenylacetic acid,2-2-chlorophenyl acetic acid,2-chlorophenyl acetic acid,2-chlorophenylaceticacid,benzeneacetic acid, 2-chloro,o-chlorophenyl acetic acid,acetic acid, o-chlorophenyl,2-chloro-benzeneacetic acid PubChem CID: 17124 IUPAC Name: 2-(2-chlorophenyl)acetic acid SMILES: C1=CC=C(C(=C1)CC(=O)O)Cl
| PubChem CID | 17124 |
|---|---|
| CAS | 2444-36-2 |
| Molecular Weight (g/mol) | 170.6 |
| MDL Number | MFCD00004317 |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)Cl |
| Synonym | 2-chlorophenylacetic acid,o-chlorophenylacetic acid,2-2-chlorophenyl acetic acid,2-chlorophenyl acetic acid,2-chlorophenylaceticacid,benzeneacetic acid, 2-chloro,o-chlorophenyl acetic acid,acetic acid, o-chlorophenyl,2-chloro-benzeneacetic acid |
| IUPAC Name | 2-(2-chlorophenyl)acetic acid |
| InChI Key | IUJAAIZKRJJZGQ-UHFFFAOYSA-N |
| Molecular Formula | C8H7ClO2 |
3,5-Dimethylbenzoic acid, 99%
CAS: 499-06-9 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00002525 InChI Key: UMVOQQDNEYOJOK-UHFFFAOYSA-N Synonym: mesitylenic acid,benzoic acid, 3,5-dimethyl,unii-ed8av34n0y,3,5-dimethyl benzoic acid,3,5-dimethyl-benzoic acid,ed8av34n0y,3,5-dimethylbenzoicacid,pubchem15440,3,5-dimethylbezoic acid,3,5 dimethylbenzoic acid PubChem CID: 10356 ChEBI: CHEBI:64821 IUPAC Name: 3,5-dimethylbenzoic acid SMILES: CC1=CC(=CC(=C1)C(=O)O)C
| PubChem CID | 10356 |
|---|---|
| CAS | 499-06-9 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:64821 |
| MDL Number | MFCD00002525 |
| SMILES | CC1=CC(=CC(=C1)C(=O)O)C |
| Synonym | mesitylenic acid,benzoic acid, 3,5-dimethyl,unii-ed8av34n0y,3,5-dimethyl benzoic acid,3,5-dimethyl-benzoic acid,ed8av34n0y,3,5-dimethylbenzoicacid,pubchem15440,3,5-dimethylbezoic acid,3,5 dimethylbenzoic acid |
| IUPAC Name | 3,5-dimethylbenzoic acid |
| InChI Key | UMVOQQDNEYOJOK-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
2,4-Dimethylbenzoic acid, 97%
CAS: 611-01-8 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00002480 InChI Key: BKYWPNROPGQIFZ-UHFFFAOYSA-N Synonym: benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl PubChem CID: 11897 ChEBI: CHEBI:64811 IUPAC Name: 2,4-dimethylbenzoic acid SMILES: CC1=CC=C(C(O)=O)C(C)=C1
| PubChem CID | 11897 |
|---|---|
| CAS | 611-01-8 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:64811 |
| MDL Number | MFCD00002480 |
| SMILES | CC1=CC=C(C(O)=O)C(C)=C1 |
| Synonym | benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl |
| IUPAC Name | 2,4-dimethylbenzoic acid |
| InChI Key | BKYWPNROPGQIFZ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
2,4-Dimethylbenzoic acid, 98%
CAS: 611-01-8 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00002480 InChI Key: BKYWPNROPGQIFZ-UHFFFAOYSA-N Synonym: benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl PubChem CID: 11897 ChEBI: CHEBI:64811 IUPAC Name: 2,4-dimethylbenzoic acid SMILES: CC1=CC=C(C(O)=O)C(C)=C1
| PubChem CID | 11897 |
|---|---|
| CAS | 611-01-8 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:64811 |
| MDL Number | MFCD00002480 |
| SMILES | CC1=CC=C(C(O)=O)C(C)=C1 |
| Synonym | benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl |
| IUPAC Name | 2,4-dimethylbenzoic acid |
| InChI Key | BKYWPNROPGQIFZ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
2,6-Dimethylbenzoic acid, 98+%
CAS: 632-46-2 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.177 MDL Number: MFCD00002483 InChI Key: HCBHQDKBSKYGCK-UHFFFAOYSA-N Synonym: benzoic acid, 2,6-dimethyl,2,6-dimethylbenzoicacid,2,6-dimethyl-benzoic acid,vic-m-xylylic acid,2,6-dimethyl benzoic acid,m-xylene-2-carboxylic acid,2,6-dimethylbenzene carboxylic acid,benzoic acid, 2,6-dimethyl-7ci,8ci,9ci,zlchem 286,vic.-m-xylylic acid PubChem CID: 12439 ChEBI: CHEBI:64827 IUPAC Name: 2,6-dimethylbenzoic acid SMILES: CC1=C(C(=CC=C1)C)C(=O)O
| PubChem CID | 12439 |
|---|---|
| CAS | 632-46-2 |
| Molecular Weight (g/mol) | 150.177 |
| ChEBI | CHEBI:64827 |
| MDL Number | MFCD00002483 |
| SMILES | CC1=C(C(=CC=C1)C)C(=O)O |
| Synonym | benzoic acid, 2,6-dimethyl,2,6-dimethylbenzoicacid,2,6-dimethyl-benzoic acid,vic-m-xylylic acid,2,6-dimethyl benzoic acid,m-xylene-2-carboxylic acid,2,6-dimethylbenzene carboxylic acid,benzoic acid, 2,6-dimethyl-7ci,8ci,9ci,zlchem 286,vic.-m-xylylic acid |
| IUPAC Name | 2,6-dimethylbenzoic acid |
| InChI Key | HCBHQDKBSKYGCK-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
4-Chloromandelic acid, 98%
CAS: 492-86-4 Molecular Formula: C8H7ClO3 Molecular Weight (g/mol): 186.591 MDL Number: MFCD00042724 InChI Key: BWSFWXSSALIZAU-UHFFFAOYSA-N Synonym: 4-chloromandelic acid,2-4-chlorophenyl-2-hydroxyacetic acid,p-chloromandelic acid,p-chloro mandelic acid,4-chloro-dl-mandelic acid,4-chloromandelic acid, pract.,benzeneacetic acid, 4-chloro-.alpha.-hydroxy,dl-4-chloromandelic acid,mandelic acid, p-chloro,4-chlorophenyl hydroxy acetic acid PubChem CID: 10299 IUPAC Name: 2-(4-chlorophenyl)-2-hydroxyacetic acid SMILES: C1=CC(=CC=C1C(C(=O)O)O)Cl
| PubChem CID | 10299 |
|---|---|
| CAS | 492-86-4 |
| Molecular Weight (g/mol) | 186.591 |
| MDL Number | MFCD00042724 |
| SMILES | C1=CC(=CC=C1C(C(=O)O)O)Cl |
| Synonym | 4-chloromandelic acid,2-4-chlorophenyl-2-hydroxyacetic acid,p-chloromandelic acid,p-chloro mandelic acid,4-chloro-dl-mandelic acid,4-chloromandelic acid, pract.,benzeneacetic acid, 4-chloro-.alpha.-hydroxy,dl-4-chloromandelic acid,mandelic acid, p-chloro,4-chlorophenyl hydroxy acetic acid |
| IUPAC Name | 2-(4-chlorophenyl)-2-hydroxyacetic acid |
| InChI Key | BWSFWXSSALIZAU-UHFFFAOYSA-N |
| Molecular Formula | C8H7ClO3 |
2,3-Dimethylbenzoic acid, 98%
CAS: 603-79-2 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.177 MDL Number: MFCD00002479 InChI Key: RIZUCYSQUWMQLX-UHFFFAOYSA-N Synonym: hemellitic acid,benzoic acid, 2,3-dimethyl,2,3-dimethylbenzoicacid,2,3-dimethyl benzoic acid,2,3-dimethyl-benzoic acid,unii-7irp8ca267,2,3-dimethylbenzenecarboxylic acid,vic-o-xylylic acid,methyl m-toluic acid,pubchem2549 PubChem CID: 11782 ChEBI: CHEBI:64823 IUPAC Name: 2,3-dimethylbenzoic acid SMILES: CC1=CC=CC(=C1C)C(=O)O
| PubChem CID | 11782 |
|---|---|
| CAS | 603-79-2 |
| Molecular Weight (g/mol) | 150.177 |
| ChEBI | CHEBI:64823 |
| MDL Number | MFCD00002479 |
| SMILES | CC1=CC=CC(=C1C)C(=O)O |
| Synonym | hemellitic acid,benzoic acid, 2,3-dimethyl,2,3-dimethylbenzoicacid,2,3-dimethyl benzoic acid,2,3-dimethyl-benzoic acid,unii-7irp8ca267,2,3-dimethylbenzenecarboxylic acid,vic-o-xylylic acid,methyl m-toluic acid,pubchem2549 |
| IUPAC Name | 2,3-dimethylbenzoic acid |
| InChI Key | RIZUCYSQUWMQLX-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
3,4-Dimethylbenzoic acid, 98%
CAS: 619-04-5 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.177 MDL Number: MFCD00002524 InChI Key: OPVAJFQBSDUNQA-UHFFFAOYSA-N Synonym: benzoic acid, 3,4-dimethyl,3,4-dimethyl-benzoic acid,1-carboxy-3,4-dimethylbenzene,o-xylene-4-carboxylic acid,3,4-dimethylbenzoicacid,pubchem14893,3,4-dimethyl benzoic acid,asym-o-xylylic acid,acmc-1b5p1,3, 4 dimethyl benzoic acid PubChem CID: 12073 ChEBI: CHEBI:64818 IUPAC Name: 3,4-dimethylbenzoic acid SMILES: CC1=C(C=C(C=C1)C(=O)O)C
| PubChem CID | 12073 |
|---|---|
| CAS | 619-04-5 |
| Molecular Weight (g/mol) | 150.177 |
| ChEBI | CHEBI:64818 |
| MDL Number | MFCD00002524 |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)C |
| Synonym | benzoic acid, 3,4-dimethyl,3,4-dimethyl-benzoic acid,1-carboxy-3,4-dimethylbenzene,o-xylene-4-carboxylic acid,3,4-dimethylbenzoicacid,pubchem14893,3,4-dimethyl benzoic acid,asym-o-xylylic acid,acmc-1b5p1,3, 4 dimethyl benzoic acid |
| IUPAC Name | 3,4-dimethylbenzoic acid |
| InChI Key | OPVAJFQBSDUNQA-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
2-Chloromandelic acid, 98%
CAS: 10421-85-9 Molecular Formula: C8H7ClO3 Molecular Weight (g/mol): 186.59 MDL Number: MFCD00084962 InChI Key: RWOLDZZTBNYTMS-UHFFFAOYNA-N Synonym: 2-chloromandelic acid,2-2-chlorophenyl-2-hydroxyacetic acid,dl-2-chloromandelic acid,2-chlorophenyl hydroxy acetic acid,dl-2-chloro mandelic acid,2-2-chlorophenyl-2-hydroxy-acetic acid,2-chlorophenyl glycolic acid,2-chloromandelicacid,2-chloro-mandelic acid,pubchem15895 PubChem CID: 97720 IUPAC Name: 2-(2-chlorophenyl)-2-hydroxyacetic acid SMILES: OC(C(O)=O)C1=CC=CC=C1Cl
| PubChem CID | 97720 |
|---|---|
| CAS | 10421-85-9 |
| Molecular Weight (g/mol) | 186.59 |
| MDL Number | MFCD00084962 |
| SMILES | OC(C(O)=O)C1=CC=CC=C1Cl |
| Synonym | 2-chloromandelic acid,2-2-chlorophenyl-2-hydroxyacetic acid,dl-2-chloromandelic acid,2-chlorophenyl hydroxy acetic acid,dl-2-chloro mandelic acid,2-2-chlorophenyl-2-hydroxy-acetic acid,2-chlorophenyl glycolic acid,2-chloromandelicacid,2-chloro-mandelic acid,pubchem15895 |
| IUPAC Name | 2-(2-chlorophenyl)-2-hydroxyacetic acid |
| InChI Key | RWOLDZZTBNYTMS-UHFFFAOYNA-N |
| Molecular Formula | C8H7ClO3 |
4-Chlorophenylboronic acid, 97%
CAS: 1679-18-1 Molecular Formula: C6H6BClO2 Molecular Weight (g/mol): 156.37 MDL Number: MFCD00039137 InChI Key: CAYQIZIAYYNFCS-UHFFFAOYSA-N Synonym: 4-chlorophenyl boronic acid,4-chlorobenzeneboronic acid,p-chlorophenylboronic acid,benzeneboronic acid, p-chloro,p-chlorobenzeneboronic acid,boronic acid, 4-chlorophenyl,boronic acid, p-chlorophenyl,4-chlorophenyl boranediol,4-chlorophenylbornic acid PubChem CID: 74299 IUPAC Name: (4-chlorophenyl)boronic acid SMILES: OB(O)C1=CC=C(Cl)C=C1
| PubChem CID | 74299 |
|---|---|
| CAS | 1679-18-1 |
| Molecular Weight (g/mol) | 156.37 |
| MDL Number | MFCD00039137 |
| SMILES | OB(O)C1=CC=C(Cl)C=C1 |
| Synonym | 4-chlorophenyl boronic acid,4-chlorobenzeneboronic acid,p-chlorophenylboronic acid,benzeneboronic acid, p-chloro,p-chlorobenzeneboronic acid,boronic acid, 4-chlorophenyl,boronic acid, p-chlorophenyl,4-chlorophenyl boranediol,4-chlorophenylbornic acid |
| IUPAC Name | (4-chlorophenyl)boronic acid |
| InChI Key | CAYQIZIAYYNFCS-UHFFFAOYSA-N |
| Molecular Formula | C6H6BClO2 |
3-Chlorophenylboronic acid, 97%
CAS: 63503-60-6 Molecular Formula: C6H6BClO2 Molecular Weight (g/mol): 156.37 MDL Number: MFCD00161354 InChI Key: SDEAGACSNFSZCU-UHFFFAOYSA-N Synonym: 3-chlorophenyl boronic acid,3-chlorobenzeneboronic acid,3-chlorophenyl boranediol,3-chlorophenylbornic acid,3-chloro benzene boronic acid,m-chlorophenylboronic acid,3-chloro-phenyl-boronic acid,boronic acid, 3-chlorophenyl,pubchem1785 PubChem CID: 2734323 IUPAC Name: (3-chlorophenyl)boronic acid SMILES: OB(O)C1=CC(Cl)=CC=C1
| PubChem CID | 2734323 |
|---|---|
| CAS | 63503-60-6 |
| Molecular Weight (g/mol) | 156.37 |
| MDL Number | MFCD00161354 |
| SMILES | OB(O)C1=CC(Cl)=CC=C1 |
| Synonym | 3-chlorophenyl boronic acid,3-chlorobenzeneboronic acid,3-chlorophenyl boranediol,3-chlorophenylbornic acid,3-chloro benzene boronic acid,m-chlorophenylboronic acid,3-chloro-phenyl-boronic acid,boronic acid, 3-chlorophenyl,pubchem1785 |
| IUPAC Name | (3-chlorophenyl)boronic acid |
| InChI Key | SDEAGACSNFSZCU-UHFFFAOYSA-N |
| Molecular Formula | C6H6BClO2 |
4-Chlorophenylacetic acid, 98%
CAS: 1878-66-6 Molecular Formula: C8H7ClO2 Molecular Weight (g/mol): 170.59 MDL Number: MFCD00004344 InChI Key: CDPKJZJVTHSESZ-UHFFFAOYSA-N Synonym: 4-chlorophenylacetic acid,2-4-chlorophenyl acetic acid,4-chlorophenyl acetic acid,4-chlorobenzeneacetic acid,p-chlorophenylacetic acid,benzeneacetic acid, 4-chloro,p-chlorophenyl acetic acid,2-p-chlorophenyl acetic acid,acetic acid, p-chlorophenyl PubChem CID: 15880 ChEBI: CHEBI:30749 IUPAC Name: 2-(4-chlorophenyl)acetic acid SMILES: OC(=O)CC1=CC=C(Cl)C=C1
| PubChem CID | 15880 |
|---|---|
| CAS | 1878-66-6 |
| Molecular Weight (g/mol) | 170.59 |
| ChEBI | CHEBI:30749 |
| MDL Number | MFCD00004344 |
| SMILES | OC(=O)CC1=CC=C(Cl)C=C1 |
| Synonym | 4-chlorophenylacetic acid,2-4-chlorophenyl acetic acid,4-chlorophenyl acetic acid,4-chlorobenzeneacetic acid,p-chlorophenylacetic acid,benzeneacetic acid, 4-chloro,p-chlorophenyl acetic acid,2-p-chlorophenyl acetic acid,acetic acid, p-chlorophenyl |
| IUPAC Name | 2-(4-chlorophenyl)acetic acid |
| InChI Key | CDPKJZJVTHSESZ-UHFFFAOYSA-N |
| Molecular Formula | C8H7ClO2 |
4-Chlorophenoxyacetic acid, 98%
CAS: 122-88-3 Molecular Formula: C8H7ClO3 Molecular Weight (g/mol): 186.59 MDL Number: MFCD00004305 InChI Key: SODPIMGUZLOIPE-UHFFFAOYSA-N Synonym: 4-chlorophenoxyacetic acid,2-4-chlorophenoxy acetic acid,4-chlorophenoxy acetic acid,4-cpa,sure-set,tomatotone,tomato fix,acetic acid, 4-chlorophenoxy,p-chlorophenoxyacetic acid,tomato hold PubChem CID: 26229 ChEBI: CHEBI:1808 IUPAC Name: 2-(4-chlorophenoxy)acetic acid SMILES: C1=CC(=CC=C1OCC(=O)O)Cl
| PubChem CID | 26229 |
|---|---|
| CAS | 122-88-3 |
| Molecular Weight (g/mol) | 186.59 |
| ChEBI | CHEBI:1808 |
| MDL Number | MFCD00004305 |
| SMILES | C1=CC(=CC=C1OCC(=O)O)Cl |
| Synonym | 4-chlorophenoxyacetic acid,2-4-chlorophenoxy acetic acid,4-chlorophenoxy acetic acid,4-cpa,sure-set,tomatotone,tomato fix,acetic acid, 4-chlorophenoxy,p-chlorophenoxyacetic acid,tomato hold |
| IUPAC Name | 2-(4-chlorophenoxy)acetic acid |
| InChI Key | SODPIMGUZLOIPE-UHFFFAOYSA-N |
| Molecular Formula | C8H7ClO3 |