Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Mineral oil, high purity
CAS: 8042-47-5 Molecular Formula: C16H10N2Na2O7S2 Molecular Weight (g/mol): 452.363 MDL Number: MFCD00131611 InChI Key: AEOVEGJBKQQFOP-DDVLFWKVSA-L Synonym: acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g PubChem CID: 9566064 IUPAC Name: disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate SMILES: C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+]
| PubChem CID | 9566064 |
|---|---|
| CAS | 8042-47-5 |
| Molecular Weight (g/mol) | 452.363 |
| MDL Number | MFCD00131611 |
| SMILES | C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
| Synonym | acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g |
| IUPAC Name | disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate |
| InChI Key | AEOVEGJBKQQFOP-DDVLFWKVSA-L |
| Molecular Formula | C16H10N2Na2O7S2 |
Graphite powder, natural, high purity, -200 mesh, 99.9995% (metals basis), Thermo Scientific Chemicals
CAS: 7782-42-5 Molecular Formula: C Molecular Weight (g/mol): 12.01 MDL Number: MFCD00133992 MFCD00144065 MFCD00146977 MFCD00211867 MFCD06411993 MFCD07370731 InChI Key: OKTJSMMVPCPJKN-UHFFFAOYSA-N Synonym: graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve PubChem CID: 5462310 ChEBI: CHEBI:27594 IUPAC Name: carbon SMILES: [C]
| PubChem CID | 5462310 |
|---|---|
| CAS | 7782-42-5 |
| Molecular Weight (g/mol) | 12.01 |
| ChEBI | CHEBI:27594 |
| MDL Number | MFCD00133992 MFCD00144065 MFCD00146977 MFCD00211867 MFCD06411993 MFCD07370731 |
| SMILES | [C] |
| Synonym | graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve |
| IUPAC Name | carbon |
| InChI Key | OKTJSMMVPCPJKN-UHFFFAOYSA-N |
| Molecular Formula | C |
| CAS | 124-03-8 |
|---|
Tetramethylammonium Chloride, High Purity, 99%, Spectrum™ Chemical
CAS: 75-57-0 Molecular Formula: C4H12ClN Molecular Weight (g/mol): 109.60 InChI Key: OKIZCWYLBDKLSU-UHFFFAOYSA-M IUPAC Name: tetramethylazanium chloride SMILES: [Cl-].C[N+](C)(C)C
| CAS | 75-57-0 |
|---|---|
| Molecular Weight (g/mol) | 109.60 |
| SMILES | [Cl-].C[N+](C)(C)C |
| IUPAC Name | tetramethylazanium chloride |
| InChI Key | OKIZCWYLBDKLSU-UHFFFAOYSA-M |
| Molecular Formula | C4H12ClN |
m-Cresol, High Purity, 99%, Spectrum™ Chemical
CAS: 108-39-4 Molecular Formula: C7H8O Molecular Weight (g/mol): 108.14 InChI Key: RLSSMJSEOOYNOY-UHFFFAOYSA-N IUPAC Name: 3-methylphenol SMILES: CC1=CC=CC(O)=C1
| CAS | 108-39-4 |
|---|---|
| Molecular Weight (g/mol) | 108.14 |
| SMILES | CC1=CC=CC(O)=C1 |
| IUPAC Name | 3-methylphenol |
| InChI Key | RLSSMJSEOOYNOY-UHFFFAOYSA-N |
| Molecular Formula | C7H8O |
1,3-Dimethyl-2-imidazolidinone, Honeywell Riedel-de Haën™
CAS: 80-73-9 Molecular Formula: C5H10N2O Molecular Weight (g/mol): 114.15 MDL Number: MFCD00003188 InChI Key: CYSGHNMQYZDMIA-UHFFFAOYSA-N Synonym: 1,3-dimethyl-2-imidazolidinone,n,n'-dimethylethyleneurea,dimethyl imidazolidinone,n,n'-dimethylimidazolidinone,1,3-dimethylimidazolidone,rhonite 1,dmeu,karbomos tsem,2-imidazolidinone, 1,3-dimethyl,1,3-dimethylethyleneurea PubChem CID: 6661 IUPAC Name: 1,3-dimethylimidazolidin-2-one SMILES: CN1CCN(C)C1=O
| PubChem CID | 6661 |
|---|---|
| CAS | 80-73-9 |
| Molecular Weight (g/mol) | 114.15 |
| MDL Number | MFCD00003188 |
| SMILES | CN1CCN(C)C1=O |
| Synonym | 1,3-dimethyl-2-imidazolidinone,n,n'-dimethylethyleneurea,dimethyl imidazolidinone,n,n'-dimethylimidazolidinone,1,3-dimethylimidazolidone,rhonite 1,dmeu,karbomos tsem,2-imidazolidinone, 1,3-dimethyl,1,3-dimethylethyleneurea |
| IUPAC Name | 1,3-dimethylimidazolidin-2-one |
| InChI Key | CYSGHNMQYZDMIA-UHFFFAOYSA-N |
| Molecular Formula | C5H10N2O |
Methylene Chloride, Hydrocarbon Stabilized, Exceeds A.C.S. Specifications, HPLC Grade, 99.9%, Spectrum™ Chemical
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N IUPAC Name: dichloromethane SMILES: ClCCl
| CAS | 75-09-2 |
|---|---|
| Molecular Weight (g/mol) | 84.93 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
Butyl acetate, CHROMASOLV™ Plus, for HPLC, 99.7%, Honeywell Riedel-de Haën™
CAS: 123-86-4 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00009445 InChI Key: DKPFZGUDAPQIHT-UHFFFAOYSA-N Synonym: n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle PubChem CID: 31272 ChEBI: CHEBI:31328 IUPAC Name: butyl acetate SMILES: CCCCOC(C)=O
| PubChem CID | 31272 |
|---|---|
| CAS | 123-86-4 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:31328 |
| MDL Number | MFCD00009445 |
| SMILES | CCCCOC(C)=O |
| Synonym | n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle |
| IUPAC Name | butyl acetate |
| InChI Key | DKPFZGUDAPQIHT-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
2-Methylbutane, CHROMASOLV™, for HPLC, ≥99.5%, Honeywell Riedel-de Haën™
CAS: 78-78-4 Molecular Formula: C5H12 Molecular Weight (g/mol): 72.15 MDL Number: MFCD00009338 InChI Key: QWTDNUCVQCZILF-UHFFFAOYSA-N Synonym: isopentane,isoamylhydride,butane, 2-methyl,dimethylethylmethane,ethyldimethylmethane,1,1,2-trimethylethane,iso-pentane,1,1-dimethylpropane,butanes,iso-c5h12 PubChem CID: 6556 ChEBI: CHEBI:30362 IUPAC Name: 2-methylbutane SMILES: CCC(C)C
| PubChem CID | 6556 |
|---|---|
| CAS | 78-78-4 |
| Molecular Weight (g/mol) | 72.15 |
| ChEBI | CHEBI:30362 |
| MDL Number | MFCD00009338 |
| SMILES | CCC(C)C |
| Synonym | isopentane,isoamylhydride,butane, 2-methyl,dimethylethylmethane,ethyldimethylmethane,1,1,2-trimethylethane,iso-pentane,1,1-dimethylpropane,butanes,iso-c5h12 |
| IUPAC Name | 2-methylbutane |
| InChI Key | QWTDNUCVQCZILF-UHFFFAOYSA-N |
| Molecular Formula | C5H12 |
Glass Spheres , MilliporeSigma™ Supelco™
Silica is a naturally occurring material in minerals, flint and in some plants in crystalline phase. Silica used in industries is in synthetic form. Surface area, pore volume, pore size and particle size are independently controllable to some extent. The crystalline silica may be classified based on atmospheric pressure as:a. Quartz = 1143Kb. Tridymite 1143 - 1743Kc. Cristobalite = 1743, over 1973K it forms amorphous vitreous silica glass.
| Linear Formula | O2Si |
|---|---|
| CAS | 65997-17-3 |
| MDL Number | MFCD00147032 |
| Physical Form | Powder |
| Packaging | Poly Bottle |
| Grade | High-Purity Grade |
| RTECS Number | LK3651000 |
| Formula Weight | 60.08 |
| Density | 1.1 g/mL (at 25°C) |
Cyclopentane, CHROMASOLV™, for HPLC, ≥75% cyclopentane basis, Honeywell Riedel-de Haën™
CAS: 287-92-3 Molecular Formula: C5H10 Molecular Weight (g/mol): 70.135 MDL Number: MFCD00001356 InChI Key: RGSFGYAAUTVSQA-UHFFFAOYSA-N Synonym: pentamethylene,ciclopentano,cyclopentan,zyklopentan,unii-t86pb90rnu,hsdb 62,t86pb90rnu,cyclopentanes,cyclopentyl group,hydrocarbons, cyclic c5 and c6 PubChem CID: 9253 ChEBI: CHEBI:23492 IUPAC Name: cyclopentane SMILES: C1CCCC1
| PubChem CID | 9253 |
|---|---|
| CAS | 287-92-3 |
| Molecular Weight (g/mol) | 70.135 |
| ChEBI | CHEBI:23492 |
| MDL Number | MFCD00001356 |
| SMILES | C1CCCC1 |
| Synonym | pentamethylene,ciclopentano,cyclopentan,zyklopentan,unii-t86pb90rnu,hsdb 62,t86pb90rnu,cyclopentanes,cyclopentyl group,hydrocarbons, cyclic c5 and c6 |
| IUPAC Name | cyclopentane |
| InChI Key | RGSFGYAAUTVSQA-UHFFFAOYSA-N |
| Molecular Formula | C5H10 |
1-Chlorobutane CHROMASOLV™, for HPLC, ≥99.8%, Honeywell Riedel-de Haën™
CAS: 109-69-3 Molecular Formula: C4H9Cl Molecular Weight (g/mol): 92.57 MDL Number: MFCD00001009 InChI Key: VFWCMGCRMGJXDK-UHFFFAOYSA-N Synonym: butyl chloride,n-butyl chloride,butane, 1-chloro,chlorure de butyle,nbc wormer,n-propylcarbinyl chloride,sure shot,butane, chloro,chlorobutane,n-chlorobutane PubChem CID: 8005 IUPAC Name: 1-chlorobutane SMILES: CCCCCl
| PubChem CID | 8005 |
|---|---|
| CAS | 109-69-3 |
| Molecular Weight (g/mol) | 92.57 |
| MDL Number | MFCD00001009 |
| SMILES | CCCCCl |
| Synonym | butyl chloride,n-butyl chloride,butane, 1-chloro,chlorure de butyle,nbc wormer,n-propylcarbinyl chloride,sure shot,butane, chloro,chlorobutane,n-chlorobutane |
| IUPAC Name | 1-chlorobutane |
| InChI Key | VFWCMGCRMGJXDK-UHFFFAOYSA-N |
| Molecular Formula | C4H9Cl |
1-Pentanesulfonic Acid Sodium Salt, HPLC Grade, J.T. Baker™
CAS: 22767-49-3 Molecular Formula: C5H11NaO3S Molecular Weight (g/mol): 174.19 MDL Number: MFCD00007541,MFCD00149548 InChI Key: ROBLTDOHDSGGDT-UHFFFAOYSA-M Synonym: sodium 1-pentanesulfonate,sodium pentane-1-sulfonate,sodium pentanesulfonate,1-pentanesulfonic acid sodium salt,1-pentanesulfonic acid, sodium salt,1-pentylsodiumsulfonate,ipc-alks-5,1-pentanesulfonate, sodium,pentanesulfonic acid na-salt,pentanesulfonic acidsodiumsalt PubChem CID: 23664617 IUPAC Name: sodium pentane-1-sulfonate SMILES: [Na+].CCCCCS([O-])(=O)=O
| PubChem CID | 23664617 |
|---|---|
| CAS | 22767-49-3 |
| Molecular Weight (g/mol) | 174.19 |
| MDL Number | MFCD00007541,MFCD00149548 |
| SMILES | [Na+].CCCCCS([O-])(=O)=O |
| Synonym | sodium 1-pentanesulfonate,sodium pentane-1-sulfonate,sodium pentanesulfonate,1-pentanesulfonic acid sodium salt,1-pentanesulfonic acid, sodium salt,1-pentylsodiumsulfonate,ipc-alks-5,1-pentanesulfonate, sodium,pentanesulfonic acid na-salt,pentanesulfonic acidsodiumsalt |
| IUPAC Name | sodium pentane-1-sulfonate |
| InChI Key | ROBLTDOHDSGGDT-UHFFFAOYSA-M |
| Molecular Formula | C5H11NaO3S |
Benzyl alcohol, Honeywell™
CAS: 100-51-6 Molecular Formula: C7H8O Molecular Weight (g/mol): 108.14 MDL Number: MFCD00004599,MFCD03792087 InChI Key: WVDDGKGOMKODPV-UHFFFAOYSA-N Synonym: benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol PubChem CID: 244 ChEBI: CHEBI:17987 IUPAC Name: phenylmethanol SMILES: OCC1=CC=CC=C1
| PubChem CID | 244 |
|---|---|
| CAS | 100-51-6 |
| Molecular Weight (g/mol) | 108.14 |
| ChEBI | CHEBI:17987 |
| MDL Number | MFCD00004599,MFCD03792087 |
| SMILES | OCC1=CC=CC=C1 |
| Synonym | benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol |
| IUPAC Name | phenylmethanol |
| InChI Key | WVDDGKGOMKODPV-UHFFFAOYSA-N |
| Molecular Formula | C7H8O |
Tetrachloroethylene, CHROMASOLV™, for HPLC, ≥99.9%, Honeywell Riedel-de Haen
CAS: 127-18-4 Molecular Formula: C2Cl4 Molecular Weight (g/mol): 165.82 MDL Number: MFCD00000834 InChI Key: CYTYCFOTNPOANT-UHFFFAOYSA-N Synonym: tetrachloroethylene,tetrachloroethene,perchloroethylene,perchlorethylene,perc,ethene, tetrachloro,tetrachlorethylene,ethylene tetrachloride,carbon dichloride,ankilostin PubChem CID: 31373 ChEBI: CHEBI:17300 SMILES: ClC(Cl)=C(Cl)Cl
| PubChem CID | 31373 |
|---|---|
| CAS | 127-18-4 |
| Molecular Weight (g/mol) | 165.82 |
| ChEBI | CHEBI:17300 |
| MDL Number | MFCD00000834 |
| SMILES | ClC(Cl)=C(Cl)Cl |
| Synonym | tetrachloroethylene,tetrachloroethene,perchloroethylene,perchlorethylene,perc,ethene, tetrachloro,tetrachlorethylene,ethylene tetrachloride,carbon dichloride,ankilostin |
| InChI Key | CYTYCFOTNPOANT-UHFFFAOYSA-N |
| Molecular Formula | C2Cl4 |