missing translation for 'onlineSavingsMsg'
Learn More
Learn More
VeriSpec™ Silicon Standard for ICP/MS 100 ppm in H2O, Ricca Chemical
Manufactured and Tested in an ISO 17025/Guide 34 Accredited Facility
Supplier: Ricca Chemical Company RV010553100N
Description
- Manufactured and tested in an ISO 17025/Guide 34 Accredited facility
- Product accompanied with detailed Certificate of Analysis
Specifications
| Silicon ICP-MS Standard | |
| 16919-19-0,7732-18-5 | |
| 100%,0.06% | |
| Liquid | |
| Colorless | |
| AA, ICP, ICP/MS, IC, XRF, and Other Analytical Instrumentation | |
| Calibration Standard | |
| ITHIMUMYFVCXSL-UHFFFAOYSA-P | |
| diazanium;hexafluorosilicon(2-) | |
| 100 mL | |
| High Purity |
| Natural LDPE Bottle | |
| 97.94%,0.06% | |
| 1 | |
| F6H8N2Si | |
| Approximately 0°C | |
| Miscible with water | |
| Standard | |
| [NH4+].[NH4+].F[Si-2](F)(F)(F)(F)F | |
| 178.153 | |
| 28145 |
Chemical Identifiers
| 16919-19-0 | |
| 178.153 | |
| 28145 | |
| [NH4+].[NH4+].F[Si-2](F)(F)(F)(F)F |
| F6H8N2Si | |
| ITHIMUMYFVCXSL-UHFFFAOYSA-P | |
| diazanium;hexafluorosilicon(2-) |