missing translation for 'onlineSavingsMsg'
Learn More
Learn More
VeriSpec™ Manganese (Mn) Standard for AAS 10 ppb in 1% HNO3, Ricca Chemical
Manufactured and Tested in an ISO 17025/Guide 34 Accredited Facility
Supplier: Ricca Chemical Company RV01012450N
Description
- Manufactured and tested in an ISO 17025/Guide 34 Accredited facility
- Product accompanied with detailed Certificate of Analysis
Specifications
| Manganese AAS Standard | |
| 10377-66-9 , 7697-37-2 , 7732-18-5 | |
| 100%,1.02% | |
| Liquid | |
| Colorless | |
| Atomic Absorption Spectrophotometer | |
| Calibration Standard | |
| MIVBAHRSNUNMPP-UHFFFAOYSA-N | |
| manganese(2+);dinitrate | |
| 50 mL | |
| High Purity |
| Natural Poly Bottle | |
| 97.02%,0.98% | |
| 1.01 | |
| MnN2O6 | |
| Approximately 0°C | |
| Miscible with water | |
| Single-element Standard Solution | |
| [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Mn+2] | |
| 178.946 | |
| 61511 |
Chemical Identifiers
| 10377-66-9 | |
| 178.946 | |
| 61511 | |
| [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Mn+2] |
| MnN2O6 | |
| MIVBAHRSNUNMPP-UHFFFAOYSA-N | |
| manganese(2+);dinitrate |