Learn More
Triphenylphosphine oxide, 99%
CAS: 791-28-6 | C18H15OP | 278.29 g/mol
$52.75 - $137.84
Chemical Identifiers
| CAS | 791-28-6 |
|---|---|
| Molecular Formula | C18H15OP |
| Molecular Weight (g/mol) | 278.29 |
| MDL Number | MFCD00002080 MFCD03458802 |
| InChI Key | FIQMHBFVRAXMOP-UHFFFAOYSA-N |
| Synonym | triphenylphosphine oxide, phosphine oxide, triphenyl, triphenyl phosphorus oxide, triphenyl phosphine oxide, triphenylphosphane oxide, tppo, triphenylphosphineoxide, ph3po, diphenylphosphoroso benzene, triphenylphosphanoxid |
| PubChem CID | 13097 |
| ChEBI | CHEBI:36601 |
| IUPAC Name | diphenylphosphorylbenzene |
| SMILES | O=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC140430250
|
Thermo Scientific Chemicals
140430250 |
25 g | Glass bottle |
Each for $52.75
|
|
||||
|
AC140431000
|
Thermo Scientific Chemicals
140431000 |
100 g | Glass bottle |
Each for $137.84
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 791-28-6 | |
| 278.29 | |
| FIQMHBFVRAXMOP-UHFFFAOYSA-N | |
| 13097 | |
| diphenylphosphorylbenzene |
| C18H15OP | |
| MFCD00002080 MFCD03458802 | |
| triphenylphosphine oxide, phosphine oxide, triphenyl, triphenyl phosphorus oxide, triphenyl phosphine oxide, triphenylphosphane oxide, tppo, triphenylphosphineoxide, ph3po, diphenylphosphoroso benzene, triphenylphosphanoxid | |
| CHEBI:36601 | |
| O=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
Specifications
| 791-28-6 | |
| Brown-Pink to White | |
| 180°C | |
| 98.5% min. (HPLC) | |
| C18H15OP | |
| MFCD00002080 MFCD03458802 | |
| 16,IV,1011 | |
| triphenylphosphine oxide, phosphine oxide, triphenyl, triphenyl phosphorus oxide, triphenyl phosphine oxide, triphenylphosphane oxide, tppo, triphenylphosphineoxide, ph3po, diphenylphosphoroso benzene, triphenylphosphanoxid | |
| FIQMHBFVRAXMOP-UHFFFAOYSA-N | |
| diphenylphosphorylbenzene | |
| 13097 | |
| 278.29 | |
| Crystalline Powder or Flakes |
| 154.0°C to 158.0°C | |
| >360.0°C | |
| Authentic | |
| Glass bottle | |
| (C6H5)3P(O) | |
| 25 g | |
| 14,337; 16,368 | |
| Solubility in water: slightly soluble. | |
| O=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 278.29 | |
| CHEBI:36601 | |
| 99% | |
| Triphenylphosphine oxide |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
Harmful to aquatic life with long lasting effects.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Wash with plenty of soap and water.
If eye irritation persists: Get medical advice/attent
GHS Signal Word: Warning
EINECSNumber : 212-338-8
RUO – Research Use Only