Learn More
Triphenylphosphine, 99%
CAS: 603-35-0 | C18H15P | 262.29 g/mol
Supplier: Thermo Scientific Chemicals 140420050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Triphenylphosphine | |
| 78.5°C to 81.5°C | |
| 377.0°C | |
| Authentic | |
| Plastic drum | |
| (C6H5)3P | |
| 5 kg | |
| 01,1238; 02,443; 03,317; 04,548; 05,725; 06,643; 07,403; 11,588; 12,550; 13,308; 14,60; 15,248; 16,264; 17,389 | |
| triphenylphosphine, triphenyl phosphine, phosphine, triphenyl, triphenylphosphorus, triphenyl-phosphane, triphenylphosphide, phosphorustriphenyl, trifenylfosfin, trifenylfosfin czech, triphenylphosphine resin | |
| RIOQSEWOXXDEQQ-UHFFFAOYSA-N | |
| triphenylphosphane | |
| 11776 | |
| 99% |
| 603-35-0 | |
| White | |
| 181°C | |
| 98.5% min. (GC) | |
| C18H15P | |
| MFCD00003043 MFCD20489348 | |
| 16,759 | |
| 15,9916 | |
| Solubility in water: insoluble. Other solubilities: soluble in glacial acetic acid,, soluble in benzene, chloroform, acetone and ccl4,, freely soluble in diethyl ether,, slightly soluble in alcohol | |
| C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 262.29 | |
| 262.28 | |
| Crystalline Powder, Crystals or Flakes |
Chemical Identifiers
| 603-35-0 | |
| 262.29 | |
| RIOQSEWOXXDEQQ-UHFFFAOYSA-N | |
| 11776 | |
| C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| C18H15P | |
| MFCD00003043 MFCD20489348 | |
| triphenylphosphine, triphenyl phosphine, phosphine, triphenyl, triphenylphosphorus, triphenyl-phosphane, triphenylphosphide, phosphorustriphenyl, trifenylfosfin, trifenylfosfin czech, triphenylphosphine resin | |
| triphenylphosphane |
Safety and Handling
GHS H Statement
May cause an allergic skin reaction.
Harmful if swallowed.
May cause damage to organs through prolonged or repeated exposure.
GHS P Statement
Wear eye protection/face protection.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
GHS Signal Word: Warning
EINECSNumber : 210-036-0
RTECSNumber : SZ3500000
TSCA : TSCA
RUO – Research Use Only