missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Triphenyl Borate 96.0+%, TCI America™
$141.02 - $1484.81
Chemical Identifiers
| CAS | 1095-03-0 |
|---|---|
| Molecular Formula | C18H15BO3 |
| Molecular Weight (g/mol) | 290.125 |
| MDL Number | MFCD00059011 |
| InChI Key | MDCWDBMBZLORER-UHFFFAOYSA-N |
| Synonym | triphenoxyborane, phenyl borate, triphenoxyboron, boric acid, triphenyl ester, phenyl borate, pho 3 b, trifenylester kyseliny borite, boric acid h3bo3 , triphenyl ester, triphenyl ester boric acid, trifenylester kyseliny borite czech, boric acid triphenyl ester |
| PubChem CID | 14182 |
| IUPAC Name | triphenyl borate |
| SMILES | B(OC1=CC=CC=C1)(OC2=CC=CC=C2)OC3=CC=CC=C3 |
Chemical Identifiers
| 1095-03-0 | |
| 290.125 | |
| MDCWDBMBZLORER-UHFFFAOYSA-N | |
| 14182 | |
| B(OC1=CC=CC=C1)(OC2=CC=CC=C2)OC3=CC=CC=C3 |
| C18H15BO3 | |
| MFCD00059011 | |
| triphenoxyborane, phenyl borate, triphenoxyboron, boric acid, triphenyl ester, phenyl borate, pho 3 b, trifenylester kyseliny borite, boric acid h3bo3 , triphenyl ester, triphenyl ester boric acid, trifenylester kyseliny borite czech, boric acid triphenyl ester | |
| triphenyl borate |
Specifications
| 1095-03-0 | |
| White-Yellow | |
| C18H15BO3 | |
| 25 g | |
| triphenoxyborane, phenyl borate, triphenoxyboron, boric acid, triphenyl ester, phenyl borate, pho 3 b, trifenylester kyseliny borite, boric acid h3bo3 , triphenyl ester, triphenyl ester boric acid, trifenylester kyseliny borite czech, boric acid triphenyl ester | |
| B(OC1=CC=CC=C1)(OC2=CC=CC=C2)OC3=CC=CC=C3 | |
| 290.125 | |
| 290.13 | |
| Crystalline Powder |
| 101°C | |
| 158°C | |
| MFCD00059011 | |
| 2811 | |
| MDCWDBMBZLORER-UHFFFAOYSA-N | |
| triphenyl borate | |
| 14182 | |
| ≥96.0% (T) | |
| Triphenyl Borate |
Safety and Handling
RTECSNumber : ED5775000
TSCA : Yes
Recommended Storage : Refrigerator