Learn More
Tributylphenyltin, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 370230010
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Tributylphenyltin | |
| 1.1250g/mL | |
| >110°C | |
| Glass bottle | |
| C6H5Sn[(CH2)3CH3]3 | |
| MFCD00134394 | |
| 1.125 | |
| SYUVAXDZVWPKSI-UHFFFAOYSA-N | |
| tributyl(phenyl)stannane | |
| 607632 | |
| ≥96.0% |
| 960-16-7 | |
| 125.0°C to 128.0°C (0.1 mmHg) | |
| Authentic | |
| C18H32Sn | |
| 1.5150 to 1.5170 | |
| 1g | |
| tributyl phenyl stannane, tributylphenyltin, phenyltributylstannane, stannane, tributylphenyl, phenyltributyltin, phenyltri-n-butyltin, phenyltributlytin, tributylphenyl tin, phenyl tnbutyl tin, phenyl tributyl tin | |
| CCCC[Sn](CCCC)(CCCC)C1=CC=CC=C1 | |
| 367.16 | |
| 367.16 |
Chemical Identifiers
| 960-16-7 | |
| 367.16 | |
| SYUVAXDZVWPKSI-UHFFFAOYSA-N | |
| 607632 | |
| CCCC[Sn](CCCC)(CCCC)C1=CC=CC=C1 |
| C18H32Sn | |
| MFCD00134394 | |
| tributyl phenyl stannane, tributylphenyltin, phenyltributylstannane, stannane, tributylphenyl, phenyltributyltin, phenyltri-n-butyltin, phenyltributlytin, tributylphenyl tin, phenyl tnbutyl tin, phenyl tributyl tin | |
| tributyl(phenyl)stannane |
Safety and Handling
GHS H Statement
Causes damage to organs through prolonged or repeated exposure.
Causes serious eye irritation.
Very toxic to aquatic life with long lasting effects.
Causes skin irritation.
Toxic if swallowed.
Harmful
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
IF ON SKIN: Wash with plenty of soap and water.
Take off contaminated clothing and wash before reuse.
IF IN EYES: Rinse cautiously with water for se
GHS Signal Word: Danger
RUO â Research Use Only