missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Tetrabutylammonium Hydroxide Titrant, 0.4 M Solution in Water, Spectrum™ Chemical
Supplier: Spectrum Chemical Mfg Cor T24314LT
Specifications
| 2052-49-5,7732-18-5 | |
| 1 | |
| C16H37NO | |
| 4 L | |
| [OH-].CCCC[N+](CCCC)(CCCC)CCCC | |
| 259.48 | |
| 0.37- 0.43 M |
| 0.15 | |
| Amber Glass Bottle | |
| MFCD00009425 | |
| VDZOOKBUILJEDG-UHFFFAOYSA-M | |
| tetrabutylazanium hydroxide | |
| Chemical Solution |
Chemical Identifiers
| 2052-49-5 | |
| 259.48 | |
| VDZOOKBUILJEDG-UHFFFAOYSA-M | |
| [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| C16H37NO | |
| MFCD00009425 | |
| tetrabutylazanium hydroxide |
CAUTION: For manufacturing or laboratory use only. Read and understand the label and Safety Data Sheet (SDS) prior to use.