missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Stachyose hydrate, 97+%
CAS: 54261-98-2 | C24H42O21 | 666.58 g/mol
Supplier: Thermo Scientific Chemicals 226080050
| Quantity | 5 g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 54261-98-2 | |
| 666.58 | |
| UQZIYBXSHAGNOE-CYDMKDQUNA-N | |
| OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[C@H]4O[C@H](CO)[C@H](O)[C@H](O)[C@H]4O)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O |
| C24H42O21 | |
| MFCD00149457 | |
| 131801001 |
Specifications
| Stachyose hydrate | |
| 54261-98-2 | |
| 95.0°C to 105.0°C | |
| Glass bottle | |
| +129 | |
| MFCD00149457 | |
| UQZIYBXSHAGNOE-CYDMKDQUNA-N | |
| (2R,3R,4S,5S,6R)-2-{[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy}-6-({[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-({[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxan-2-yl]oxy}methyl)oxane-3,4,5-triol | |
| 131801001 | |
| ≥97% |
| 98.5% | |
| ear colorless to yellow to pale brown liquid product may darken during storage | |
| 5 g | |
| 97% min. (ELSD) (HPLC) | |
| C24H42O21 | |
| 5% in water, Clear to slightly hazy, Colorless | |
| OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[C@H]4O[C@H](CO)[C@H](O)[C@H](O)[C@H]4O)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O | |
| 666.58 | |
| 666.58 |