missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Sodium Oxalate, For Nitrogen (Nitrite), Certified, 0.0250M ±0.0005M (0.05N), LabChem™
Supplier: LabChem LC247201
Specifications
| Sodium Oxalate | |
| For Nitrogen (Nitrite) | |
| 99.66,0.34 | |
| Na2C2O4 | |
| 0.0250M ±0.0005M (0.05N) | |
| sodium oxalate, disodium oxalate, natriumoxalat, ethanedioic acid, disodium salt, oxalic acid, disodium salt, natriumoxalat german, stavelan sodny czech, oxalic acid disodium salt, unii-7u0v68lt9x, ethanedioic acid disodium salt | |
| ZNCPFRVNHGOPAG-UHFFFAOYSA-L | |
| disodium oxalate | |
| 6125 | |
| Certified | |
| Poly Bottle | |
| Traceable to NIST | |
| 500 mL |
| Colorless | |
| 62-76-0,7732-18-5 | |
| C2Na2O4 | |
| MFCD00012465 | |
| 1g/mL | |
| Soluble in water | |
| [Na+].[Na+].[O-]C(=O)C([O-])=O | |
| 134.00 | |
| 134 | |
| Passes Test | |
| 1g/mL | |
| Carbon monoxide; Carbon dioxide | |
| Liquid |
Chemical Identifiers
| 62-76-0 | |
| 134.00 | |
| ZNCPFRVNHGOPAG-UHFFFAOYSA-L | |
| 6125 | |
| [Na+].[Na+].[O-]C(=O)C([O-])=O |
| C2Na2O4 | |
| MFCD00012465 | |
| sodium oxalate, disodium oxalate, natriumoxalat, ethanedioic acid, disodium salt, oxalic acid, disodium salt, natriumoxalat german, stavelan sodny czech, oxalic acid disodium salt, unii-7u0v68lt9x, ethanedioic acid disodium salt | |
| disodium oxalate |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature