Learn More
Sodium hydrosulfite, ca. 85%, Tech.
CAS: 7775-14-6 | Na2O4S2 | 174.1 g/mol
$59.73 - $317.97
Chemical Identifiers
| CAS | 7775-14-6 |
|---|---|
| MDL Number | MFCD00011640 |
| InChI Key | JVBXVOWTABLYPX-UHFFFAOYSA-L |
| Synonym | sodium dithionite, sodium hydrosulfite, disodium dithionite, vatrolite, sodium sulfoxylate, sodium hydrosulphite, dithionous acid, disodium salt, blankit, burmol, hydros |
| PubChem CID | 24489 |
| ChEBI | CHEBI:66870 |
| SMILES | [O-]S(=O)S(=O)[O-].[Na+].[Na+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC169590250
|
Thermo Scientific Chemicals
169590250 |
25 g | Glass bottle |
Each for $59.73
|
|
||||
|
AC169590010
|
Thermo Scientific Chemicals
169590010 |
1 kg | Glass Bottle |
Each for $194.22
|
|
||||
|
AC169590020
|
Thermo Scientific Chemicals
169590020 |
2 kg | Glass Bottle |
Each for $317.97
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Reduction reagentChemical Identifiers
| 7775-14-6 | |
| JVBXVOWTABLYPX-UHFFFAOYSA-L | |
| 24489 | |
| [O-]S(=O)S(=O)[O-].[Na+].[Na+] |
| MFCD00011640 | |
| sodium dithionite, sodium hydrosulfite, disodium dithionite, vatrolite, sodium sulfoxylate, sodium hydrosulphite, dithionous acid, disodium salt, blankit, burmol, hydros | |
| CHEBI:66870 |
Specifications
| >300.0°C | |
| White | |
| 25 g | |
| Na2O4S2 | |
| MFCD00011640 | |
| sodium dithionite, sodium hydrosulfite, disodium dithionite, vatrolite, sodium sulfoxylate, sodium hydrosulphite, dithionous acid, disodium salt, blankit, burmol, hydros | |
| JVBXVOWTABLYPX-UHFFFAOYSA-L | |
| 174.1 | |
| CHEBI:66870 | |
| ∼85% | |
| Glass bottle |
| 7775-14-6 | |
| Crystalline Powder | |
| ca. 85% | |
| Na2S2O4 | |
| 15, 8747 | |
| Solubility in water: 250g/L (20°C). Other solubilities: slightly soluble in alcohol | |
| [O-]S(=O)S(=O)[O-].[Na+].[Na+] | |
| 24489 | |
| 174.1 | |
| Technical | |
| Sodium hydrosulfite, tech., ca. 85% |
Safety and Handling
GHS P Statement Harmful if swallowed. Self-heating; may catch fire. Contact with acids liberates toxic gas.
GHS P Statement Keep cool. Protect from sunlight. Wash face, hands and any exposed skin thoroughly after handling. IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Danger
EINECSNumber : 231-890-0
TSCA : TSCA
RUO – Research Use Only