missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific™ Shikimic Acid, 98%
Supplier: Thermo Scientific™ 132700010
| Quantity | 1g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 138-59-0 | |
| 174.15 | |
| JXOHGGNKMLTUBP-HSUXUTPPSA-M | |
| 7057976 | |
| (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate |
| C7H10O5 | |
| MFCD00066278 | |
| shikimic acid, shikimate, --shikimic acid, l-shikimic acid, 3r,4s,5r-3,4,5-trihydroxycyclohex-1-enecarboxylic acid, 3r,4s,5r-3,4,5-trihydroxycyclohex-1-ene-1-carboxylic acid, --shikimate, ccris 7681, unii-29ms2wi2nu, 3alpha,4alpha,5beta-trihydroxy-1-cyclohexene-1-carboxylic acid | |
| CHEBI:36208 | |
| C1C(C(C(C=C1C(=O)[O-])O)O)O |
Specifications
| Shikimic acid | |
| Authentic | |
| Glass bottle | |
| 1g | |
| 10, 458 | |
| − 180.00 (25.00°C c=4,H2O) | |
| shikimic acid, shikimate, --shikimic acid, l-shikimic acid, 3r,4s,5r-3,4,5-trihydroxycyclohex-1-enecarboxylic acid, 3r,4s,5r-3,4,5-trihydroxycyclohex-1-ene-1-carboxylic acid, --shikimate, ccris 7681, unii-29ms2wi2nu, 3alpha,4alpha,5beta-trihydroxy-1-cyclohexene-1-carboxylic acid | |
| JXOHGGNKMLTUBP-HSUXUTPPSA-M | |
| (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate | |
| 7057976 | |
| 174.15 |
| 138-59-0 | |
| 98% | |
| C7H10O5 | |
| MFCD00066278 | |
| 15, 8619 | |
| − 180.00 | |
| Solubility in water: 18g/100mL (20 c). Other solubilities: 2.25g/100mL abs.alcohol, 0.015g/100mL anhydr.ether, practically insoluble in chloroform, benzene and, petroleum ether | |
| C1C(C(C(C=C1C(=O)[O-])O)O)O | |
| 174.15 | |
| CHEBI:36208 | |
| 98% |
Safety and Handling
EINECSNumber : 205-334-2