missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Resazurin, sodium salt, pure, high purity biological stain
CAS: 62758-13-8 | C12H6NNaO4 | 251.173 g/mol
Supplier: Thermo Scientific Chemicals 189900050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Resazurin, sodium salt | |
| 75% min. | |
| MFCD00005036 | |
| 14, 8141 | |
| IVGPGQSSDLDOLH-UHFFFAOYSA-M | |
| C1=CC2=C(C=C1[O-])OC3=CC(=O)C=CC3=[N+]2[O-].[Na+] | |
| 251.173 | |
| 251.17 | |
| Glass bottle | |
| Black to Green | |
| Powder |
| 62758-13-8 | |
| C12H6NNaO4 | |
| 27, 128 | |
| 7-Hydroxy-3H-phenoxazin-3-one 10-oxide, sodium salt | |
| Authentic | |
| sodium;10-oxido-7-oxophenoxazin-10-ium-3-olate | |
| 112939 | |
| Pure | |
| Complies | |
| 5 g |
Chemical Identifiers
| 62758-13-8 | |
| 251.173 | |
| IVGPGQSSDLDOLH-UHFFFAOYSA-M | |
| 112939 | |
| C1=CC2=C(C=C1[O-])OC3=CC(=O)C=CC3=[N+]2[O-].[Na+] |
| C12H6NNaO4 | |
| MFCD00005036 | |
| 7-Hydroxy-3H-phenoxazin-3-one 10-oxide, sodium salt | |
| sodium;10-oxido-7-oxophenoxazin-10-ium-3-olate |
Safety and Handling
Warning
RUO – Research Use Only