missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Quinhydrone, TCI America™
$63.38 - $548.03
Chemical Identifiers
| CAS | 106-34-3 |
|---|---|
| Molecular Formula | C12H10O4 |
| Molecular Weight (g/mol) | 218.21 |
| MDL Number | MFCD00010310 |
| InChI Key | BDJXVNRFAQSMAA-UHFFFAOYSA-N |
| Synonym | quinhydrone, green hydroquinone, p-benzoquinhydrone, chinhydron, chinhydron czech, unii-p4a66lq3qj, hydroquinone, compd. with p-benzoquinone, p-benzoquinone, compd. with hydroquinone, 2,5-cyclohexadiene-1,4-dione, compd. with 1,4-benzenediol 1:1, p-benzoquinone-hydroquinone compound 1:1 |
| PubChem CID | 7801 |
| ChEBI | CHEBI:26491 |
| IUPAC Name | benzene-1,4-diol; cyclohexa-2,5-diene-1,4-dione |
| SMILES | OC1=CC=C(O)C=C1.O=C1C=CC(=O)C=C1 |
Chemical Identifiers
| 106-34-3 | |
| 218.21 | |
| BDJXVNRFAQSMAA-UHFFFAOYSA-N | |
| 7801 | |
| benzene-1,4-diol; cyclohexa-2,5-diene-1,4-dione |
| C12H10O4 | |
| MFCD00010310 | |
| quinhydrone, green hydroquinone, p-benzoquinhydrone, chinhydron, chinhydron czech, unii-p4a66lq3qj, hydroquinone, compd. with p-benzoquinone, p-benzoquinone, compd. with hydroquinone, 2,5-cyclohexadiene-1,4-dione, compd. with 1,4-benzenediol 1:1, p-benzoquinone-hydroquinone compound 1:1 | |
| CHEBI:26491 | |
| OC1=CC=C(O)C=C1.O=C1C=CC(=O)C=C1 |
Specifications
| 106-34-3 | |
| C12H10O4 | |
| 25 g | |
| quinhydrone, green hydroquinone, p-benzoquinhydrone, chinhydron, chinhydron czech, unii-p4a66lq3qj, hydroquinone, compd. with p-benzoquinone, p-benzoquinone, compd. with hydroquinone, 2,5-cyclohexadiene-1,4-dione, compd. with 1,4-benzenediol 1:1, p-benzoquinone-hydroquinone compound 1:1 | |
| OC1=CC=C(O)C=C1.O=C1C=CC(=O)C=C1 | |
| 218.21 | |
| CHEBI:26491 | |
| Crystalline Powder |
| 172°C | |
| MFCD00010310 | |
| 2811 | |
| BDJXVNRFAQSMAA-UHFFFAOYSA-N | |
| benzene-1,4-diol; cyclohexa-2,5-diene-1,4-dione | |
| 7801 | |
| 218.21 | |
| Quinhydrone |
Safety and Handling
RTECSNumber : VA4550000
TSCA : Yes