missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Pyrocatechol Violet, pure, indicator grade
CAS: 115-41-3 | C19H14O7S | 386.37 g/mol
$139.33 - $466.15
Chemical Identifiers
| CAS | 115-41-3 |
|---|---|
| Molecular Formula | C19H14O7S |
| Molecular Weight (g/mol) | 386.37 |
| MDL Number | MFCD00005868 |
| InChI Key | RRRCKIRSVQAAAS-UHFFFAOYSA-N |
| Synonym | Pyrocatecholsulfonephthalein |
| PubChem CID | 66993 |
| IUPAC Name | 4-[3-(3,4-dihydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]benzene-1,2-diol |
| SMILES | OC1=CC=C(C=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC=C(O)C(O)=C1 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC146540050
|
Thermo Scientific Chemicals
146540050 |
5 g |
Each for $139.33
|
|
|||||
|
AC146540250
|
Thermo Scientific Chemicals
146540250 |
25 g |
Each for $466.15
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
IndicatorChemical Identifiers
| 115-41-3 | |
| 386.37 | |
| RRRCKIRSVQAAAS-UHFFFAOYSA-N | |
| 66993 | |
| OC1=CC=C(C=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC=C(O)C(O)=C1 |
| C19H14O7S | |
| MFCD00005868 | |
| Pyrocatecholsulfonephthalein | |
| 4-[3-(3,4-dihydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]benzene-1,2-diol |
Specifications
| 115-41-3 | |
| MFCD00005868 | |
| Solubility in water: soluble. Other solubilities: soluble in ethanol, 2-methoxyethanol | |
| Authentic | |
| 4-[3-(3,4-dihydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]benzene-1,2-diol | |
| 66993 | |
| 386.36 | |
| Glass bottle | |
| for complexometric det. of metal oxides: passes | |
| 5 g | |
| Pyrocatechol Violet |
| C19H14O7S | |
| Pyrocatecholsulfonephthalein | |
| RRRCKIRSVQAAAS-UHFFFAOYSA-N | |
| OC1=CC=C(C=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC=C(O)C(O)=C1 | |
| 386.37 | |
| 441 to 449nm (in methanol) | |
| Pure | |
| 375 (at lambda max, methanol) min. | |
| Brown or Green | |
| Metallic or Crystalline Powder |
RUO – Research Use Only