missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium Persulfate, For Mercury, Metals, Certified, 4.5% to 5.0% (w/v), LabChem™
$64.83 - $100.67
Chemical Identifiers
| CAS | 7727-21-1 |
|---|---|
| Molecular Formula | K2O8S2 |
| Molecular Weight (g/mol) | 270.309 |
| InChI Key | USHAGKDGDHPEEY-UHFFFAOYSA-L |
| Synonym | potassium persulfate, anthion, potassium peroxydisulfate, potassium peroxodisulfate, dipotassium peroxydisulfate, potassium peroxydisulphate, dipotassium persulfate, caswell no. 700, dipotassium peroxodisulphate, unii-6b86k0mczc |
| PubChem CID | 24412 |
| IUPAC Name | dipotassium;sulfonatooxy sulfate |
| SMILES | [O-]S(=O)(=O)OOS(=O)(=O)[O-].[K+].[K+] |
Chemical Identifiers
| 7727-21-1 | |
| 270.309 | |
| potassium persulfate, anthion, potassium peroxydisulfate, potassium peroxodisulfate, dipotassium peroxydisulfate, potassium peroxydisulphate, dipotassium persulfate, caswell no. 700, dipotassium peroxodisulphate, unii-6b86k0mczc | |
| dipotassium;sulfonatooxy sulfate |
| K2O8S2 | |
| USHAGKDGDHPEEY-UHFFFAOYSA-L | |
| 24412 | |
| [O-]S(=O)(=O)OOS(=O)(=O)[O-].[K+].[K+] |
Specifications
| Colorless | |
| 95.3,4.7 | |
| K2S2O8 | |
| potassium persulfate, anthion, potassium peroxydisulfate, potassium peroxodisulfate, dipotassium peroxydisulfate, potassium peroxydisulphate, dipotassium persulfate, caswell no. 700, dipotassium peroxodisulphate, unii-6b86k0mczc | |
| USHAGKDGDHPEEY-UHFFFAOYSA-L | |
| dipotassium;sulfonatooxy sulfate | |
| 24412 | |
| 4.5 to 5.0% (w/v) | |
| Passes Test | |
| 1.05g/mL | |
| Oxygen; Sulfur compounds | |
| Liquid |
| 7727-21-1,7732-18-5 | |
| K2O8S2 | |
| 1.05g/mL | |
| Soluble in water | |
| [O-]S(=O)(=O)OOS(=O)(=O)[O-].[K+].[K+] | |
| 270.309 | |
| 270.32 | |
| Certified | |
| Amber Glass | |
| Traceable to NIST | |
| 500 mL | |
| Potassium Persulfate, For Mercury, Metals |
Safety and Handling
GHS H Statement
May cause an allergic skin reaction.
May cause allergy or asthma symptoms or breathing difficulties if inhaled.
GHS P Statement
Avoid breathing mist.
Wear protective gloves, protective clothing, eye protection, face protection.
Wear respiratory protection.
If on skin: Wash with plenty of soap and water.
Take off contaminated clothing and wash it before reuse.
If skin irritation occurs: Get medical advice/attention.
If inhaled: Remove person to fresh air and keep comfortable for breathing.
If experiencing respiratory symptoms: Call a poison center/doctor.
Dispose of contents/container to comply with local, state and federal regulations.
Danger
Recommended Storage : Room Temperature