missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium dichromate concentrate, For 1L standard solution, 1/60Â M K2Cr2O7 (0.1N), Honeywell Fluka™
for 1L standard solution, 1/60Â M K2Cr2O7 (0.1N)
Supplier: Honeywell-Fluka 381006X1EA
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Specifications
| 100°C | |
| For 1L standard solution, 1/60Â M K2Cr2O7 (0.1N) | |
| 5.7%,>94.0000% | |
| Concentrate | |
| Cr2K2O7 | |
| MFCD00011367 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] | |
| 294.182 | |
| CHEBI:53444 | |
| Ampoule |
| Potassium dichromate concentrate | |
| 7778-50-9,7732-18-5 | |
| >94.0000% | |
| 6 x 1 Ea. | |
| K2Cr2O7 | |
| UN2922 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium | |
| 24502 | |
| 294.18 | |
| 1.030 g/cm3 |
Chemical Identifiers
| 7778-50-9 | |
| 294.182 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| 24502 | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| Cr2K2O7 | |
| MFCD00011367 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| CHEBI:53444 | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
Safety and Handling
P201-P260-P280-P284-P305 + P351 + P338-P308 + P313
ShelfLife : 1260 days from date of manufacture
DOTInformation : Transport Hazard Class: 8; Packing Group:3: II; Proper Shipping Name: Corrosive liquids, toxic, n.o.s.
Recommended Storage : Room Temp