missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium Dichromate, Certified, 0.1000N ±0.0005N (0.0167M), LabChem™
$44.43 - $554.89
Chemical Identifiers
| CAS | 7778-50-9 |
|---|---|
| Molecular Formula | Cr2K2O7 |
| Molecular Weight (g/mol) | 294.182 |
| InChI Key | KMUONIBRACKNSN-UHFFFAOYSA-N |
| Synonym | potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash |
| PubChem CID | 24502 |
| ChEBI | CHEBI:53444 |
| IUPAC Name | dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| SMILES | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
LC189801
|
LabChem
LC189801 |
500 mL |
Each for $44.43
|
|
|||||
|
LC189802
|
LabChem
LC189802 |
1 L |
Each for $76.29
|
|
|||||
|
LC189804
|
LabChem
LC189804 |
4 L |
Each for $155.39
|
|
|||||
|
LC189806
|
LabChem
LC189806 |
10 L |
Each for $362.75
|
|
|||||
|
LC189805
|
LabChem
LC189805 |
20 L |
Each for $554.89
|
|
|||||
Chemical Identifiers
| 7778-50-9 | |
| 294.182 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| CHEBI:53444 | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
| Cr2K2O7 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| 24502 | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
Specifications
| 7778-50-9,7732-18-5 | |
| 99.5,0.5 | |
| 500 mL | |
| K2Cr2O7 | |
| Soluble in water | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] | |
| 294.182 | |
| CHEBI:53444 | |
| Certified | |
| Passes Test | |
| 1g/mL | |
| 1g/mL |
| Orange | |
| Liquid | |
| Cr2K2O7 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium | |
| 24502 | |
| 294.18 | |
| 0.1000N ±0.0005N (0.0167M) | |
| Poly Bottle | |
| Contains hexavalent Chromium | |
| Potassium Dichromate |
Safety and Handling
GHS H Statement
May cause an allergic skin reaction.
May cause allergy or asthma symptoms or breathing difficulties if inhaled.
May cause genetic defects.
May cause cancer.
May damage fertility or the unborn child.
GHS P Statement
Obtain special instructions before use.
Do not handle until all safety precautions have been read and understood.
Avoid breathing mist.
Wear protective gloves, protective clothing, eye protection, face protection.
Wear respiratory protection.
Contaminated work clothing must not be allowed out of the workplace.
If exposed or concerned: Get medical advice/attention.
If on skin: Wash with plenty of soap and water.
Take off contaminated clothing and wash it before reuse.
If skin irritation or rash occurs: Get medical advice/attention.
If inhaled: Remove person to fresh air and keep comfortable for breathing.
If experiencing respiratory symptoms: Call a poison center/doctor.
Store locked up.
Dispose of contents/container to comply with local, state and federal regulations.
Danger
Recommended Storage : Room Temperature