missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium Dichromate, 4% (w/v), Ricca Chemical
Supplier: Ricca Chemical Company R6042800500A
| Quantity | 500 mL |
|---|---|
| Packaging | Natural Poly Bottle |
Chemical Identifiers
| 7778-50-9 , 7732-18-5 | |
| 294.182 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| CHEBI:53444 | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
| Cr2K2O7 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| 24502 | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
Specifications
| Potassium Dichromate | |
| 94.0, 3.77 | |
| Cr2K2O7 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium | |
| 24502 | |
| Natural Poly Bottle | |
| 4% (w/v) |
| 7778-50-9 , 7732-18-5 | |
| 98.0, 3.93 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] | |
| 294.182 | |
| CHEBI:53444 | |
| 500 mL |