missing translation for 'onlineSavingsMsg'
Learn More
Learn More
PIPES, disodium salt, 99%
CAS: 76836-02-7 | C8H16N2Na2O6S2 | 346.324 g/mol
$131.57 - $715.38
Chemical Identifiers
| CAS | 76836-02-7 |
|---|---|
| Molecular Formula | C8H16N2Na2O6S2 |
| Molecular Weight (g/mol) | 346.324 |
| InChI Key | GMHSTJRPSVFLMT-UHFFFAOYSA-L |
| Synonym | 1, 4-Piperazinediethanesulfonic acid disodium salt |
| PubChem CID | 173553 |
| ChEBI | CHEBI:63055 |
| IUPAC Name | disodium;2-[4-(2-sulfonatoethyl)piperazin-1-yl]ethanesulfonate |
| SMILES | C1CN(CCN1CCS(=O)(=O)[O-])CCS(=O)(=O)[O-].[Na+].[Na+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC215090250
|
Thermo Scientific Chemicals
215090250 |
25 g | Glass bottle |
Each for $131.57
|
|
||||
|
AC215091000
|
Thermo Scientific Chemicals
215091000 |
100 g | Glass bottle |
Each for $307.33
|
|
||||
|
AC215092500
|
Thermo Scientific Chemicals
215092500 |
250 g | Glass bottle |
Each for $715.38
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 76836-02-7 | |
| 346.324 | |
| 1, 4-Piperazinediethanesulfonic acid disodium salt | |
| CHEBI:63055 | |
| C1CN(CCN1CCS(=O)(=O)[O-])CCS(=O)(=O)[O-].[Na+].[Na+] |
| C8H16N2Na2O6S2 | |
| GMHSTJRPSVFLMT-UHFFFAOYSA-L | |
| 173553 | |
| disodium;2-[4-(2-sulfonatoethyl)piperazin-1-yl]ethanesulfonate |
Specifications
| 0.050 max. (0.1M in water) at 260nm, 0.050 max. (0.1M in water) at 280nm, 0.050 max. (260nm, 0.1M in water) | |
| White | |
| Crystalline Powder or Powder | |
| 99% | |
| C8H16N2Na2O6S2 | |
| 1, 4-Piperazinediethanesulfonic acid disodium salt | |
| C1CN(CCN1CCS(=O)(=O)[O-])CCS(=O)(=O)[O-].[Na+].[Na+] | |
| 346.324 | |
| CHEBI:63055 | |
| 99% |
| 76836-02-7 | |
| 9.2 to 10.0 max. (25°C, 1% min. aq. soln.) | |
| 25 g | |
| Authentic | |
| Glass bottle | |
| GMHSTJRPSVFLMT-UHFFFAOYSA-L | |
| disodium;2-[4-(2-sulfonatoethyl)piperazin-1-yl]ethanesulfonate | |
| 173553 | |
| 346.33 | |
| PIPES, disodium salt |
RUO – Research Use Only