missing translation for 'onlineSavingsMsg'
Learn More
Learn More
PIPES-buffered saline (5X), pH 6.5, Thermo Scientific™
Supplier: Thermo Scientific Chemicals J63152AP
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| PIPES-buffered saline | |
| Colorless | |
| 6.5 | |
| 500 mL | |
| MFCD00006159 | |
| C1CN(CCN1CCS(=O)(=O)O)CCS(=O)(=O)O | |
| 302.36 | |
| CHEBI:44933 |
| 5625-37-6 | |
| 5X | |
| Liquid | |
| C8H18N2O6S2 | |
| IHPYMWDTONKSCO-UHFFFAOYSA-N | |
| 2-[4-(2-sulfoethyl)piperazin-1-yl]ethanesulfonic acid | |
| 79723 |
Chemical Identifiers
| 5625-37-6 | |
| 302.36 | |
| IHPYMWDTONKSCO-UHFFFAOYSA-N | |
| CHEBI:44933 | |
| C1CN(CCN1CCS(=O)(=O)O)CCS(=O)(=O)O |
| C8H18N2O6S2 | |
| MFCD00006159 | |
| 79723 | |
| 2-[4-(2-sulfoethyl)piperazin-1-yl]ethanesulfonic acid |
Safety and Handling
TSCA : Yes
Recommended Storage : Ambient temperatures