missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Pimobendan, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 468572500
Specifications
| Pimobendan | |
| Available | |
| Titration with HClO4 | |
| C19H18N4O2 | |
| 00761648 | |
| White to Light Yellow | |
| GLBJJMFZWDBELO-UHFFFAOYNA-N | |
| 6-[2-(4-methoxyphenyl)-1H-1,3-benzodiazol-6-yl]-5-methyl-2,3,4,5-tetrahydropyridazin-3-one | |
| 250 mg |
| Glass Bottle | |
| 74150-27-9 | |
| Powder | |
| 97.5% to 102.5% | |
| 2811 | |
| 7516 | |
| COC1=CC=C(C=C1)C1=NC2=CC=C(C=C2N1)C1=NNC(=O)CC1C | |
| 334.38 | |
| 334.37 |
Chemical Identifiers
| 74150-27-9 | |
| 334.38 | |
| GLBJJMFZWDBELO-UHFFFAOYNA-N | |
| COC1=CC=C(C=C1)C1=NC2=CC=C(C=C2N1)C1=NNC(=O)CC1C |
| C19H18N4O2 | |
| 00761648 | |
| 6-[2-(4-methoxyphenyl)-1H-1,3-benzodiazol-6-yl]-5-methyl-2,3,4,5-tetrahydropyridazin-3-one |
Safety and Handling
GHS07: Exclamation mark
ShelfLife : 3 years
RTECSNumber : UR6373000
Recommended Storage : Refrigerator +4°C