missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Picric Acid, Reagent Grade, Ricca Chemical
For safety in transportation, Picric Acid is usually mixed with a minimum of 30% water.
Supplier: Ricca Chemical Company RDCP030010C1
Specifications
| Picric Acid | |
| 70 | |
| OXNIZHLAWKMVMX-UHFFFAOYSA-N | |
| 2,4,6-trinitrophenol | |
| 49% | |
| 10 g |
| 7732-18-5,88-89-1 | |
| C6H3N3O7 | |
| OC1=C(C=C(C=C1[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O | |
| Mixture | |
| Reagent | |
| Amber Glass Bottle |
Chemical Identifiers
| 7732-18-5 | |
| Mixture | |
| 2,4,6-trinitrophenol |
| C6H3N3O7 | |
| OXNIZHLAWKMVMX-UHFFFAOYSA-N |
Safety and Handling
ShelfLife : 84 months