missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Picric Acid, Crystal, Spectrum™ Chemical
Supplier: Spectrum Chemical Mfg Cor P1691500GM
Specifications
| 121° to 123°C | |
| 1 | |
| OXNIZHLAWKMVMX-UHFFFAOYSA-N | |
| 2,4,6-trinitrophenol | |
| Reagent | |
| Amber Glass Bottle |
| 88-89-1 | |
| C6H3N3O7 | |
| OC1=C(C=C(C=C1[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O | |
| 229.10 | |
| 500 g |
Chemical Identifiers
| 88-89-1 | |
| 229.10 | |
| 2,4,6-trinitrophenol |
| C6H3N3O7 | |
| OXNIZHLAWKMVMX-UHFFFAOYSA-N | |
| OC1=C(C=C(C=C1[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O |
CAUTION: For manufacturing or laboratory use only. Read and understand the label and Safety Data Sheet (SDS) prior to use.