missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Phosphoenolpyruvic Acid Monocyclohexylammonium Salt 98.0+%, TCI America™
Supplier: TCI America P07581G
Specifications
| Phosphoenolpyruvic Acid Monocyclohexylammonium Salt | |
| White | |
| MFCD00036375 | |
| cyclohexanamine 2-phosphonooxy acrylate, phosphoenolpyruvic acid cyclohexylammonium salt, 2-propenoic acid, 2-phosphonooxy-, compd. with cyclohexanamine 1:1, cyclohexylamine; phosphoenolpyruvic acid, phosphoenolpyruvic acid cyclohexylamine salt, phosphoenolpyruvic acid, cyclohexylammonium salt, cyclohexanamine; 2-phosphonooxyprop-2-enoic acid, phospho enol pyruvic acid cyclohexylammonium salt, phosphoenolpyruvic acid monocyclohexylammonium salt | |
| NC1CCCCC1.OC(=O)C(=C)OP(O)(O)=O | |
| 267.22 | |
| 267.22 | |
| Crystalline Powder |
| 10526-80-4 | |
| C9H18NO6P | |
| 1 g | |
| VHFCNZDHPABZJO-UHFFFAOYSA-N | |
| 2-(phosphonooxy)prop-2-enoic acid; cyclohexanamine | |
| 82702 | |
| ≥98.0% (T) |
Chemical Identifiers
| 10526-80-4 | |
| 267.22 | |
| VHFCNZDHPABZJO-UHFFFAOYSA-N | |
| 82702 | |
| NC1CCCCC1.OC(=O)C(=C)OP(O)(O)=O |
| C9H18NO6P | |
| MFCD00036375 | |
| cyclohexanamine 2-phosphonooxy acrylate, phosphoenolpyruvic acid cyclohexylammonium salt, 2-propenoic acid, 2-phosphonooxy-, compd. with cyclohexanamine 1:1, cyclohexylamine; phosphoenolpyruvic acid, phosphoenolpyruvic acid cyclohexylamine salt, phosphoenolpyruvic acid, cyclohexylammonium salt, cyclohexanamine; 2-phosphonooxyprop-2-enoic acid, phospho enol pyruvic acid cyclohexylammonium salt, phosphoenolpyruvic acid monocyclohexylammonium salt | |
| 2-(phosphonooxy)prop-2-enoic acid; cyclohexanamine |
Safety and Handling
TSCA : Yes
Recommended Storage : Refrigerator