missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Phosphoenolpyruvic Acid Monocyclohexylammonium Salt 98.0+%, TCI America™
$31.68 - $139.81
Chemical Identifiers
| CAS | 10526-80-4 |
|---|---|
| Molecular Formula | C9H18NO6P |
| Molecular Weight (g/mol) | 267.22 |
| MDL Number | MFCD00036375 |
| InChI Key | VHFCNZDHPABZJO-UHFFFAOYSA-N |
| Synonym | cyclohexanamine 2-phosphonooxy acrylate, phosphoenolpyruvic acid cyclohexylammonium salt, 2-propenoic acid, 2-phosphonooxy-, compd. with cyclohexanamine 1:1, cyclohexylamine; phosphoenolpyruvic acid, phosphoenolpyruvic acid cyclohexylamine salt, phosphoenolpyruvic acid, cyclohexylammonium salt, cyclohexanamine; 2-phosphonooxyprop-2-enoic acid, phospho enol pyruvic acid cyclohexylammonium salt, phosphoenolpyruvic acid monocyclohexylammonium salt |
| PubChem CID | 82702 |
| IUPAC Name | 2-(phosphonooxy)prop-2-enoic acid; cyclohexanamine |
| SMILES | NC1CCCCC1.OC(=O)C(=C)OP(O)(O)=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
P0758100MG
|
TCI America
P0758100MG |
100 mg |
Each for $31.68
|
|
|||||
|
P07581G
|
TCI America
P07581G |
1 g |
Each for $139.81
|
|
|||||
Chemical Identifiers
| 10526-80-4 | |
| 267.22 | |
| VHFCNZDHPABZJO-UHFFFAOYSA-N | |
| 82702 | |
| NC1CCCCC1.OC(=O)C(=C)OP(O)(O)=O |
| C9H18NO6P | |
| MFCD00036375 | |
| cyclohexanamine 2-phosphonooxy acrylate, phosphoenolpyruvic acid cyclohexylammonium salt, 2-propenoic acid, 2-phosphonooxy-, compd. with cyclohexanamine 1:1, cyclohexylamine; phosphoenolpyruvic acid, phosphoenolpyruvic acid cyclohexylamine salt, phosphoenolpyruvic acid, cyclohexylammonium salt, cyclohexanamine; 2-phosphonooxyprop-2-enoic acid, phospho enol pyruvic acid cyclohexylammonium salt, phosphoenolpyruvic acid monocyclohexylammonium salt | |
| 2-(phosphonooxy)prop-2-enoic acid; cyclohexanamine |
Specifications
| 10526-80-4 | |
| C9H18NO6P | |
| 100 mg | |
| VHFCNZDHPABZJO-UHFFFAOYSA-N | |
| 2-(phosphonooxy)prop-2-enoic acid; cyclohexanamine | |
| 82702 | |
| ≥98.0% (T) | |
| Phosphoenolpyruvic Acid Monocyclohexylammonium Salt |
| White | |
| MFCD00036375 | |
| cyclohexanamine 2-phosphonooxy acrylate, phosphoenolpyruvic acid cyclohexylammonium salt, 2-propenoic acid, 2-phosphonooxy-, compd. with cyclohexanamine 1:1, cyclohexylamine; phosphoenolpyruvic acid, phosphoenolpyruvic acid cyclohexylamine salt, phosphoenolpyruvic acid, cyclohexylammonium salt, cyclohexanamine; 2-phosphonooxyprop-2-enoic acid, phospho enol pyruvic acid cyclohexylammonium salt, phosphoenolpyruvic acid monocyclohexylammonium salt | |
| NC1CCCCC1.OC(=O)C(=C)OP(O)(O)=O | |
| 267.22 | |
| 267.22 | |
| Crystalline Powder |
Safety and Handling
TSCA : Yes
Recommended Storage : Refrigerator