Learn More
Phenyl sulfone, 97%
CAS: 127-63-9 | C12H10O2S | 218.27 g/mol
$118.05 - $118.05
Chemical Identifiers
| CAS | 127-63-9 |
|---|---|
| Molecular Formula | C12H10O2S |
| Molecular Weight (g/mol) | 218.27 |
| MDL Number | MFCD00007548 |
| InChI Key | KZTYYGOKRVBIMI-UHFFFAOYSA-N |
| Synonym | diphenyl sulfone, phenyl sulfone, sulfonyldibenzene, diphenylsulfone, sulfobenzide, diphenyl sulphone, benzene, 1,1'-sulfonylbis, sulfone, diphenyl, 1,1'-sulfonyldibenzene, phenyl sulphone |
| PubChem CID | 31386 |
| ChEBI | CHEBI:78360 |
| SMILES | O=S(=O)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC130962500
|
Thermo Scientific Chemicals
130962500 |
250 g | Plastic bottle |
Each for $118.05
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 127-63-9 | |
| 218.27 | |
| KZTYYGOKRVBIMI-UHFFFAOYSA-N | |
| 31386 | |
| O=S(=O)(C1=CC=CC=C1)C1=CC=CC=C1 |
| C12H10O2S | |
| MFCD00007548 | |
| diphenyl sulfone, phenyl sulfone, sulfonyldibenzene, diphenylsulfone, sulfobenzide, diphenyl sulphone, benzene, 1,1'-sulfonylbis, sulfone, diphenyl, 1,1'-sulfonyldibenzene, phenyl sulphone | |
| CHEBI:78360 |
Specifications
| 127-63-9 | |
| White | |
| Authentic | |
| Plastic bottle | |
| (C6H5)2SO2 | |
| 250 g | |
| 15, 3372 | |
| Solubility in water: insoluble. Other solubilities: slightly soluble in boiling water,soluble in hot alcohol and benzene | |
| O=S(=O)(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 218.27 | |
| CHEBI:78360 | |
| 97% | |
| Phenyl sulfone, 97% |
| 125.0°C to 129.0°C | |
| 379.0°C | |
| 97% | |
| C12H10O2S | |
| MFCD00007548 | |
| 06, 300 | |
| diphenyl sulfone, phenyl sulfone, sulfonyldibenzene, diphenylsulfone, sulfobenzide, diphenyl sulphone, benzene, 1,1'-sulfonylbis, sulfone, diphenyl, 1,1'-sulfonyldibenzene, phenyl sulphone | |
| KZTYYGOKRVBIMI-UHFFFAOYSA-N | |
| (benzenesulfonyl)benzene | |
| 31386 | |
| 218.28 | |
| Crystalline Powder |
Safety and Handling
GHS H Statement
Harmful if swallowed.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Call a POISON CENTER or doctor/physician if you feel unwell.
Wash face,hands and any exposed skin thoroughly after handling.
GHS Signal Word: Warning
EINECSNumber : 204-853-1
RTECSNumber : SX2400000
TSCA : TSCA
RUO – Research Use Only