missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Phenol Red, 0.04%, Aqueous, pH 6.8 to 8.4 Yellow to Red, Certified, LabChem™
$40.82 - $78.14
Chemical Identifiers
| CAS | 34487-61-1 |
|---|---|
| Molecular Formula | C19H13NaO5S |
| Molecular Weight (g/mol) | 376.358 |
| InChI Key | HKHYOKBQJILTEI-UHFFFAOYSA-M |
| PubChem CID | 23686673 |
| IUPAC Name | sodium;4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenolate |
| SMILES | C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC=C(C=C3)O)C4=CC=C(C=C4)[O-].[Na+] |
Chemical Identifiers
| 34487-61-1 | |
| 376.358 | |
| 23686673 | |
| C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC=C(C=C3)O)C4=CC=C(C=C4)[O-].[Na+] |
| C19H13NaO5S | |
| HKHYOKBQJILTEI-UHFFFAOYSA-M | |
| sodium;4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenolate |
Specifications
| 34487-61-1 , 7732-18-5 | |
| C19H13NaO5S | |
| Soluble in water | |
| HKHYOKBQJILTEI-UHFFFAOYSA-M | |
| sodium;4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenolate | |
| 23686673 | |
| Certified | |
| Nitrogen oxides; Carbon monoxide; Carbon dioxide | |
| 125 mL | |
| Phenol Red, 0.04%, Aqueous, pH 6.8 to 8.4 Yellow to Red |
| 99.96,0.04 | |
| C19H13O5SNa | |
| Passes Test | |
| C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC=C(C=C3)O)C4=CC=C(C=C4)[O-].[Na+] | |
| 376.358 | |
| 376.36 | |
| Poly Bottle | |
| Red | |
| Liquid |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature