Learn More
Perfluoroheptanes, mixed isomers, 97%, Thermo Scientific Chemicals
Supplier: Thermo Scientific Chemicals L1697914
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Perfluoroheptanes | |
| 335-57-9 | |
| 80°C to 82°C | |
| 1.265 | |
| MFCD00040339 | |
| 1716335 | |
| LGUZHRODIJCVOC-UHFFFAOYSA-N | |
| 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-hexadecafluoroheptane | |
| 9553 | |
| 388.05 |
| mixed isomers | |
| 1.72 | |
| C7F16 | |
| CF3(CF2)5CF3 | |
| 25 g | |
| hexadecafluoroheptane, perfluoroheptane, perfluoro-n-heptane, heptane, hexadecafluoro, perfluoroheptanes, unii-i23zvd1p1l, i23zvd1p1l, heptane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-hexadecafluoro, perfluoroheptane s, acmc-20akry | |
| C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F | |
| 388.051 | |
| CHEBI:38847 | |
| 98% |
Chemical Identifiers
| 335-57-9 | |
| 388.051 | |
| LGUZHRODIJCVOC-UHFFFAOYSA-N | |
| 9553 | |
| 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-hexadecafluoroheptane |
| C7F16 | |
| MFCD00040339 | |
| hexadecafluoroheptane, perfluoroheptane, perfluoro-n-heptane, heptane, hexadecafluoro, perfluoroheptanes, unii-i23zvd1p1l, i23zvd1p1l, heptane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-hexadecafluoro, perfluoroheptane s, acmc-20akry | |
| CHEBI:38847 | |
| C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
Safety and Handling
P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P332+P313-P362-P501c
H315-H319-H335
EINECSNumber : 206-392-1
RTECSNumber : MJ0875000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only