missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Organic Carbon Standard, 200 ppm C, Ricca Chemical
Supplier: Ricca Chemical Company R1846200250C
Specifications
| Organic Carbon Standard | |
| Amber Glass Bottle | |
| Odorless | |
| C8H5KO4 | |
| < 2 | |
| 100°C | |
| Miscible with water | |
| TOC Standard | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] | |
| 204.222 | |
| 23676735 |
| 200 ppm C | |
| 877-24-7,7664-38-2,7732-18-5 | |
| Liquid | |
| Colorless | |
| 0.0°C | |
| Water Analyzer | |
| Calibration Solution | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate | |
| 250 mL | |
| Laboratory |
Chemical Identifiers
| 877-24-7 | |
| 204.222 | |
| 23676735 | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| C8H5KO4 | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate |
Safety and Handling
ShelfLife : 12 months