missing translation for 'onlineSavingsMsg'
Learn More
Learn More
pH Buffer Pouches, Oakton™
Oakton™ pH buffer pouches; package of 20 Economical pouches are accurate and convenient.±0.01 accuracy at 77°°F (25°°C)
Supplier: Oakton Instruments 3565303
Specifications
| Oakton pH buffer pouches | |
| Calibration | |
| 10.00 | |
| 20 Ea. | |
| C8H5KO4 | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] | |
| 204.222 |
| 877-24-7 | |
| pH Meter and Electrode | |
| Liquid | |
| pH Buffer | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate | |
| 23676735 |
Chemical Identifiers
| 877-24-7 | |
| 204.222 | |
| 23676735 | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| C8H5KO4 | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate |