missing translation for 'onlineSavingsMsg'
Learn More
Learn More
o-Tolidine, Powder, Reagent, Spectrum™ Chemical
T1084, 119-93-7, C14H16N2
Supplier: Spectrum Chemical Mfg Cor T108425GM
Description
Spectrum™ Chemical o-Tolidine, Powder, Reagent is a commercially important aromatic amine used to make dyes. It is also used in the production of certain elastomers and as a reagent and indicator in analytical forensic and clinical chemistry. As an ACS grade Reagent, Spectrum Chemical manufactured compound is used as the quality standard against which other substances are grade and has met the toughest regulatory standards for quality and pureness.Specifications
| 119-93-7 | |
| 125-132°C | |
| C14H16N2 | |
| NUIURNJTPRWVAP-UHFFFAOYSA-N | |
| 3,3'-dimethyl-[1,1'-biphenyl]-4,4'-diamine | |
| 97.5% | |
| Crystalline Powder or Lumps |
| 1 | |
| Amber Glass Bottle | |
| 25 g | |
| CC1=CC(=CC=C1N)C1=CC=C(N)C(C)=C1 | |
| 212.30 | |
| Reagent |
Chemical Identifiers
| 119-93-7 | |
| 212.30 | |
| 3,3'-dimethyl-[1,1'-biphenyl]-4,4'-diamine |
| C14H16N2 | |
| NUIURNJTPRWVAP-UHFFFAOYSA-N | |
| CC1=CC(=CC=C1N)C1=CC=C(N)C(C)=C1 |