missing translation for 'onlineSavingsMsg'
Learn More
Learn More
o-Phenanthroline Solution, Certified, 0.25% (w/v), LabChem™
Supplier: LabChem LC181601
Specifications
| o-Phenanthroline Solution | |
| 5144-89-8,7732-18-5 | |
| C12H10N2O | |
| MFCD00149973 | |
| 1,10-phenanthroline hydrate, 1,10-phenanthroline monohydrate, o-phenanthroline monohydrate, unii-ksx215x00e, 1,10-fenantrolina, 4,5-phenanthroline monohydrate, 1,10-phenanthroline, monohydrate, 1,10-fenanthrolin, 1,10-phenanthrolineo-phenanthroline, 1, 10-phenanthroline monohydrate | |
| PPQJCISYYXZCAE-UHFFFAOYSA-N | |
| 1,10-phenanthroline hydrate | |
| 21226 | |
| 0.25% (w/v) | |
| Passes Test | |
| 1g/mL | |
| Carbon monoxide; Carbon dioxide | |
| Liquid |
| Colorless | |
| 99.75,0.25 | |
| C12H8N2·H2O | |
| 1g/mL | |
| Soluble in water | |
| O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1 | |
| 198.23 | |
| 198.22 | |
| Certified | |
| Poly Bottle | |
| Passes Test | |
| 500 mL |
Chemical Identifiers
| 5144-89-8 | |
| 198.23 | |
| PPQJCISYYXZCAE-UHFFFAOYSA-N | |
| 21226 | |
| O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1 |
| C12H10N2O | |
| MFCD00149973 | |
| 1,10-phenanthroline hydrate, 1,10-phenanthroline monohydrate, o-phenanthroline monohydrate, unii-ksx215x00e, 1,10-fenantrolina, 4,5-phenanthroline monohydrate, 1,10-phenanthroline, monohydrate, 1,10-fenanthrolin, 1,10-phenanthrolineo-phenanthroline, 1, 10-phenanthroline monohydrateShow More | |
| 1,10-phenanthroline hydrate |
Safety and Handling
GHS H Statement
Harmful to aquatic life with long lasting effects.
GHS P Statement
Avoid release to the environment.
Dispose of contents/container to comply with local, state and federal regulations.
Recommended Storage : Room Temperature