missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Nile Red, 99%, pure
CAS: 7385-67-3 | C20H18N2O2 | 318.38 g/mol
Supplier: Thermo Scientific Chemicals 415710010
| Quantity | 1 g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| C20H18N2O2 | |
| MFCD00011639 | |
| Nile blue A oxazone | |
| CHEBI:52169 |
Specifications
| Nile Red | |
| 99% | |
| 98.5 | |
| 99% | |
| MFCD00011639 | |
| 15, 6628 | |
| Solubility in water: almost insoluble. Other solubilities: soluble in acetone, acetonitrile, chloroform, thf,, ethanol, dmso, cs2, benzene, nitrobenzene, pyridin, e, hexane, diethyl ether | |
| CCN(CC)C1=CC=C2N=C3C(OC2=C1)=CC(=O)C1=CC=CC=C31 | |
| 8-(diethylamino)-12H-10-oxa-5-azatetraphen-12-one | |
| 65182 | |
| 318.38 | |
| Pure | |
| 98.5% min. | |
| Maroon to Red | |
| Powder |
| 203.0°C to 205.0°C | |
| 7385-67-3 | |
| 100.0 | |
| C20H18N2O2 | |
| 27, II, 468 | |
| Nile blue A oxazone | |
| VOFUROIFQGPCGE-UHFFFAOYSA-N | |
| Authentic | |
| 318.38 | |
| CHEBI:52169 | |
| 99% | |
| Glass bottle | |
| Complies | |
| 1 g |
Safety and Handling
EINECSNumber : 230-966-0
TSCA : TSCA