missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Naphthalene-2,6-dicarboxylic acid, 98+%
CAS: 1141-38-4 | C12H8O4 | 216.192 g/mol
$107.68 - $1474.03
Chemical Identifiers
| CAS | 1141-38-4 |
|---|---|
| Molecular Formula | C12H8O4 |
| Molecular Weight (g/mol) | 216.192 |
| MDL Number | MFCD00004105 |
| InChI Key | RXOHFPCZGPKIRD-UHFFFAOYSA-N |
| Synonym | 2,6-naphthalenedicarboxylic acid, 2,6-naphthalic acid, 2,6-dicarboxynaphthalene, unii-k3c4dyz29o, 2,6-naphthalene dicarboxylic acid, k3c4dyz29o, dsstox_cid_9211, acmc-2099kj, d06kmp, dsstox_rid_78711 |
| PubChem CID | 14357 |
| ChEBI | CHEBI:44460 |
| IUPAC Name | naphthalene-2,6-dicarboxylic acid |
| SMILES | C1=CC2=C(C=CC(=C2)C(=O)O)C=C1C(=O)O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAA1686806
|
Thermo Scientific Chemicals
A1686806 |
5 g |
Each for $107.68
|
|
|||||
|
AAA1686814
|
Thermo Scientific Chemicals
A1686814 |
25 g |
Each for $411.32
|
|
|||||
|
AAA1686822
|
Thermo Scientific Chemicals
A1686822 |
100 g |
Each for $1,474.03
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1141-38-4 | |
| 216.192 | |
| RXOHFPCZGPKIRD-UHFFFAOYSA-N | |
| 14357 | |
| naphthalene-2,6-dicarboxylic acid |
| C12H8O4 | |
| MFCD00004105 | |
| 2,6-naphthalenedicarboxylic acid, 2,6-naphthalic acid, 2,6-dicarboxynaphthalene, unii-k3c4dyz29o, 2,6-naphthalene dicarboxylic acid, k3c4dyz29o, dsstox_cid_9211, acmc-2099kj, d06kmp, dsstox_rid_78711 | |
| CHEBI:44460 | |
| C1=CC2=C(C=CC(=C2)C(=O)O)C=C1C(=O)O |
Specifications
| 1141-38-4 | |
| Odorless | |
| MFCD00004105 | |
| 2051257 | |
| RXOHFPCZGPKIRD-UHFFFAOYSA-N | |
| naphthalene-2,6-dicarboxylic acid | |
| 14357 | |
| 216.19 | |
| Naphthalene-2,6-dicarboxylic acid |
| >300°C | |
| C12H8O4 | |
| 5 g | |
| 2,6-naphthalenedicarboxylic acid, 2,6-naphthalic acid, 2,6-dicarboxynaphthalene, unii-k3c4dyz29o, 2,6-naphthalene dicarboxylic acid, k3c4dyz29o, dsstox_cid_9211, acmc-2099kj, d06kmp, dsstox_rid_78711 | |
| C1=CC2=C(C=CC(=C2)C(=O)O)C=C1C(=O)O | |
| 216.192 | |
| CHEBI:44460 | |
| ≥98% |
Safety and Handling
EINECSNumber : 214-527-0
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only