Learn More
MOPS (Fine White Crystals/Molecular Biology), Fisher BioReagents™
Commonly used buffering agent
Supplier: Fisher BioReagents BP308500
Description
Commonly used buffering agent
This biological buffer has a usable pH range of 6.5 to 7.9.Specifications
| MOPS | |
| 1132-61-2 | |
| White | |
| 2.5 to 4.0 | |
| 500 g | |
| DNase-, RNase- and Protease-Free | |
| Pass Test | |
| C7H15NO4S | |
| MFCD00006183 | |
| Protease free | |
| 3-(4-Morpholino)propane sulfonic acid | |
| [O-]S(=O)(=O)CCC[NH+]1CCOCC1 | |
| 209.26 | |
| CHEBI:44115 | |
| ≥97% |
| 277°C | |
| 277°C | |
| >277°C | |
| Crystals | |
| DNase free | |
| 3-(4-Morpholino) Propane Sulfonic Acid | |
| ≥97 % | |
| CH2CH2OCH2CH2N(CH2)3SO3H | |
| Poly Bottle | |
| 15, 6352 | |
| DVLFYONBTKHTER-UHFFFAOYSA-N | |
| 3-morpholin-4-ylpropane-1-sulfonic acid | |
| 70807 | |
| 209.26 | |
| Molecular Biology |
Chemical Identifiers
| 1132-61-2 | |
| 209.26 | |
| DVLFYONBTKHTER-UHFFFAOYSA-N | |
| 70807 | |
| 3-morpholin-4-ylpropane-1-sulfonic acid |
| C7H15NO4S | |
| MFCD00006183 | |
| 3-(4-Morpholino)propane sulfonic acid | |
| CHEBI:44115 | |
| [O-]S(=O)(=O)CCC[NH+]1CCOCC1 |
Safety and Handling
WARNING!
Emergency Overview
Causes eye, skin, and respiratory tract irritation. Ensure adequate ventilation. Wash off immediately with plenty of water for at least 15 minutes. Obtain medical attention. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. Obtain medical attention. Do not induce vomiting. Obtain medical attention. . .
NFPA
Health:2
Flammability:1
Instability:0
Recommended Storage : RT