missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Molecular sieves 4A, powder <50 micron
CAS: 70955-01-0 | C20H25FN2O8 | 440.42 g/mol
Supplier: Thermo Scientific Chemicals 214805000
| Quantity | 500 g |
|---|---|
| Packaging | Plastic Bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Drying agentChemical Identifiers
| 70955-01-0 | |
| 440.42 | |
| 73906282 | |
| COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC |
| C20H25FN2O8 | |
| FJUZEZRZKVMAMD-UHFFFAOYNA-N | |
| (2R,3S)-2-[[(2R)-2-acetamido-3-(3-fluorophenyl)propanoyl]amino]-5-methoxy-4-methoxycarbonyl-3-methyl-5-oxopentanoic acid |
Specifications
| Molecular sieves pack 4A beads,8-12 mesh | |
| 9 to 12 (10% water suspension) | |
| Plastic Bottle | |
| 3% max. | |
| 70955-01-0 | |
| MFCD03457537 | |
| FJUZEZRZKVMAMD-UHFFFAOYNA-N | |
| (2R,3S)-2-[[(2R)-2-acetamido-3-(3-fluorophenyl)propanoyl]amino]-5-methoxy-4-methoxycarbonyl-3-methyl-5-oxopentanoic acid | |
| 73906282 |
| White to Beige | |
| 500 g | |
| 18% max. | |
| Beads | |
| C20H25FN2O8 | |
| Solubility in water: insoluble. | |
| COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC | |
| 440.42 |
Safety and Handling
HYGROSCOPIC