missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Molecular Sieves, 4A, Pellets, Dia.: 3.2mm, Honeywell™ Fluka™
Pellets, 3.2 mm diameter
Supplier: Honeywell Chemicals 3342945KG
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Specifications
| Brown | |
| 2g/cm3 | |
| Drum with inliner | |
| Pellets | |
| 400°C | |
| Na12[(AlO2)12(SiO2)12] · xH2O | |
| NONH for all modes of transport | |
| COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC | |
| 440.42 |
| 5 kg | |
| Dia.: 3.2mm | |
| Molecular sieves, 4Å | |
| 70955-01-0 | |
| C20H25FN2O8 | |
| MFCD00131613 | |
| FJUZEZRZKVMAMD-UHFFFAOYNA-N | |
| (2R,3S)-2-[[(2R)-2-acetamido-3-(3-fluorophenyl)propanoyl]amino]-5-methoxy-4-methoxycarbonyl-3-methyl-5-oxopentanoic acid | |
| 73906282 |
Chemical Identifiers
| 70955-01-0 | |
| 440.42 | |
| FJUZEZRZKVMAMD-UHFFFAOYNA-N | |
| (2R,3S)-2-[[(2R)-2-acetamido-3-(3-fluorophenyl)propanoyl]amino]-5-methoxy-4-methoxycarbonyl-3-methyl-5-oxopentanoic acid |
| C20H25FN2O8 | |
| MFCD00131613 | |
| 73906282 | |
| COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC |
Safety and Handling
P261-P305 + P351 + P338