missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Molecular sieves 4A, Cylinders, 3.2mm diameter
CAS: 70955-01-0 | C20H25FN2O8 | 440.42 g/mol
Supplier: Thermo Scientific Chemicals 436730010
| Quantity | 1 kg |
|---|---|
| Packaging | Glass Bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Drying agentChemical Identifiers
| 70955-01-0 | |
| 440.42 | |
| FJUZEZRZKVMAMD-UHFFFAOYNA-N | |
| COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC |
| C20H25FN2O8 | |
| MFCD00131613 | |
| 73906282 |
Specifications
| Beige | |
| Glass Bottle | |
| 650 to 750g/L | |
| > 20% (55% rH, 20°C) | |
| 70955-01-0 | |
| MFCD00131613 | |
| COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC | |
| 440.42 |
| Molecular sieves 4A | |
| 1 kg | |
| < 2% (900°C, 2 hrs.) | |
| Cylinders | |
| C20H25FN2O8 | |
| FJUZEZRZKVMAMD-UHFFFAOYNA-N | |
| Molecular sieves | |
| 73906282 |