missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Molecular sieves 4A, 10 to 18 mesh
CAS: 70955-01-0 | C20H25FN2O8 | 440.42 g/mol
Supplier: Thermo Scientific Chemicals 264750050
| Quantity | 5 kg |
|---|---|
| Packaging | Plastic drum |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Drying agentChemical Identifiers
| 70955-01-0 | |
| 440.42 | |
| FJUZEZRZKVMAMD-UHFFFAOYNA-N | |
| Molecular sieves |
| C20H25FN2O8 | |
| MFCD00131613 | |
| 73906282 | |
| COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC |
Specifications
| Beige | |
| 5 kg | |
| 680 to 760g/L | |
| > 20% (50% rH, 20°C, 24 h) | |
| 70955-01-0 | |
| MFCD00131613 | |
| COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC | |
| 440.42 |
| Molecular sieves 4A | |
| Plastic drum | |
| < 1.5% (550°C, 2 hrs.) | |
| Granules | |
| C20H25FN2O8 | |
| FJUZEZRZKVMAMD-UHFFFAOYNA-N | |
| Molecular sieves | |
| 73906282 |
Safety and Handling
HYGROSCOPIC